Organic Chemistry MCQ Practice Question
1. Which of the following represents an sp3 hybridized carbon?
a) CH2=CH2
b) CH≡CH
c) CH3-CH3
d) C6H6
Answer: c) CH3-CH3
2. What is the IUPAC name for the compound CH3-CH(CH3)-CH2-CH(CH3)-CH3?
a) 2,4-dimethylpentane
b) 2,4-dimethylhexane
c) 3,5-dimethylhexane
d) 3,5-dimethylpentane
Answer: a) 2,4-dimethylpentane
3. Which of the following is an example of an electrophile?
a) OH-
b) NH3
c) CH3-
d) AlCl3
Answer: d) AlCl3
4. What type of reaction is represented by: R-Br + NaOH → R-OH + NaBr?
a) Elimination
b) Addition
c) Substitution
d) Rearrangement
Answer: c) Substitution
5. Which of the following is a strong acid?
a) CH3COOH
b) H2SO4
c) H3PO4
d) H2CO3
Answer: b) H2SO4
6. What is the product of the reaction between propene and HBr?
a) 1-bromopropane
b) 2-bromopropane
c) 1,2-dibromopropane
d) propyl bromide
Answer: b) 2-bromopropane
7. Which of the following is an aromatic compound?
a) Cyclohexane
b) Cyclobutadiene
c) Pyridine
d) Cyclooctatetraene
Answer: c) Pyridine
8. What is the major product of the dehydration of 2-propanol?
a) Propane
b) Propene
c) 1-propanol
d) Propanal
Answer: b) Propene
9. Which mechanism best describes the bromination of benzene?
a) Free radical
b) Nucleophilic addition
c) Electrophilic aromatic substitution
d) Nucleophilic aromatic substitution
Answer: c) Electrophilic aromatic substitution
10. What is the product of the reaction between acetylene and excess HCl?
a) Vinyl chloride
b) Dichloroethane
c) Chloroethane
d) Trichloroethane
Answer: b) Dichloroethane
11. Which of the following is a Brønsted-Lowry base?
a) BF3
b) AlCl3
c) NH3
d) SO3
Answer: c) NH3
12. What type of isomerism is exhibited by 2-butanol and 2-methyl-2-propanol?
a) Geometric isomerism
b) Structural isomerism
c) Conformational isomerism
d) Optical isomerism
Answer: b) Structural isomerism
13. Which reagent would you use to convert an alkene to an alkane?
a) H2/Pt
b) H2O/H+
c) Br2/CCl4
d) KMnO4/H+
Answer: a) H2/Pt
14. What is the product of the reaction between ethanol and sodium metal?
a) Sodium ethoxide
b) Ethyl sodium
c) Sodium acetate
d) Ethyl acetate
Answer: a) Sodium ethoxide
15. Which of the following compounds will react fastest in an SN1 reaction?
a) CH3Cl
b) CH3CH2Cl
c) (CH3)2CHCl
d) (CH3)3CCl
Answer: d) (CH3)3CCl
16. What is the major product of the reaction between propene and H2O/H+?
a) 1-propanol
b) 2-propanol
c) Propanal
d) Propene oxide
Answer: b) 2-propanol
17. Which of the following is not a characteristic of aromatic compounds?
a) Planar structure
b) Delocalized π electrons
c) Follows Hückel's rule
d) High reactivity in addition reactions
Answer: d) High reactivity in addition reactions
18. What type of reaction is represented by the conversion of 2-bromopropane to propene?
a) Substitution
b) Addition
c) Elimination
d) Rearrangement
Answer: c) Elimination
19. Which of the following is the strongest base?
a) CH3COO-
b) NH2-
c) OH-
d) F-
Answer: b) NH2-
20. What is the product of the reaction between benzene and chlorine in the presence of FeCl3?
a) Chlorobenzene
b) Dichlorobenzene
c) Hexachlorobenzene
d) Benzyl chloride
Answer: a) Chlorobenzene
21. Which of the following is not a common method for synthesizing alkenes?
a) Dehydration of alcohols
b) Dehydrohalogenation of alkyl halides
c) Hydrogenation of alkynes
d) Wittig reaction
Answer: c) Hydrogenation of alkynes
22. What is the hybridization of the nitrogen atom in pyridine?
a) sp
b) sp2
c) sp3
d) sp3d
Answer: b) sp2
23. Which of the following reagents would you use to distinguish between an aldehyde and a
ketone?
a) Br2/CCl4
b) H2/Pt
c) Tollens' reagent
d) H2O/H+
Answer: c) Tollens' reagent
24. What is the major product of the reaction between 2-butene and HBr?
a) 1-bromobutane
b) 2-bromobutane
c) 1,2-dibromobutane
d) 2,3-dibromobutane
Answer: b) 2-bromobutane
25. Which of the following is not a method for preparing carboxylic acids?
a) Oxidation of primary alcohols
b) Hydrolysis of nitriles
c) Oxidation of aldehydes
d) Reduction of ketones
Answer: d) Reduction of ketone
26. Which of the following is an example of a nucleophile?
a) H+
b) BF3
c) CN-
d) NO2+
Answer: c) CN-
27. What is the product of the Diels-Alder reaction between 1,3-butadiene and ethene?
a) Cyclohexene
b) Cyclohexane
c) Benzene
d) Cyclobutane
Answer: a) Cyclohexene
28. Which of the following reagents would you use to convert a carboxylic acid to an acid
chloride?
a) NaBH4
b) LiAlH4
c) SOCl2
d) NaOH
Answer: c) SOCl2
29. What is the major product of the reaction between propene and Br2 in water?
a) 1-bromopropane
b) 2-bromopropane
c) 1,2-dibromopropane
d) 1-bromo-2-propanol
Answer: d) 1-bromo-2-propanol
30. Which of the following compounds exhibits the highest boiling point?
a) CH3CH2CH2CH3
b) CH3CH2CH2OH
c) CH3CH2OCH2CH3
d) CH3CH2CHO
Answer: b) CH3CH2CH2OH
31. What type of reaction is represented by the conversion of acetone to 2-propanol?
a) Oxidation
b) Reduction
c) Substitution
d) Elimination
Answer: b) Reduction
32. Which of the following is not a characteristic of an SN2 reaction?
a) Second-order kinetics
b) Inversion of configuration
c) Rearrangement of carbocation intermediate
d) Preference for primary substrates
Answer: c) Rearrangement of carbocation intermediate
33. What is the IUPAC name for the compound CH3-C(CH3)2-CH2-CHO?
a) 3,3-dimethylbutanal
b) 2,2-dimethylpentanal
c) 4,4-dimethylpentanal
d) 3,3-dimethylpentanal
Answer: a) 3,3-dimethylbutanal
34. Which of the following is an example of a Grignard reagent?
a) CH3MgBr
b) CH3Li
c) (CH3)2CuLi
d) CH3ONa
Answer: a) CH3MgBr
35. What is the product of the reaction between ethylene oxide and water in acidic conditions?
a) Ethanol
b) Ethylene glycol
c) Acetaldehyde
d) Acetic acid
Answer: b) Ethylene glycol
36. Which of the following is not a method for preparing ethers?
a) Williamson ether synthesis
b) Dehydration of alcohols
c) Alkoxymercuration-demercuration
d) Nucleophilic addition to carbonyls
Answer: d) Nucleophilic addition to carbonyls
37. What is the major product of the reaction between benzene and propene in the presence of
H2SO4?
a) Ethylbenzene
b) Isopropylbenzene
c) n-propylbenzene
d) tert-butylbenzene
Answer: b) Isopropylbenzene
38. Which of the following is an example of a protecting group for alcohols?
a) Acetyl chloride
b) tert-butyldimethylsilyl chloride (TBDMSCl)
c) Sodium borohydride
d) Potassium permanganate
Answer: b) tert-butyldimethylsilyl chloride (TBDMSCl)
39. What is the product of the reaction between acetylene and two equivalents of HCN?
a) Acrylonitrile
b) Succinonitrile
c) Malononitrile
d) Fumaronitrile
Answer: c) Malononitrile
40. Which of the following compounds would have the highest pKa?
a) Phenol
b) Ethanol
c) Acetic acid
d) Benzoic acid
Answer: b) Ethanol
41. What type of reaction is involved in the conversion of an alkyl halide to a Grignard reagent?
a) Oxidation
b) Reduction
c) Substitution
d) Addition
Answer: b) Reduction
42. Which of the following is not a method for the synthesis of amines?
a) Reduction of nitro compounds
b) Reductive amination
c) Gabriel synthesis
d) Williamson ether synthesis
Answer: d) Williamson ether synthesis
43. What is the major product of the reaction between cyclohexene and m-chloroperoxybenzoic
acid (m-CPBA)?
a) Cyclohexanol
b) Cyclohexanone
c) Cyclohexene oxide
d) Chlorocyclohexane
Answer: c) Cyclohexene oxide
44. Which of the following reagents would you use to convert an aldehyde to a primary alcohol?
a) H2/Pt
b) LiAlH4
c) PCC
d) H2CrO4
Answer: b) LiAlH4
45. What is the product of the Claisen condensation of ethyl acetate?
a) Acetoacetic ester
b) Ethyl propionate
c) Diethyl succinate
d) Ethyl 3-oxobutanoate
Answer: a) Acetoacetic ester
46. Which of the following is an example of a leaving group in nucleophilic substitution
reactions?
a) OH-
b) NH2-
c) Cl-
d) CH3O-
Answer: c) Cl-
47. What is the major product of the reaction between propene and Cl2 in the presence of
water?
a) 1-chloropropane
b) 2-chloropropane
c) 1,2-dichloropropane
d) 1-chloro-2-propanol
Answer: d) 1-chloro-2-propanol
48. Which of the following is not a method for the synthesis of alkyl halides?
a) Addition of HX to alkenes
b) Reaction of alcohols with PBr3
c) Sandmeyer reaction
d) Hydrohalogenation of alkynes
Answer: d) Hydrohalogenation of alkynes
49. What is the product of the reaction between acetone and HCN?
a) 2-hydroxy-2-methylpropanenitrile
b) 2-hydroxypropanenitrile
c) 2-methyl-2-propanol
d) Acetone cyanohydrin
Answer: d) Acetone cyanohydrin (Note: This is the same as option a, but using its common
name)
50. Which of the following compounds would be most reactive in electrophilic aromatic
substitution?
a) Nitrobenzene
b) Toluene
c) Benzene
d) Chlorobenzene
Answer: b) Toluene
26. Which of the following is an example of a nucleophile?
a) H+
b) BF3
c) CN-
d) NO2+
Answer: c) CN-
27. What is the product of the Diels-Alder reaction between 1,3-butadiene and ethene?
a) Cyclohexene
b) Cyclohexane
c) Benzene
d) Cyclobutane
Answer: a) Cyclohexene
28. Which of the following reagents would you use to convert a carboxylic acid to an acid
chloride?
a) NaBH4
b) LiAlH4
c) SOCl2
d) NaOH
Answer: c) SOCl2
29. What is the major product of the reaction between propene and Br2 in water?
a) 1-bromopropane
b) 2-bromopropane
c) 1,2-dibromopropane
d) 1-bromo-2-propanol
Answer: d) 1-bromo-2-propanol
30. Which of the following compounds exhibits the highest boiling point?
a) CH3CH2CH2CH3
b) CH3CH2CH2OH
c) CH3CH2OCH2CH3
d) CH3CH2CHO
Answer: b) CH3CH2CH2OH
31. What type of reaction is represented by the conversion of acetone to 2-propanol?
a) Oxidation
b) Reduction
c) Substitution
d) Elimination
Answer: b) Reduction
32. Which of the following is not a characteristic of an SN2 reaction?
a) Second-order kinetics
b) Inversion of configuration
c) Rearrangement of carbocation intermediate
d) Preference for primary substrates
Answer: c) Rearrangement of carbocation intermediate
33. What is the IUPAC name for the compound CH3-C(CH3)2-CH2-CHO?
a) 3,3-dimethylbutanal
b) 2,2-dimethylpentanal
c) 4,4-dimethylpentanal
d) 3,3-dimethylpentanal
Answer: a) 3,3-dimethylbutanal
34. Which of the following is an example of a Grignard reagent?
a) CH3MgBr
b) CH3Li
c) (CH3)2CuLi
d) CH3ONa
Answer: a) CH3MgBr
35. What is the product of the reaction between ethylene oxide and water in acidic conditions?
a) Ethanol
b) Ethylene glycol
c) Acetaldehyde
d) Acetic acid
Answer: b) Ethylene glycol
36. Which of the following is not a method for preparing ethers?
a) Williamson ether synthesis
b) Dehydration of alcohols
c) Alkoxymercuration-demercuration
d) Nucleophilic addition to carbonyls
Answer: d) Nucleophilic addition to carbonyls
37. What is the major product of the reaction between benzene and propene in the presence of
H2SO4?
a) Ethylbenzene
b) Isopropylbenzene
c) n-propylbenzene
d) tert-butylbenzene
Answer: b) Isopropylbenzene
38. Which of the following is an example of a protecting group for alcohols?
a) Acetyl chloride
b) tert-butyldimethylsilyl chloride (TBDMSCl)
c) Sodium borohydride
d) Potassium permanganate
Answer: b) tert-butyldimethylsilyl chloride (TBDMSCl)
39. What is the product of the reaction between acetylene and two equivalents of HCN?
a) Acrylonitrile
b) Succinonitrile
c) Malononitrile
d) Fumaronitrile
Answer: c) Malononitrile
40. Which of the following compounds would have the highest pKa?
a) Phenol
b) Ethanol
c) Acetic acid
d) Benzoic acid
Answer: b) Ethanol
41. What type of reaction is involved in the conversion of an alkyl halide to a Grignard reagent?
a) Oxidation
b) Reduction
c) Substitution
d) Addition
Answer: b) Reduction
42. Which of the following is not a method for the synthesis of amines?
a) Reduction of nitro compounds
b) Reductive amination
c) Gabriel synthesis
d) Williamson ether synthesis
Answer: d) Williamson ether synthesis
43. What is the major product of the reaction between cyclohexene and m-chloroperoxybenzoic
acid (m-CPBA)?
a) Cyclohexanol
b) Cyclohexanone
c) Cyclohexene oxide
d) Chlorocyclohexane
Answer: c) Cyclohexene oxide
44. Which of the following reagents would you use to convert an aldehyde to a primary alcohol?
a) H2/Pt
b) LiAlH4
c) PCC
d) H2CrO4
Answer: b) LiAlH4
45. What is the product of the Claisen condensation of ethyl acetate?
a) Acetoacetic ester
b) Ethyl propionate
c) Diethyl succinate
d) Ethyl 3-oxobutanoate
Answer: a) Acetoacetic ester
46. Which of the following is an example of a leaving group in nucleophilic substitution
reactions?
a) OH-
b) NH2-
c) Cl-
d) CH3O-
Answer: c) Cl-
47. What is the major product of the reaction between propene and Cl2 in the presence of
water?
a) 1-chloropropane
b) 2-chloropropane
c) 1,2-dichloropropane
d) 1-chloro-2-propanol
Answer: d) 1-chloro-2-propanol
48. Which of the following is not a method for the synthesis of alkyl halides?
a) Addition of HX to alkenes
b) Reaction of alcohols with PBr3
c) Sandmeyer reaction
d) Hydrohalogenation of alkynes
Answer: d) Hydrohalogenation of alkynes
49. What is the product of the reaction between acetone and HCN?
a) 2-hydroxy-2-methylpropanenitrile
b) 2-hydroxypropanenitrile
c) 2-methyl-2-propanol
d) Acetone cyanohydrin
Answer: d) Acetone cyanohydrin (Note: This is the same as option a, but using its common
name)
50. Which of the following compounds would be most reactive in electrophilic aromatic
substitution?
a) Nitrobenzene
b) Toluene
c) Benzene
d) Chlorobenzene
Answer: b) Toluene
1. What is the de Broglie wavelength equation?
a) λ = h/p
b) λ = h/mv
c) λ = hc/E
d) λ = h/E
Answer: a) λ = h/p
2. Which of the following is not a postulate of the Bohr model?
a) Electrons orbit the nucleus in circular orbits
b) Electrons can have any energy
c) Atoms emit radiation when electrons jump from higher to lower energy levels
d) Angular momentum of electrons is quantized
Answer: b) Electrons can have any energy
3. What does the Schrödinger equation describe?
a) The motion of particles
b) The wave function of a quantum system
c) The uncertainty principle
d) The photoelectric effect
Answer: b) The wave function of a quantum system
4. Which quantum number describes the shape of an orbital?
a) n (principal quantum number)
b) l (angular momentum quantum number)
c) ml (magnetic quantum number)
d) ms (spin quantum number)
Answer: b) l (angular momentum quantum number)
5. What is the maximum number of electrons that can occupy a p subshell?
a) 2
b) 6
c) 10
d) 14
Answer: b) 6
6. Which of the following is true about the wave function (ψ)?
a) It has a direct physical meaning
b) Its square gives the probability density
c) It can be directly measured
d) It is always real-valued
Answer: b) Its square gives the probability density
7. What is the ground state electron configuration of carbon?
a) 1s² 2s² 2p¹
b) 1s² 2s² 2p²
c) 1s² 2s¹ 2p³
d) 1s² 2s² 2p⁴
Answer: b) 1s² 2s² 2p²
8. Which of the following is not a valid combination of quantum numbers for an electron in a 3d
orbital?
a) n=3, l=2, ml=0, ms=+1/2
b) n=3, l=2, ml=+1, ms=-1/2
c) n=3, l=2, ml=+3, ms=+1/2
d) n=3, l=2, ml=-2, ms=-1/2
Answer: c) n=3, l=2, ml=+3, ms=+1/2
9. What is the energy of a photon with a wavelength of 500 nm?
a) 2.48 eV
b) 3.98 eV
c) 1.24 eV
d) 4.96 eV
Answer: a) 2.48 eV
10. Which of the following best describes the Pauli exclusion principle?
a) No two electrons in an atom can have the same set of quantum numbers
b) Electrons can only occupy certain energy levels
c) The total angular momentum of an electron is quantized
d) The energy of an electron is inversely proportional to its wavelength
Answer: a) No two electrons in an atom can have the same set of quantum numbers
11. What is the hybridization of the carbon atom in methane (CH )?₄
a) sp
b) sp²
c) sp³
d) unhybridized
Answer: c) sp³
amson ether synthesis
b) Dehydration of alcohols
c) Alkoxymercuration-demercuration
d) Nucleophilic addition to carbonyls
Answer: d) Nucleophilic addition to carbonyls
37. What is the major product of the reaction between benzene and propene in the presence of
H2SO4?
a) Ethylbenzene
b) Isopropylbenzene
c) n-propylbenzene
d) tert-butylbenzene
Answer: b) Isopropylbenzene
38. Which of the following is an example of a protecting group for alcohols?
a) Acetyl chloride
b) tert-butyldimethylsilyl chloride (TBDMSCl)
c) Sodium borohydride
d) Potassium permanganate
Answer: b) tert-butyldimethylsilyl chloride (TBDMSCl)
39. What is the product of the reaction between acetylene and two equivalents of HCN?
a) Acrylonitrile
b) Succinonitrile
c) Malononitrile
d) Fumaronitrile
Answer: c) Malononitrile
40. Which of the following compounds would have the highest pKa?
a) Phenol
b) Ethanol
c) Acetic acid
d) Benzoic acid
Answer: b) Ethanol
41. What type of reaction is involved in the conversion of an alkyl halide to a Grignard reagent?
a) Oxidation
b) Reduction
c) Substitution
d) Addition
Answer: b) Reduction
42. Which of the following is not a method for the synthesis of amines?
a) Reduction of nitro compounds
b) Reductive amination
c) Gabriel synthesis
d) Williamson ether synthesis
Answer: d) Williamson ether synthesis
43. What is the major product of the reaction between cyclohexene and m-chloroperoxybenzoic
acid (m-CPBA)?
a) Cyclohexanol
b) Cyclohexanone
c) Cyclohexene oxide
d) Chlorocyclohexane
Answer: c) Cyclohexene oxide
44. Which of the following reagents would you use to convert an aldehyde to a primary alcohol?
a) H2/Pt
b) LiAlH4
c) PCC
d) H2CrO4
Answer: b) LiAlH4
45. What is the product of the Claisen condensation of ethyl acetate?
a) Acetoacetic ester
b) Ethyl propionate
c) Diethyl succinate
d) Ethyl 3-oxobutanoate
Answer: a) Acetoacetic ester
46. Which of the following is an example of a leaving group in nucleophilic substitution
reactions?
a) OH-
b) NH2-
c) Cl-
d) CH3O-
Answer: c) Cl-
47. What is the major product of the reaction between propene and Cl2 in the presence of
water?
a) 1-chloropropane
b) 2-chloropropane
c) 1,2-dichloropropane
d) 1-chloro-2-propanol
Answer: d) 1-chloro-2-propanol
48. Which of the following is not a method for the synthesis of alkyl halides?
a) Addition of HX to alkenes
b) Reaction of alcohols with PBr3
c) Sandmeyer reaction
d) Hydrohalogenation of alkynes
Answer: d) Hydrohalogenation of alkynes
49. What is the product of the reaction between acetone and HCN?
a) 2-hydroxy-2-methylpropanenitrile
b) 2-hydroxypropanenitrile
c) 2-methyl-2-propanol
d) Acetone cyanohydrin
Answer: d) Acetone cyanohydrin (Note: This is the same as option a, but using its common
name)
50. Which of the following compounds would be most reactive in electrophilic aromatic
substitution?
a) Nitrobenzene
b) Toluene
c) Benzene
d) Chlorobenzene
Answer: b) Toluene
26. Which of the following is an example of a nucleophile?
a) H+
b) BF3
c) CN-
d) NO2+
Answer: c) CN-
27. What is the product of the Diels-Alder reaction between 1,3-butadiene and ethene?
a) Cyclohexene
b) Cyclohexane
c) Benzene
d) Cyclobutane
Answer: a) Cyclohexene
28. Which of the following reagents would you use to convert a carboxylic acid to an acid
chloride?
a) NaBH4
b) LiAlH4
c) SOCl2
d) NaOH
Answer: c) SOCl2
29. What is the major product of the reaction between propene and Br2 in water?
a) 1-bromopropane
b) 2-bromopropane
c) 1,2-dibromopropane
d) 1-bromo-2-propanol
Answer: d) 1-bromo-2-propanol
30. Which of the following compounds exhibits the highest boiling point?
a) CH3CH2CH2CH3
b) CH3CH2CH2OH
c) CH3CH2OCH2CH3
d) CH3CH2CHO
Answer: b) CH3CH2CH2OH
31. What type of reaction is represented by the conversion of acetone to 2-propanol?
a) Oxidation
b) Reduction
c) Substitution
d) Elimination
Answer: b) Reduction
32. Which of the following is not a characteristic of an SN2 reaction?
a) Second-order kinetics
b) Inversion of configuration
c) Rearrangement of carbocation intermediate
d) Preference for primary substrates
Answer: c) Rearrangement of carbocation intermediate
33. What is the IUPAC name for the compound CH3-C(CH3)2-CH2-CHO?
a) 3,3-dimethylbutanal
b) 2,2-dimethylpentanal
c) 4,4-dimethylpentanal
d) 3,3-dimethylpentanal
Answer: a) 3,3-dimethylbutanal
34. Which of the following is an example of a Grignard reagent?
a) CH3MgBr
b) CH3Li
c) (CH3)2CuLi
d) CH3ONa
Answer: a) CH3MgBr
35. What is the product of the reaction between ethylene oxide and water in acidic conditions?
a) Ethanol
b) Ethylene glycol
c) Acetaldehyde
d) Acetic acid
Answer: b) Ethylene glycol
36. Which of the following is not a method for preparing ethers?
a) Williamson ether synthesis
b) Dehydration of alcohols
c) Alkoxymercuration-demercuration
d) Nucleophilic addition to carbonyls
Answer: d) Nucleophilic addition to carbonyls
37. What is the major product of the reaction between benzene and propene in the presence of
H2SO4?
a) Ethylbenzene
b) Isopropylbenzene
c) n-propylbenzene
d) tert-butylbenzene
Answer: b) Isopropylbenzene
38. Which of the following is an example of a protecting group for alcohols?
a) Acetyl chloride
b) tert-butyldimethylsilyl chloride (TBDMSCl)
c) Sodium borohydride
d) Potassium permanganate
Answer: b) tert-butyldimethylsilyl chloride (TBDMSCl)
39. What is the product of the reaction between acetylene and two equivalents of HCN?
a) Acrylonitrile
b) Succinonitrile
c) Malononitrile
d) Fumaronitrile
Answer: c) Malononitrile
40. Which of the following compounds would have the highest pKa?
a) Phenol
b) Ethanol
c) Acetic acid
d) Benzoic acid
Answer: b) Ethanol
41. What type of reaction is involved in the conversion of an alkyl halide to a Grignard reagent?
a) Oxidation
b) Reduction
c) Substitution
d) Addition
Answer: b) Reduction
42. Which of the following is not a method for the synthesis of amines?
a) Reduction of nitro compounds
b) Reductive amination
c) Gabriel synthesis
d) Williamson ether synthesis
Answer: d) Williamson ether synthesis
43. What is the major product of the reaction between cyclohexene and m-chloroperoxybenzoic
acid (m-CPBA)?
a) Cyclohexanol
b) Cyclohexanone
c) Cyclohexene oxide
d) Chlorocyclohexane
Answer: c) Cyclohexene oxide
44. Which of the following reagents would you use to convert an aldehyde to a primary alcohol?
a) H2/Pt
b) LiAlH4
c) PCC
d) H2CrO4
Answer: b) LiAlH4
45. What is the product of the Claisen condensation of ethyl acetate?
a) Acetoacetic ester
b) Ethyl propionate
c) Diethyl succinate
d) Ethyl 3-oxobutanoate
Answer: a) Acetoacetic ester
46. Which of the following is an example of a leaving group in nucleophilic substitution
reactions?
a) OH-
b) NH2-
c) Cl-
d) CH3O-
Answer: c) Cl-
47. What is the major product of the reaction between propene and Cl2 in the presence of
water?
a) 1-chloropropane
b) 2-chloropropane
c) 1,2-dichloropropane
d) 1-chloro-2-propanol
Answer: d) 1-chloro-2-propanol
48. Which of the following is not a method for the synthesis of alkyl halides?
a) Addition of HX to alkenes
b) Reaction of alcohols with PBr3
c) Sandmeyer reaction
d) Hydrohalogenation of alkynes
Answer: d) Hydrohalogenation of alkynes
49. What is the product of the reaction between acetone and HCN?
a) 2-hydroxy-2-methylpropanenitrile
b) 2-hydroxypropanenitrile
c) 2-methyl-2-propanol
d) Acetone cyanohydrin
Answer: d) Acetone cyanohydrin (Note: This is the same as option a, but using its common
name)
50. Which of the following compounds would be most reactive in electrophilic aromatic
substitution?
a) Nitrobenzene
b) Toluene
c) Benzene
d) Chlorobenzene
Answer: b) Toluene
1. What is the de Broglie wavelength equation?
a) λ = h/p
b) λ = h/mv
c) λ = hc/E
d) λ = h/E
Answer: a) λ = h/p
2. Which of the following is not a postulate of the Bohr model?
a) Electrons orbit the nucleus in circular orbits
b) Electrons can have any energy
c) Atoms emit radiation when electrons jump from higher to lower energy levels
d) Angular momentum of electrons is quantized
Answer: b) Electrons can have any energy
3. What does the Schrödinger equation describe?
a) The motion of particles
b) The wave function of a quantum system
c) The uncertainty principle
d) The photoelectric effect
Answer: b) The wave function of a quantum system
4. Which quantum number describes the shape of an orbital?
a) n (principal quantum number)
b) l (angular momentum quantum number)
c) ml (magnetic quantum number)
d) ms (spin quantum number)
Answer: b) l (angular momentum quantum number)
5. What is the maximum number of electrons that can occupy a p subshell?
a) 2
b) 6
c) 10
d) 14
Answer: b) 6
6. Which of the following is true about the wave function (ψ)?
a) It has a direct physical meaning
b) Its square gives the probability density
c) It can be directly measured
d) It is always real-valued
Answer: b) Its square gives the probability density
7. What is the ground state electron configuration of carbon?
a) 1s² 2s² 2p¹
b) 1s² 2s² 2p²
c) 1s² 2s¹ 2p³
d) 1s² 2s² 2p⁴
Answer: b) 1s² 2s² 2p²
8. Which of the following is not a valid combination of quantum numbers for an electron in a 3d
orbital?
a) n=3, l=2, ml=0, ms=+1/2
b) n=3, l=2, ml=+1, ms=-1/2
c) n=3, l=2, ml=+3, ms=+1/2
d) n=3, l=2, ml=-2, ms=-1/2
Answer: c) n=3, l=2, ml=+3, ms=+1/2
9. What is the energy of a photon with a wavelength of 500 nm?
a) 2.48 eV
b) 3.98 eV
c) 1.24 eV
d) 4.96 eV
Answer: a) 2.48 eV
10. Which of the following best describes the Pauli exclusion principle?
a) No two electrons in an atom can have the same set of quantum numbers
b) Electrons can only occupy certain energy levels
c) The total angular momentum of an electron is quantized
d) The energy of an electron is inversely proportional to its wavelength
Answer: a) No two electrons in an atom can have the same set of quantum numbers
11. What is the hybridization of the carbon atom in methane (CH )?₄
a) sp
b) sp²
c) sp³
d) unhybridized
Answer: c) sp³
amson ether synthesis
b) Dehydration of alcohols
c) Alkoxymercuration-demercuration
d) Nucleophilic addition to carbonyls
Answer: d) Nucleophilic addition to carbonyls
37. What is the major product of the reaction between benzene and propene in the presence of
H2SO4?
a) Ethylbenzene
b) Isopropylbenzene
c) n-propylbenzene
d) tert-butylbenzene
Answer: b) Isopropylbenzene
38. Which of the following is an example of a protecting group for alcohols?
a) Acetyl chloride
b) tert-butyldimethylsilyl chloride (TBDMSCl)
c) Sodium borohydride
d) Potassium permanganate
Answer: b) tert-butyldimethylsilyl chloride (TBDMSCl)
39. What is the product of the reaction between acetylene and two equivalents of HCN?
a) Acrylonitrile
b) Succinonitrile
c) Malononitrile
d) Fumaronitrile
Answer: c) Malononitrile
40. Which of the following compounds would have the highest pKa?
a) Phenol
b) Ethanol
c) Acetic acid
d) Benzoic acid
Answer: b) Ethanol
41. What type of reaction is involved in the conversion of an alkyl halide to a Grignard reagent?
a) Oxidation
b) Reduction
c) Substitution
d) Addition
Answer: b) Reduction
42. Which of the following is not a method for the synthesis of amines?
a) Reduction of nitro compounds
b) Reductive amination
c) Gabriel synthesis
d) Williamson ether synthesis
Answer: d) Williamson ether synthesis
43. What is the major product of the reaction between cyclohexene and m-chloroperoxybenzoic
acid (m-CPBA)?
a) Cyclohexanol
b) Cyclohexanone
c) Cyclohexene oxide
d) Chlorocyclohexane
Answer: c) Cyclohexene oxide
44. Which of the following reagents would you use to convert an aldehyde to a primary alcohol?
a) H2/Pt
b) LiAlH4
c) PCC
d) H2CrO4
Answer: b) LiAlH4
45. What is the product of the Claisen condensation of ethyl acetate?
a) Acetoacetic ester
b) Ethyl propionate
c) Diethyl succinate
d) Ethyl 3-oxobutanoate
Answer: a) Acetoacetic ester
46. Which of the following is an example of a leaving group in nucleophilic substitution
reactions?
a) OH-
b) NH2-
c) Cl-
d) CH3O-
Answer: c) Cl-
47. What is the major product of the reaction between propene and Cl2 in the presence of
water?
a) 1-chloropropane
b) 2-chloropropane
c) 1,2-dichloropropane
d) 1-chloro-2-propanol
Answer: d) 1-chloro-2-propanol
48. Which of the following is not a method for the synthesis of alkyl halides?
a) Addition of HX to alkenes
b) Reaction of alcohols with PBr3
c) Sandmeyer reaction
d) Hydrohalogenation of alkynes
Answer: d) Hydrohalogenation of alkynes
49. What is the product of the reaction between acetone and HCN?
a) 2-hydroxy-2-methylpropanenitrile
b) 2-hydroxypropanenitrile
c) 2-methyl-2-propanol
d) Acetone cyanohydrin
Answer: d) Acetone cyanohydrin (Note: This is the same as option a, but using its common
name)
50. Which of the following compounds would be most reactive in electrophilic aromatic
substitution?
a) Nitrobenzene
b) Toluene
c) Benzene
d) Chlorobenzene
Answer: b) Toluene
26. Which of the following is an example of a nucleophile?
a) H+
b) BF3
c) CN-
d) NO2+
Answer: c) CN-
27. What is the product of the Diels-Alder reaction between 1,3-butadiene and ethene?
a) Cyclohexene
b) Cyclohexane
c) Benzene
d) Cyclobutane
Answer: a) Cyclohexene
28. Which of the following reagents would you use to convert a carboxylic acid to an acid
chloride?
a) NaBH4
b) LiAlH4
c) SOCl2
d) NaOH
Answer: c) SOCl2
29. What is the major product of the reaction between propene and Br2 in water?
a) 1-bromopropane
b) 2-bromopropane
c) 1,2-dibromopropane
d) 1-bromo-2-propanol
Answer: d) 1-bromo-2-propanol
30. Which of the following compounds exhibits the highest boiling point?
a) CH3CH2CH2CH3
b) CH3CH2CH2OH
c) CH3CH2OCH2CH3
d) CH3CH2CHO
Answer: b) CH3CH2CH2OH
31. What type of reaction is represented by the conversion of acetone to 2-propanol?
a) Oxidation
b) Reduction
c) Substitution
d) Elimination
Answer: b) Reduction
32. Which of the following is not a characteristic of an SN2 reaction?
a) Second-order kinetics
b) Inversion of configuration
c) Rearrangement of carbocation intermediate
d) Preference for primary substrates
Answer: c) Rearrangement of carbocation intermediate
33. What is the IUPAC name for the compound CH3-C(CH3)2-CH2-CHO?
a) 3,3-dimethylbutanal
b) 2,2-dimethylpentanal
c) 4,4-dimethylpentanal
d) 3,3-dimethylpentanal
Answer: a) 3,3-dimethylbutanal
34. Which of the following is an example of a Grignard reagent?
a) CH3MgBr
b) CH3Li
c) (CH3)2CuLi
d) CH3ONa
Answer: a) CH3MgBr
35. What is the product of the reaction between ethylene oxide and water in acidic conditions?
a) Ethanol
b) Ethylene glycol
c) Acetaldehyde
d) Acetic acid
Answer: b) Ethylene glycol
36. Which of the following is not a method for preparing ethers?
a) Williamson ether synthesis
b) Dehydration of alcohols
c) Alkoxymercuration-demercuration
d) Nucleophilic addition to carbonyls
Answer: d) Nucleophilic addition to carbonyls
37. What is the major product of the reaction between benzene and propene in the presence of
H2SO4?
a) Ethylbenzene
b) Isopropylbenzene
c) n-propylbenzene
d) tert-butylbenzene
Answer: b) Isopropylbenzene
38. Which of the following is an example of a protecting group for alcohols?
a) Acetyl chloride
b) tert-butyldimethylsilyl chloride (TBDMSCl)
c) Sodium borohydride
d) Potassium permanganate
Answer: b) tert-butyldimethylsilyl chloride (TBDMSCl)
39. What is the product of the reaction between acetylene and two equivalents of HCN?
a) Acrylonitrile
b) Succinonitrile
c) Malononitrile
d) Fumaronitrile
Answer: c) Malononitrile
40. Which of the following compounds would have the highest pKa?
a) Phenol
b) Ethanol
c) Acetic acid
d) Benzoic acid
Answer: b) Ethanol
41. What type of reaction is involved in the conversion of an alkyl halide to a Grignard reagent?
a) Oxidation
b) Reduction
c) Substitution
d) Addition
Answer: b) Reduction
42. Which of the following is not a method for the synthesis of amines?
a) Reduction of nitro compounds
b) Reductive amination
c) Gabriel synthesis
d) Williamson ether synthesis
Answer: d) Williamson ether synthesis
43. What is the major product of the reaction between cyclohexene and m-chloroperoxybenzoic
acid (m-CPBA)?
a) Cyclohexanol
b) Cyclohexanone
c) Cyclohexene oxide
d) Chlorocyclohexane
Answer: c) Cyclohexene oxide
44. Which of the following reagents would you use to convert an aldehyde to a primary alcohol?
a) H2/Pt
b) LiAlH4
c) PCC
d) H2CrO4
Answer: b) LiAlH4
45. What is the product of the Claisen condensation of ethyl acetate?
a) Acetoacetic ester
b) Ethyl propionate
c) Diethyl succinate
d) Ethyl 3-oxobutanoate
Answer: a) Acetoacetic ester
46. Which of the following is an example of a leaving group in nucleophilic substitution
reactions?
a) OH-
b) NH2-
c) Cl-
d) CH3O-
Answer: c) Cl-
47. What is the major product of the reaction between propene and Cl2 in the presence of
water?
a) 1-chloropropane
b) 2-chloropropane
c) 1,2-dichloropropane
d) 1-chloro-2-propanol
Answer: d) 1-chloro-2-propanol
48. Which of the following is not a method for the synthesis of alkyl halides?
a) Addition of HX to alkenes
b) Reaction of alcohols with PBr3
c) Sandmeyer reaction
d) Hydrohalogenation of alkynes
Answer: d) Hydrohalogenation of alkynes
49. What is the product of the reaction between acetone and HCN?
a) 2-hydroxy-2-methylpropanenitrile
b) 2-hydroxypropanenitrile
c) 2-methyl-2-propanol
d) Acetone cyanohydrin
Answer: d) Acetone cyanohydrin (Note: This is the same as option a, but using its common
name)
50. Which of the following compounds would be most reactive in electrophilic aromatic
substitution?
a) Nitrobenzene
b) Toluene
c) Benzene
d) Chlorobenzene
Answer: b) Toluene
1. What is the de Broglie wavelength equation?
a) λ = h/p
b) λ = h/mv
c) λ = hc/E
d) λ = h/E
Answer: a) λ = h/p
2. Which of the following is not a postulate of the Bohr model?
a) Electrons orbit the nucleus in circular orbits
b) Electrons can have any energy
c) Atoms emit radiation when electrons jump from higher to lower energy levels
d) Angular momentum of electrons is quantized
Answer: b) Electrons can have any energy
3. What does the Schrödinger equation describe?
a) The motion of particles
b) The wave function of a quantum system
c) The uncertainty principle
d) The photoelectric effect
Answer: b) The wave function of a quantum system
4. Which quantum number describes the shape of an orbital?
a) n (principal quantum number)
b) l (angular momentum quantum number)
c) ml (magnetic quantum number)
d) ms (spin quantum number)
Answer: b) l (angular momentum quantum number)
5. What is the maximum number of electrons that can occupy a p subshell?
a) 2
b) 6
c) 10
d) 14
Answer: b) 6
6. Which of the following is true about the wave function (ψ)?
a) It has a direct physical meaning
b) Its square gives the probability density
c) It can be directly measured
d) It is always real-valued
Answer: b) Its square gives the probability density
7. What is the ground state electron configuration of carbon?
a) 1s² 2s² 2p¹
b) 1s² 2s² 2p²
c) 1s² 2s¹ 2p³
d) 1s² 2s² 2p⁴
Answer: b) 1s² 2s² 2p²
8. Which of the following is not a valid combination of quantum numbers for an electron in a 3d
orbital?
a) n=3, l=2, ml=0, ms=+1/2
b) n=3, l=2, ml=+1, ms=-1/2
c) n=3, l=2, ml=+3, ms=+1/2
d) n=3, l=2, ml=-2, ms=-1/2
Answer: c) n=3, l=2, ml=+3, ms=+1/2
9. What is the energy of a photon with a wavelength of 500 nm?
a) 2.48 eV
b) 3.98 eV
c) 1.24 eV
d) 4.96 eV
Answer: a) 2.48 eV
10. Which of the following best describes the Pauli exclusion principle?
a) No two electrons in an atom can have the same set of quantum numbers
b) Electrons can only occupy certain energy levels
c) The total angular momentum of an electron is quantized
d) The energy of an electron is inversely proportional to its wavelength
Answer: a) No two electrons in an atom can have the same set of quantum numbers
11. What is the hybridization of the carbon atom in methane (CH )?₄
a) sp
b) sp²
c) sp³
d) unhybridized
Answer: c) sp³
amson ether synthesis
b) Dehydration of alcohols
c) Alkoxymercuration-demercuration
d) Nucleophilic addition to carbonyls
Answer: d) Nucleophilic addition to carbonyls
37. What is the major product of the reaction between benzene and propene in the presence of
H2SO4?
a) Ethylbenzene
b) Isopropylbenzene
c) n-propylbenzene
d) tert-butylbenzene
Answer: b) Isopropylbenzene
38. Which of the following is an example of a protecting group for alcohols?
a) Acetyl chloride
b) tert-butyldimethylsilyl chloride (TBDMSCl)
c) Sodium borohydride
d) Potassium permanganate
Answer: b) tert-butyldimethylsilyl chloride (TBDMSCl)
39. What is the product of the reaction between acetylene and two equivalents of HCN?
a) Acrylonitrile
b) Succinonitrile
c) Malononitrile
d) Fumaronitrile
Answer: c) Malononitrile
40. Which of the following compounds would have the highest pKa?
a) Phenol
b) Ethanol
c) Acetic acid
d) Benzoic acid
Answer: b) Ethanol
41. What type of reaction is involved in the conversion of an alkyl halide to a Grignard reagent?
a) Oxidation
b) Reduction
c) Substitution
d) Addition
Answer: b) Reduction
42. Which of the following is not a method for the synthesis of amines?
a) Reduction of nitro compounds
b) Reductive amination
c) Gabriel synthesis
d) Williamson ether synthesis
Answer: d) Williamson ether synthesis
43. What is the major product of the reaction between cyclohexene and m-chloroperoxybenzoic
acid (m-CPBA)?
a) Cyclohexanol
b) Cyclohexanone
c) Cyclohexene oxide
d) Chlorocyclohexane
Answer: c) Cyclohexene oxide
44. Which of the following reagents would you use to convert an aldehyde to a primary alcohol?
a) H2/Pt
b) LiAlH4
c) PCC
d) H2CrO4
Answer: b) LiAlH4
45. What is the product of the Claisen condensation of ethyl acetate?
a) Acetoacetic ester
b) Ethyl propionate
c) Diethyl succinate
d) Ethyl 3-oxobutanoate
Answer: a) Acetoacetic ester
46. Which of the following is an example of a leaving group in nucleophilic substitution
reactions?
a) OH-
b) NH2-
c) Cl-
d) CH3O-
Answer: c) Cl-
47. What is the major product of the reaction between propene and Cl2 in the presence of
water?
a) 1-chloropropane
b) 2-chloropropane
c) 1,2-dichloropropane
d) 1-chloro-2-propanol
Answer: d) 1-chloro-2-propanol
48. Which of the following is not a method for the synthesis of alkyl halides?
a) Addition of HX to alkenes
b) Reaction of alcohols with PBr3
c) Sandmeyer reaction
d) Hydrohalogenation of alkynes
Answer: d) Hydrohalogenation of alkynes
49. What is the product of the reaction between acetone and HCN?
a) 2-hydroxy-2-methylpropanenitrile
b) 2-hydroxypropanenitrile
c) 2-methyl-2-propanol
d) Acetone cyanohydrin
Answer: d) Acetone cyanohydrin (Note: This is the same as option a, but using its common
name)
50. Which of the following compounds would be most reactive in electrophilic aromatic
substitution?
a) Nitrobenzene
b) Toluene
c) Benzene
d) Chlorobenzene
Answer: b) Toluene
26. Which of the following is an example of a nucleophile?
a) H+
b) BF3
c) CN-
d) NO2+
Answer: c) CN-
27. What is the product of the Diels-Alder reaction between 1,3-butadiene and ethene?
a) Cyclohexene
b) Cyclohexane
c) Benzene
d) Cyclobutane
Answer: a) Cyclohexene
28. Which of the following reagents would you use to convert a carboxylic acid to an acid
chloride?
a) NaBH4
b) LiAlH4
c) SOCl2
d) NaOH
Answer: c) SOCl2
29. What is the major product of the reaction between propene and Br2 in water?
a) 1-bromopropane
b) 2-bromopropane
c) 1,2-dibromopropane
d) 1-bromo-2-propanol
Answer: d) 1-bromo-2-propanol
30. Which of the following compounds exhibits the highest boiling point?
a) CH3CH2CH2CH3
b) CH3CH2CH2OH
c) CH3CH2OCH2CH3
d) CH3CH2CHO
Answer: b) CH3CH2CH2OH
31. What type of reaction is represented by the conversion of acetone to 2-propanol?
a) Oxidation
b) Reduction
c) Substitution
d) Elimination
Answer: b) Reduction
32. Which of the following is not a characteristic of an SN2 reaction?
a) Second-order kinetics
b) Inversion of configuration
c) Rearrangement of carbocation intermediate
d) Preference for primary substrates
Answer: c) Rearrangement of carbocation intermediate
33. What is the IUPAC name for the compound CH3-C(CH3)2-CH2-CHO?
a) 3,3-dimethylbutanal
b) 2,2-dimethylpentanal
c) 4,4-dimethylpentanal
d) 3,3-dimethylpentanal
Answer: a) 3,3-dimethylbutanal
34. Which of the following is an example of a Grignard reagent?
a) CH3MgBr
b) CH3Li
c) (CH3)2CuLi
d) CH3ONa
Answer: a) CH3MgBr
35. What is the product of the reaction between ethylene oxide and water in acidic conditions?
a) Ethanol
b) Ethylene glycol
c) Acetaldehyde
d) Acetic acid
Answer: b) Ethylene glycol
36. Which of the following is not a method for preparing ethers?
a) Williamson ether synthesis
b) Dehydration of alcohols
c) Alkoxymercuration-demercuration
d) Nucleophilic addition to carbonyls
Answer: d) Nucleophilic addition to carbonyls
37. What is the major product of the reaction between benzene and propene in the presence of
H2SO4?
a) Ethylbenzene
b) Isopropylbenzene
c) n-propylbenzene
d) tert-butylbenzene
Answer: b) Isopropylbenzene
38. Which of the following is an example of a protecting group for alcohols?
a) Acetyl chloride
b) tert-butyldimethylsilyl chloride (TBDMSCl)
c) Sodium borohydride
d) Potassium permanganate
Answer: b) tert-butyldimethylsilyl chloride (TBDMSCl)
39. What is the product of the reaction between acetylene and two equivalents of HCN?
a) Acrylonitrile
b) Succinonitrile
c) Malononitrile
d) Fumaronitrile
Answer: c) Malononitrile
40. Which of the following compounds would have the highest pKa?
a) Phenol
b) Ethanol
c) Acetic acid
d) Benzoic acid
Answer: b) Ethanol
41. What type of reaction is involved in the conversion of an alkyl halide to a Grignard reagent?
a) Oxidation
b) Reduction
c) Substitution
d) Addition
Answer: b) Reduction
42. Which of the following is not a method for the synthesis of amines?
a) Reduction of nitro compounds
b) Reductive amination
c) Gabriel synthesis
d) Williamson ether synthesis
Answer: d) Williamson ether synthesis
43. What is the major product of the reaction between cyclohexene and m-chloroperoxybenzoic
acid (m-CPBA)?
a) Cyclohexanol
b) Cyclohexanone
c) Cyclohexene oxide
d) Chlorocyclohexane
Answer: c) Cyclohexene oxide
44. Which of the following reagents would you use to convert an aldehyde to a primary alcohol?
a) H2/Pt
b) LiAlH4
c) PCC
d) H2CrO4
Answer: b) LiAlH4
45. What is the product of the Claisen condensation of ethyl acetate?
a) Acetoacetic ester
b) Ethyl propionate
c) Diethyl succinate
d) Ethyl 3-oxobutanoate
Answer: a) Acetoacetic ester
46. Which of the following is an example of a leaving group in nucleophilic substitution
reactions?
a) OH-
b) NH2-
c) Cl-
d) CH3O-
Answer: c) Cl-
47. What is the major product of the reaction between propene and Cl2 in the presence of
water?
a) 1-chloropropane
b) 2-chloropropane
c) 1,2-dichloropropane
d) 1-chloro-2-propanol
Answer: d) 1-chloro-2-propanol
48. Which of the following is not a method for the synthesis of alkyl halides?
a) Addition of HX to alkenes
b) Reaction of alcohols with PBr3
c) Sandmeyer reaction
d) Hydrohalogenation of alkynes
Answer: d) Hydrohalogenation of alkynes
49. What is the product of the reaction between acetone and HCN?
a) 2-hydroxy-2-methylpropanenitrile
b) 2-hydroxypropanenitrile
c) 2-methyl-2-propanol
d) Acetone cyanohydrin
Answer: d) Acetone cyanohydrin (Note: This is the same as option a, but using its common
name)
50. Which of the following compounds would be most reactive in electrophilic aromatic
substitution?
a) Nitrobenzene
b) Toluene
c) Benzene
d) Chlorobenzene
Answer: b) Toluene
1. What is the de Broglie wavelength equation?
a) λ = h/p
b) λ = h/mv
c) λ = hc/E
d) λ = h/E
Answer: a) λ = h/p
2. Which of the following is not a postulate of the Bohr model?
a) Electrons orbit the nucleus in circular orbits
b) Electrons can have any energy
c) Atoms emit radiation when electrons jump from higher to lower energy levels
d) Angular momentum of electrons is quantized
Answer: b) Electrons can have any energy
3. What does the Schrödinger equation describe?
a) The motion of particles
b) The wave function of a quantum system
c) The uncertainty principle
d) The photoelectric effect
Answer: b) The wave function of a quantum system
4. Which quantum number describes the shape of an orbital?
a) n (principal quantum number)
b) l (angular momentum quantum number)
c) ml (magnetic quantum number)
d) ms (spin quantum number)
Answer: b) l (angular momentum quantum number)
5. What is the maximum number of electrons that can occupy a p subshell?
a) 2
b) 6
c) 10
d) 14
Answer: b) 6
6. Which of the following is true about the wave function (ψ)?
a) It has a direct physical meaning
b) Its square gives the probability density
c) It can be directly measured
d) It is always real-valued
Answer: b) Its square gives the probability density
7. What is the ground state electron configuration of carbon?
a) 1s² 2s² 2p¹
b) 1s² 2s² 2p²
c) 1s² 2s¹ 2p³
d) 1s² 2s² 2p⁴
Answer: b) 1s² 2s² 2p²
8. Which of the following is not a valid combination of quantum numbers for an electron in a 3d
orbital?
a) n=3, l=2, ml=0, ms=+1/2
b) n=3, l=2, ml=+1, ms=-1/2
c) n=3, l=2, ml=+3, ms=+1/2
d) n=3, l=2, ml=-2, ms=-1/2
Answer: c) n=3, l=2, ml=+3, ms=+1/2
9. What is the energy of a photon with a wavelength of 500 nm?
a) 2.48 eV
b) 3.98 eV
c) 1.24 eV
d) 4.96 eV
Answer: a) 2.48 eV
10. Which of the following best describes the Pauli exclusion principle?
a) No two electrons in an atom can have the same set of quantum numbers
b) Electrons can only occupy certain energy levels
c) The total angular momentum of an electron is quantized
d) The energy of an electron is inversely proportional to its wavelength
Answer: a) No two electrons in an atom can have the same set of quantum numbers
11. What is the hybridization of the carbon atom in methane (CH )?₄
a) sp
b) sp²
c) sp³
d) unhybridized
Answer: c) sp³
amson ether synthesis
b) Dehydration of alcohols
c) Alkoxymercuration-demercuration
d) Nucleophilic addition to carbonyls
Answer: d) Nucleophilic addition to carbonyls
37. What is the major product of the reaction between benzene and propene in the presence of
H2SO4?
a) Ethylbenzene
b) Isopropylbenzene
c) n-propylbenzene
d) tert-butylbenzene
Answer: b) Isopropylbenzene
38. Which of the following is an example of a protecting group for alcohols?
a) Acetyl chloride
b) tert-butyldimethylsilyl chloride (TBDMSCl)
c) Sodium borohydride
d) Potassium permanganate
Answer: b) tert-butyldimethylsilyl chloride (TBDMSCl)
39. What is the product of the reaction between acetylene and two equivalents of HCN?
a) Acrylonitrile
b) Succinonitrile
c) Malononitrile
d) Fumaronitrile
Answer: c) Malononitrile
40. Which of the following compounds would have the highest pKa?
a) Phenol
b) Ethanol
c) Acetic acid
d) Benzoic acid
Answer: b) Ethanol
41. What type of reaction is involved in the conversion of an alkyl halide to a Grignard reagent?
a) Oxidation
b) Reduction
c) Substitution
d) Addition
Answer: b) Reduction
42. Which of the following is not a method for the synthesis of amines?
a) Reduction of nitro compounds
b) Reductive amination
c) Gabriel synthesis
d) Williamson ether synthesis
Answer: d) Williamson ether synthesis
43. What is the major product of the reaction between cyclohexene and m-chloroperoxybenzoic
acid (m-CPBA)?
a) Cyclohexanol
b) Cyclohexanone
c) Cyclohexene oxide
d) Chlorocyclohexane
Answer: c) Cyclohexene oxide
44. Which of the following reagents would you use to convert an aldehyde to a primary alcohol?
a) H2/Pt
b) LiAlH4
c) PCC
d) H2CrO4
Answer: b) LiAlH4
45. What is the product of the Claisen condensation of ethyl acetate?
a) Acetoacetic ester
b) Ethyl propionate
c) Diethyl succinate
d) Ethyl 3-oxobutanoate
Answer: a) Acetoacetic ester
46. Which of the following is an example of a leaving group in nucleophilic substitution
reactions?
a) OH-
b) NH2-
c) Cl-
d) CH3O-
Answer: c) Cl-
47. What is the major product of the reaction between propene and Cl2 in the presence of
water?
a) 1-chloropropane
b) 2-chloropropane
c) 1,2-dichloropropane
d) 1-chloro-2-propanol
Answer: d) 1-chloro-2-propanol
48. Which of the following is not a method for the synthesis of alkyl halides?
a) Addition of HX to alkenes
b) Reaction of alcohols with PBr3
c) Sandmeyer reaction
d) Hydrohalogenation of alkynes
Answer: d) Hydrohalogenation of alkynes
49. What is the product of the reaction between acetone and HCN?
a) 2-hydroxy-2-methylpropanenitrile
b) 2-hydroxypropanenitrile
c) 2-methyl-2-propanol
d) Acetone cyanohydrin
Answer: d) Acetone cyanohydrin (Note: This is the same as option a, but using its common
name)
50. Which of the following compounds would be most reactive in electrophilic aromatic
substitution?
a) Nitrobenzene
b) Toluene
c) Benzene
d) Chlorobenzene
Answer: b) Toluene
26. Which of the following is an example of a nucleophile?
a) H+
b) BF3
c) CN-
d) NO2+
Answer: c) CN-
27. What is the product of the Diels-Alder reaction between 1,3-butadiene and ethene?
a) Cyclohexene
b) Cyclohexane
c) Benzene
d) Cyclobutane
Answer: a) Cyclohexene
28. Which of the following reagents would you use to convert a carboxylic acid to an acid
chloride?
a) NaBH4
b) LiAlH4
c) SOCl2
d) NaOH
Answer: c) SOCl2
29. What is the major product of the reaction between propene and Br2 in water?
a) 1-bromopropane
b) 2-bromopropane
c) 1,2-dibromopropane
d) 1-bromo-2-propanol
Answer: d) 1-bromo-2-propanol
30. Which of the following compounds exhibits the highest boiling point?
a) CH3CH2CH2CH3
b) CH3CH2CH2OH
c) CH3CH2OCH2CH3
d) CH3CH2CHO
Answer: b) CH3CH2CH2OH
31. What type of reaction is represented by the conversion of acetone to 2-propanol?
a) Oxidation
b) Reduction
c) Substitution
d) Elimination
Answer: b) Reduction
32. Which of the following is not a characteristic of an SN2 reaction?
a) Second-order kinetics
b) Inversion of configuration
c) Rearrangement of carbocation intermediate
d) Preference for primary substrates
Answer: c) Rearrangement of carbocation intermediate
33. What is the IUPAC name for the compound CH3-C(CH3)2-CH2-CHO?
a) 3,3-dimethylbutanal
b) 2,2-dimethylpentanal
c) 4,4-dimethylpentanal
d) 3,3-dimethylpentanal
Answer: a) 3,3-dimethylbutanal
34. Which of the following is an example of a Grignard reagent?
a) CH3MgBr
b) CH3Li
c) (CH3)2CuLi
d) CH3ONa
Answer: a) CH3MgBr
35. What is the product of the reaction between ethylene oxide and water in acidic conditions?
a) Ethanol
b) Ethylene glycol
c) Acetaldehyde
d) Acetic acid
Answer: b) Ethylene glycol
36. Which of the following is not a method for preparing ethers?
a) Williamson ether synthesis
b) Dehydration of alcohols
c) Alkoxymercuration-demercuration
d) Nucleophilic addition to carbonyls
Answer: d) Nucleophilic addition to carbonyls
37. What is the major product of the reaction between benzene and propene in the presence of
H2SO4?
a) Ethylbenzene
b) Isopropylbenzene
c) n-propylbenzene
d) tert-butylbenzene
Answer: b) Isopropylbenzene
38. Which of the following is an example of a protecting group for alcohols?
a) Acetyl chloride
b) tert-butyldimethylsilyl chloride (TBDMSCl)
c) Sodium borohydride
d) Potassium permanganate
Answer: b) tert-butyldimethylsilyl chloride (TBDMSCl)
39. What is the product of the reaction between acetylene and two equivalents of HCN?
a) Acrylonitrile
b) Succinonitrile
c) Malononitrile
d) Fumaronitrile
Answer: c) Malononitrile
40. Which of the following compounds would have the highest pKa?
a) Phenol
b) Ethanol
c) Acetic acid
d) Benzoic acid
Answer: b) Ethanol
41. What type of reaction is involved in the conversion of an alkyl halide to a Grignard reagent?
a) Oxidation
b) Reduction
c) Substitution
d) Addition
Answer: b) Reduction
42. Which of the following is not a method for the synthesis of amines?
a) Reduction of nitro compounds
b) Reductive amination
c) Gabriel synthesis
d) Williamson ether synthesis
Answer: d) Williamson ether synthesis
43. What is the major product of the reaction between cyclohexene and m-chloroperoxybenzoic
acid (m-CPBA)?
a) Cyclohexanol
b) Cyclohexanone
c) Cyclohexene oxide
d) Chlorocyclohexane
Answer: c) Cyclohexene oxide
44. Which of the following reagents would you use to convert an aldehyde to a primary alcohol?
a) H2/Pt
b) LiAlH4
c) PCC
d) H2CrO4
Answer: b) LiAlH4
45. What is the product of the Claisen condensation of ethyl acetate?
a) Acetoacetic ester
b) Ethyl propionate
c) Diethyl succinate
d) Ethyl 3-oxobutanoate
Answer: a) Acetoacetic ester
46. Which of the following is an example of a leaving group in nucleophilic substitution
reactions?
a) OH-
b) NH2-
c) Cl-
d) CH3O-
Answer: c) Cl-
47. What is the major product of the reaction between propene and Cl2 in the presence of
water?
a) 1-chloropropane
b) 2-chloropropane
c) 1,2-dichloropropane
d) 1-chloro-2-propanol
Answer: d) 1-chloro-2-propanol
48. Which of the following is not a method for the synthesis of alkyl halides?
a) Addition of HX to alkenes
b) Reaction of alcohols with PBr3
c) Sandmeyer reaction
d) Hydrohalogenation of alkynes
Answer: d) Hydrohalogenation of alkynes
49. What is the product of the reaction between acetone and HCN?
a) 2-hydroxy-2-methylpropanenitrile
b) 2-hydroxypropanenitrile
c) 2-methyl-2-propanol
d) Acetone cyanohydrin
Answer: d) Acetone cyanohydrin (Note: This is the same as option a, but using its common
name)
50. Which of the following compounds would be most reactive in electrophilic aromatic
substitution?
a) Nitrobenzene
b) Toluene
c) Benzene
d) Chlorobenzene
Answer: b) Toluene
1. What is the de Broglie wavelength equation?
a) λ = h/p
b) λ = h/mv
c) λ = hc/E
d) λ = h/E
Answer: a) λ = h/p
2. Which of the following is not a postulate of the Bohr model?
a) Electrons orbit the nucleus in circular orbits
b) Electrons can have any energy
c) Atoms emit radiation when electrons jump from higher to lower energy levels
d) Angular momentum of electrons is quantized
Answer: b) Electrons can have any energy
3. What does the Schrödinger equation describe?
a) The motion of particles
b) The wave function of a quantum system
c) The uncertainty principle
d) The photoelectric effect
Answer: b) The wave function of a quantum system
4. Which quantum number describes the shape of an orbital?
a) n (principal quantum number)
b) l (angular momentum quantum number)
c) ml (magnetic quantum number)
d) ms (spin quantum number)
Answer: b) l (angular momentum quantum number)
5. What is the maximum number of electrons that can occupy a p subshell?
a) 2
b) 6
c) 10
d) 14
Answer: b) 6
6. Which of the following is true about the wave function (ψ)?
a) It has a direct physical meaning
b) Its square gives the probability density
c) It can be directly measured
d) It is always real-valued
Answer: b) Its square gives the probability density
7. What is the ground state electron configuration of carbon?
a) 1s² 2s² 2p¹
b) 1s² 2s² 2p²
c) 1s² 2s¹ 2p³
d) 1s² 2s² 2p⁴
Answer: b) 1s² 2s² 2p²
8. Which of the following is not a valid combination of quantum numbers for an electron in a 3d
orbital?
a) n=3, l=2, ml=0, ms=+1/2
b) n=3, l=2, ml=+1, ms=-1/2
c) n=3, l=2, ml=+3, ms=+1/2
d) n=3, l=2, ml=-2, ms=-1/2
Answer: c) n=3, l=2, ml=+3, ms=+1/2
9. What is the energy of a photon with a wavelength of 500 nm?
a) 2.48 eV
b) 3.98 eV
c) 1.24 eV
d) 4.96 eV
Answer: a) 2.48 eV
10. Which of the following best describes the Pauli exclusion principle?
a) No two electrons in an atom can have the same set of quantum numbers
b) Electrons can only occupy certain energy levels
c) The total angular momentum of an electron is quantized
d) The energy of an electron is inversely proportional to its wavelength
Answer: a) No two electrons in an atom can have the same set of quantum numbers
11. What is the hybridization of the carbon atom in methane (CH )?₄
a) sp
b) sp²
c) sp³
d) unhybridized
Answer: c) sp³
amson ether synthesis
b) Dehydration of alcohols
c) Alkoxymercuration-demercuration
d) Nucleophilic addition to carbonyls
Answer: d) Nucleophilic addition to carbonyls
37. What is the major product of the reaction between benzene and propene in the presence of
H2SO4?
a) Ethylbenzene
b) Isopropylbenzene
c) n-propylbenzene
d) tert-butylbenzene
Answer: b) Isopropylbenzene
38. Which of the following is an example of a protecting group for alcohols?
a) Acetyl chloride
b) tert-butyldimethylsilyl chloride (TBDMSCl)
c) Sodium borohydride
d) Potassium permanganate
Answer: b) tert-butyldimethylsilyl chloride (TBDMSCl)
39. What is the product of the reaction between acetylene and two equivalents of HCN?
a) Acrylonitrile
b) Succinonitrile
c) Malononitrile
d) Fumaronitrile
Answer: c) Malononitrile
40. Which of the following compounds would have the highest pKa?
a) Phenol
b) Ethanol
c) Acetic acid
d) Benzoic acid
Answer: b) Ethanol
41. What type of reaction is involved in the conversion of an alkyl halide to a Grignard reagent?
a) Oxidation
b) Reduction
c) Substitution
d) Addition
Answer: b) Reduction
42. Which of the following is not a method for the synthesis of amines?
a) Reduction of nitro compounds
b) Reductive amination
c) Gabriel synthesis
d) Williamson ether synthesis
Answer: d) Williamson ether synthesis
43. What is the major product of the reaction between cyclohexene and m-chloroperoxybenzoic
acid (m-CPBA)?
a) Cyclohexanol
b) Cyclohexanone
c) Cyclohexene oxide
d) Chlorocyclohexane
Answer: c) Cyclohexene oxide
44. Which of the following reagents would you use to convert an aldehyde to a primary alcohol?
a) H2/Pt
b) LiAlH4
c) PCC
d) H2CrO4
Answer: b) LiAlH4
45. What is the product of the Claisen condensation of ethyl acetate?
a) Acetoacetic ester
b) Ethyl propionate
c) Diethyl succinate
d) Ethyl 3-oxobutanoate
Answer: a) Acetoacetic ester
46. Which of the following is an example of a leaving group in nucleophilic substitution
reactions?
a) OH-
b) NH2-
c) Cl-
d) CH3O-
Answer: c) Cl-
47. What is the major product of the reaction between propene and Cl2 in the presence of
water?
a) 1-chloropropane
b) 2-chloropropane
c) 1,2-dichloropropane
d) 1-chloro-2-propanol
Answer: d) 1-chloro-2-propanol
48. Which of the following is not a method for the synthesis of alkyl halides?
a) Addition of HX to alkenes
b) Reaction of alcohols with PBr3
c) Sandmeyer reaction
d) Hydrohalogenation of alkynes
Answer: d) Hydrohalogenation of alkynes
49. What is the product of the reaction between acetone and HCN?
a) 2-hydroxy-2-methylpropanenitrile
b) 2-hydroxypropanenitrile
c) 2-methyl-2-propanol
d) Acetone cyanohydrin
Answer: d) Acetone cyanohydrin (Note: This is the same as option a, but using its common
name)
50. Which of the following compounds would be most reactive in electrophilic aromatic
substitution?
a) Nitrobenzene
b) Toluene
c) Benzene
d) Chlorobenzene
Answer: b) Toluene
26. Which of the following is an example of a nucleophile?
a) H+
b) BF3
c) CN-
d) NO2+
Answer: c) CN-
27. What is the product of the Diels-Alder reaction between 1,3-butadiene and ethene?
a) Cyclohexene
b) Cyclohexane
c) Benzene
d) Cyclobutane
Answer: a) Cyclohexene
28. Which of the following reagents would you use to convert a carboxylic acid to an acid
chloride?
a) NaBH4
b) LiAlH4
c) SOCl2
d) NaOH
Answer: c) SOCl2
29. What is the major product of the reaction between propene and Br2 in water?
a) 1-bromopropane
b) 2-bromopropane
c) 1,2-dibromopropane
d) 1-bromo-2-propanol
Answer: d) 1-bromo-2-propanol
30. Which of the following compounds exhibits the highest boiling point?
a) CH3CH2CH2CH3
b) CH3CH2CH2OH
c) CH3CH2OCH2CH3
d) CH3CH2CHO
Answer: b) CH3CH2CH2OH
31. What type of reaction is represented by the conversion of acetone to 2-propanol?
a) Oxidation
b) Reduction
c) Substitution
d) Elimination
Answer: b) Reduction
32. Which of the following is not a characteristic of an SN2 reaction?
a) Second-order kinetics
b) Inversion of configuration
c) Rearrangement of carbocation intermediate
d) Preference for primary substrates
Answer: c) Rearrangement of carbocation intermediate
33. What is the IUPAC name for the compound CH3-C(CH3)2-CH2-CHO?
a) 3,3-dimethylbutanal
b) 2,2-dimethylpentanal
c) 4,4-dimethylpentanal
d) 3,3-dimethylpentanal
Answer: a) 3,3-dimethylbutanal
34. Which of the following is an example of a Grignard reagent?
a) CH3MgBr
b) CH3Li
c) (CH3)2CuLi
d) CH3ONa
Answer: a) CH3MgBr
35. What is the product of the reaction between ethylene oxide and water in acidic conditions?
a) Ethanol
b) Ethylene glycol
c) Acetaldehyde
d) Acetic acid
Answer: b) Ethylene glycol
36. Which of the following is not a method for preparing ethers?
a) Williamson ether synthesis
b) Dehydration of alcohols
c) Alkoxymercuration-demercuration
d) Nucleophilic addition to carbonyls
Answer: d) Nucleophilic addition to carbonyls
37. What is the major product of the reaction between benzene and propene in the presence of
H2SO4?
a) Ethylbenzene
b) Isopropylbenzene
c) n-propylbenzene
d) tert-butylbenzene
Answer: b) Isopropylbenzene
38. Which of the following is an example of a protecting group for alcohols?
a) Acetyl chloride
b) tert-butyldimethylsilyl chloride (TBDMSCl)
c) Sodium borohydride
d) Potassium permanganate
Answer: b) tert-butyldimethylsilyl chloride (TBDMSCl)
39. What is the product of the reaction between acetylene and two equivalents of HCN?
a) Acrylonitrile
b) Succinonitrile
c) Malononitrile
d) Fumaronitrile
Answer: c) Malononitrile
40. Which of the following compounds would have the highest pKa?
a) Phenol
b) Ethanol
c) Acetic acid
d) Benzoic acid
Answer: b) Ethanol
41. What type of reaction is involved in the conversion of an alkyl halide to a Grignard reagent?
a) Oxidation
b) Reduction
c) Substitution
d) Addition
Answer: b) Reduction
42. Which of the following is not a method for the synthesis of amines?
a) Reduction of nitro compounds
b) Reductive amination
c) Gabriel synthesis
d) Williamson ether synthesis
Answer: d) Williamson ether synthesis
43. What is the major product of the reaction between cyclohexene and m-chloroperoxybenzoic
acid (m-CPBA)?
a) Cyclohexanol
b) Cyclohexanone
c) Cyclohexene oxide
d) Chlorocyclohexane
Answer: c) Cyclohexene oxide
44. Which of the following reagents would you use to convert an aldehyde to a primary alcohol?
a) H2/Pt
b) LiAlH4
c) PCC
d) H2CrO4
Answer: b) LiAlH4
45. What is the product of the Claisen condensation of ethyl acetate?
a) Acetoacetic ester
b) Ethyl propionate
c) Diethyl succinate
d) Ethyl 3-oxobutanoate
Answer: a) Acetoacetic ester
46. Which of the following is an example of a leaving group in nucleophilic substitution
reactions?
a) OH-
b) NH2-
c) Cl-
d) CH3O-
Answer: c) Cl-
47. What is the major product of the reaction between propene and Cl2 in the presence of
water?
a) 1-chloropropane
b) 2-chloropropane
c) 1,2-dichloropropane
d) 1-chloro-2-propanol
Answer: d) 1-chloro-2-propanol
48. Which of the following is not a method for the synthesis of alkyl halides?
a) Addition of HX to alkenes
b) Reaction of alcohols with PBr3
c) Sandmeyer reaction
d) Hydrohalogenation of alkynes
Answer: d) Hydrohalogenation of alkynes
49. What is the product of the reaction between acetone and HCN?
a) 2-hydroxy-2-methylpropanenitrile
b) 2-hydroxypropanenitrile
c) 2-methyl-2-propanol
d) Acetone cyanohydrin
Answer: d) Acetone cyanohydrin (Note: This is the same as option a, but using its common
name)
50. Which of the following compounds would be most reactive in electrophilic aromatic
substitution?
a) Nitrobenzene
b) Toluene
c) Benzene
d) Chlorobenzene
Answer: b) Toluene
1. What is the de Broglie wavelength equation?
a) λ = h/p
b) λ = h/mv
c) λ = hc/E
d) λ = h/E
Answer: a) λ = h/p
2. Which of the following is not a postulate of the Bohr model?
a) Electrons orbit the nucleus in circular orbits
b) Electrons can have any energy
c) Atoms emit radiation when electrons jump from higher to lower energy levels
d) Angular momentum of electrons is quantized
Answer: b) Electrons can have any energy
3. What does the Schrödinger equation describe?
a) The motion of particles
b) The wave function of a quantum system
c) The uncertainty principle
d) The photoelectric effect
Answer: b) The wave function of a quantum system
4. Which quantum number describes the shape of an orbital?
a) n (principal quantum number)
b) l (angular momentum quantum number)
c) ml (magnetic quantum number)
d) ms (spin quantum number)
Answer: b) l (angular momentum quantum number)
5. What is the maximum number of electrons that can occupy a p subshell?
a) 2
b) 6
c) 10
d) 14
Answer: b) 6
6. Which of the following is true about the wave function (ψ)?
a) It has a direct physical meaning
b) Its square gives the probability density
c) It can be directly measured
d) It is always real-valued
Answer: b) Its square gives the probability density
7. What is the ground state electron configuration of carbon?
a) 1s² 2s² 2p¹
b) 1s² 2s² 2p²
c) 1s² 2s¹ 2p³
d) 1s² 2s² 2p⁴
Answer: b) 1s² 2s² 2p²
8. Which of the following is not a valid combination of quantum numbers for an electron in a 3d
orbital?
a) n=3, l=2, ml=0, ms=+1/2
b) n=3, l=2, ml=+1, ms=-1/2
c) n=3, l=2, ml=+3, ms=+1/2
d) n=3, l=2, ml=-2, ms=-1/2
Answer: c) n=3, l=2, ml=+3, ms=+1/2
9. What is the energy of a photon with a wavelength of 500 nm?
a) 2.48 eV
b) 3.98 eV
c) 1.24 eV
d) 4.96 eV
Answer: a) 2.48 eV
10. Which of the following best describes the Pauli exclusion principle?
a) No two electrons in an atom can have the same set of quantum numbers
b) Electrons can only occupy certain energy levels
c) The total angular momentum of an electron is quantized
d) The energy of an electron is inversely proportional to its wavelength
Answer: a) No two electrons in an atom can have the same set of quantum numbers
11. What is the hybridization of the carbon atom in methane (CH )?₄
a) sp
b) sp²
c) sp³
d) unhybridized
Answer: c) sp³
amson ether synthesis
b) Dehydration of alcohols
c) Alkoxymercuration-demercuration
d) Nucleophilic addition to carbonyls
Answer: d) Nucleophilic addition to carbonyls
37. What is the major product of the reaction between benzene and propene in the presence of
H2SO4?
a) Ethylbenzene
b) Isopropylbenzene
c) n-propylbenzene
d) tert-butylbenzene
Answer: b) Isopropylbenzene
38. Which of the following is an example of a protecting group for alcohols?
a) Acetyl chloride
b) tert-butyldimethylsilyl chloride (TBDMSCl)
c) Sodium borohydride
d) Potassium permanganate
Answer: b) tert-butyldimethylsilyl chloride (TBDMSCl)
39. What is the product of the reaction between acetylene and two equivalents of HCN?
a) Acrylonitrile
b) Succinonitrile
c) Malononitrile
d) Fumaronitrile
Answer: c) Malononitrile
40. Which of the following compounds would have the highest pKa?
a) Phenol
b) Ethanol
c) Acetic acid
d) Benzoic acid
Answer: b) Ethanol
41. What type of reaction is involved in the conversion of an alkyl halide to a Grignard reagent?
a) Oxidation
b) Reduction
c) Substitution
d) Addition
Answer: b) Reduction
42. Which of the following is not a method for the synthesis of amines?
a) Reduction of nitro compounds
b) Reductive amination
c) Gabriel synthesis
d) Williamson ether synthesis
Answer: d) Williamson ether synthesis
43. What is the major product of the reaction between cyclohexene and m-chloroperoxybenzoic
acid (m-CPBA)?
a) Cyclohexanol
b) Cyclohexanone
c) Cyclohexene oxide
d) Chlorocyclohexane
Answer: c) Cyclohexene oxide
44. Which of the following reagents would you use to convert an aldehyde to a primary alcohol?
a) H2/Pt
b) LiAlH4
c) PCC
d) H2CrO4
Answer: b) LiAlH4
45. What is the product of the Claisen condensation of ethyl acetate?
a) Acetoacetic ester
b) Ethyl propionate
c) Diethyl succinate
d) Ethyl 3-oxobutanoate
Answer: a) Acetoacetic ester
46. Which of the following is an example of a leaving group in nucleophilic substitution
reactions?
a) OH-
b) NH2-
c) Cl-
d) CH3O-
Answer: c) Cl-
47. What is the major product of the reaction between propene and Cl2 in the presence of
water?
a) 1-chloropropane
b) 2-chloropropane
c) 1,2-dichloropropane
d) 1-chloro-2-propanol
Answer: d) 1-chloro-2-propanol
48. Which of the following is not a method for the synthesis of alkyl halides?
a) Addition of HX to alkenes
b) Reaction of alcohols with PBr3
c) Sandmeyer reaction
d) Hydrohalogenation of alkynes
Answer: d) Hydrohalogenation of alkynes
49. What is the product of the reaction between acetone and HCN?
a) 2-hydroxy-2-methylpropanenitrile
b) 2-hydroxypropanenitrile
c) 2-methyl-2-propanol
d) Acetone cyanohydrin
Answer: d) Acetone cyanohydrin (Note: This is the same as option a, but using its common
name)
50. Which of the following compounds would be most reactive in electrophilic aromatic
substitution?
a) Nitrobenzene
b) Toluene
c) Benzene
d) Chlorobenzene
Answer: b) Toluene
26. Which of the following is an example of a nucleophile?
a) H+
b) BF3
c) CN-
d) NO2+
Answer: c) CN-
27. What is the product of the Diels-Alder reaction between 1,3-butadiene and ethene?
a) Cyclohexene
b) Cyclohexane
c) Benzene
d) Cyclobutane
Answer: a) Cyclohexene
28. Which of the following reagents would you use to convert a carboxylic acid to an acid
chloride?
a) NaBH4
b) LiAlH4
c) SOCl2
d) NaOH
Answer: c) SOCl2
29. What is the major product of the reaction between propene and Br2 in water?
a) 1-bromopropane
b) 2-bromopropane
c) 1,2-dibromopropane
d) 1-bromo-2-propanol
Answer: d) 1-bromo-2-propanol
30. Which of the following compounds exhibits the highest boiling point?
a) CH3CH2CH2CH3
b) CH3CH2CH2OH
c) CH3CH2OCH2CH3
d) CH3CH2CHO
Answer: b) CH3CH2CH2OH
31. What type of reaction is represented by the conversion of acetone to 2-propanol?
a) Oxidation
b) Reduction
c) Substitution
d) Elimination
Answer: b) Reduction
32. Which of the following is not a characteristic of an SN2 reaction?
a) Second-order kinetics
b) Inversion of configuration
c) Rearrangement of carbocation intermediate
d) Preference for primary substrates
Answer: c) Rearrangement of carbocation intermediate
33. What is the IUPAC name for the compound CH3-C(CH3)2-CH2-CHO?
a) 3,3-dimethylbutanal
b) 2,2-dimethylpentanal
c) 4,4-dimethylpentanal
d) 3,3-dimethylpentanal
Answer: a) 3,3-dimethylbutanal
34. Which of the following is an example of a Grignard reagent?
a) CH3MgBr
b) CH3Li
c) (CH3)2CuLi
d) CH3ONa
Answer: a) CH3MgBr
35. What is the product of the reaction between ethylene oxide and water in acidic conditions?
a) Ethanol
b) Ethylene glycol
c) Acetaldehyde
d) Acetic acid
Answer: b) Ethylene glycol
36. Which of the following is not a method for preparing ethers?
a) Williamson ether synthesis
b) Dehydration of alcohols
c) Alkoxymercuration-demercuration
d) Nucleophilic addition to carbonyls
Answer: d) Nucleophilic addition to carbonyls
37. What is the major product of the reaction between benzene and propene in the presence of
H2SO4?
a) Ethylbenzene
b) Isopropylbenzene
c) n-propylbenzene
d) tert-butylbenzene
Answer: b) Isopropylbenzene
38. Which of the following is an example of a protecting group for alcohols?
a) Acetyl chloride
b) tert-butyldimethylsilyl chloride (TBDMSCl)
c) Sodium borohydride
d) Potassium permanganate
Answer: b) tert-butyldimethylsilyl chloride (TBDMSCl)
39. What is the product of the reaction between acetylene and two equivalents of HCN?
a) Acrylonitrile
b) Succinonitrile
c) Malononitrile
d) Fumaronitrile
Answer: c) Malononitrile
40. Which of the following compounds would have the highest pKa?
a) Phenol
b) Ethanol
c) Acetic acid
d) Benzoic acid
Answer: b) Ethanol
41. What type of reaction is involved in the conversion of an alkyl halide to a Grignard reagent?
a) Oxidation
b) Reduction
c) Substitution
d) Addition
Answer: b) Reduction
42. Which of the following is not a method for the synthesis of amines?
a) Reduction of nitro compounds
b) Reductive amination
c) Gabriel synthesis
d) Williamson ether synthesis
Answer: d) Williamson ether synthesis
43. What is the major product of the reaction between cyclohexene and m-chloroperoxybenzoic
acid (m-CPBA)?
a) Cyclohexanol
b) Cyclohexanone
c) Cyclohexene oxide
d) Chlorocyclohexane
Answer: c) Cyclohexene oxide
44. Which of the following reagents would you use to convert an aldehyde to a primary alcohol?
a) H2/Pt
b) LiAlH4
c) PCC
d) H2CrO4
Answer: b) LiAlH4
45. What is the product of the Claisen condensation of ethyl acetate?
a) Acetoacetic ester
b) Ethyl propionate
c) Diethyl succinate
d) Ethyl 3-oxobutanoate
Answer: a) Acetoacetic ester
46. Which of the following is an example of a leaving group in nucleophilic substitution
reactions?
a) OH-
b) NH2-
c) Cl-
d) CH3O-
Answer: c) Cl-
47. What is the major product of the reaction between propene and Cl2 in the presence of
water?
a) 1-chloropropane
b) 2-chloropropane
c) 1,2-dichloropropane
d) 1-chloro-2-propanol
Answer: d) 1-chloro-2-propanol
48. Which of the following is not a method for the synthesis of alkyl halides?
a) Addition of HX to alkenes
b) Reaction of alcohols with PBr3
c) Sandmeyer reaction
d) Hydrohalogenation of alkynes
Answer: d) Hydrohalogenation of alkynes
49. What is the product of the reaction between acetone and HCN?
a) 2-hydroxy-2-methylpropanenitrile
b) 2-hydroxypropanenitrile
c) 2-methyl-2-propanol
d) Acetone cyanohydrin
Answer: d) Acetone cyanohydrin (Note: This is the same as option a, but using its common
name)
50. Which of the following compounds would be most reactive in electrophilic aromatic
substitution?
a) Nitrobenzene
b) Toluene
c) Benzene
d) Chlorobenzene
Answer: b) Toluene
1. What is the de Broglie wavelength equation?
a) λ = h/p
b) λ = h/mv
c) λ = hc/E
d) λ = h/E
Answer: a) λ = h/p
2. Which of the following is not a postulate of the Bohr model?
a) Electrons orbit the nucleus in circular orbits
b) Electrons can have any energy
c) Atoms emit radiation when electrons jump from higher to lower energy levels
d) Angular momentum of electrons is quantized
Answer: b) Electrons can have any energy
3. What does the Schrödinger equation describe?
a) The motion of particles
b) The wave function of a quantum system
c) The uncertainty principle
d) The photoelectric effect
Answer: b) The wave function of a quantum system
4. Which quantum number describes the shape of an orbital?
a) n (principal quantum number)
b) l (angular momentum quantum number)
c) ml (magnetic quantum number)
d) ms (spin quantum number)
Answer: b) l (angular momentum quantum number)
5. What is the maximum number of electrons that can occupy a p subshell?
a) 2
b) 6
c) 10
d) 14
Answer: b) 6
6. Which of the following is true about the wave function (ψ)?
a) It has a direct physical meaning
b) Its square gives the probability density
c) It can be directly measured
d) It is always real-valued
Answer: b) Its square gives the probability density
7. What is the ground state electron configuration of carbon?
a) 1s² 2s² 2p¹
b) 1s² 2s² 2p²
c) 1s² 2s¹ 2p³
d) 1s² 2s² 2p⁴
Answer: b) 1s² 2s² 2p²
8. Which of the following is not a valid combination of quantum numbers for an electron in a 3d
orbital?
a) n=3, l=2, ml=0, ms=+1/2
b) n=3, l=2, ml=+1, ms=-1/2
c) n=3, l=2, ml=+3, ms=+1/2
d) n=3, l=2, ml=-2, ms=-1/2
Answer: c) n=3, l=2, ml=+3, ms=+1/2
9. What is the energy of a photon with a wavelength of 500 nm?
a) 2.48 eV
b) 3.98 eV
c) 1.24 eV
d) 4.96 eV
Answer: a) 2.48 eV
10. Which of the following best describes the Pauli exclusion principle?
a) No two electrons in an atom can have the same set of quantum numbers
b) Electrons can only occupy certain energy levels
c) The total angular momentum of an electron is quantized
d) The energy of an electron is inversely proportional to its wavelength
Answer: a) No two electrons in an atom can have the same set of quantum numbers
11. What is the hybridization of the carbon atom in methane (CH )?₄
a) sp
b) sp²
c) sp³
d) unhybridized
Answer: c) sp³
amson ether synthesis
b) Dehydration of alcohols
c) Alkoxymercuration-demercuration
d) Nucleophilic addition to carbonyls
Answer: d) Nucleophilic addition to carbonyls
37. What is the major product of the reaction between benzene and propene in the presence of
H2SO4?
a) Ethylbenzene
b) Isopropylbenzene
c) n-propylbenzene
d) tert-butylbenzene
Answer: b) Isopropylbenzene
38. Which of the following is an example of a protecting group for alcohols?
a) Acetyl chloride
b) tert-butyldimethylsilyl chloride (TBDMSCl)
c) Sodium borohydride
d) Potassium permanganate
Answer: b) tert-butyldimethylsilyl chloride (TBDMSCl)
39. What is the product of the reaction between acetylene and two equivalents of HCN?
a) Acrylonitrile
b) Succinonitrile
c) Malononitrile
d) Fumaronitrile
Answer: c) Malononitrile
40. Which of the following compounds would have the highest pKa?
a) Phenol
b) Ethanol
c) Acetic acid
d) Benzoic acid
Answer: b) Ethanol
41. What type of reaction is involved in the conversion of an alkyl halide to a Grignard reagent?
a) Oxidation
b) Reduction
c) Substitution
d) Addition
Answer: b) Reduction
42. Which of the following is not a method for the synthesis of amines?
a) Reduction of nitro compounds
b) Reductive amination
c) Gabriel synthesis
d) Williamson ether synthesis
Answer: d) Williamson ether synthesis
43. What is the major product of the reaction between cyclohexene and m-chloroperoxybenzoic
acid (m-CPBA)?
a) Cyclohexanol
b) Cyclohexanone
c) Cyclohexene oxide
d) Chlorocyclohexane
Answer: c) Cyclohexene oxide
44. Which of the following reagents would you use to convert an aldehyde to a primary alcohol?
a) H2/Pt
b) LiAlH4
c) PCC
d) H2CrO4
Answer: b) LiAlH4
45. What is the product of the Claisen condensation of ethyl acetate?
a) Acetoacetic ester
b) Ethyl propionate
c) Diethyl succinate
d) Ethyl 3-oxobutanoate
Answer: a) Acetoacetic ester
46. Which of the following is an example of a leaving group in nucleophilic substitution
reactions?
a) OH-
b) NH2-
c) Cl-
d) CH3O-
Answer: c) Cl-
47. What is the major product of the reaction between propene and Cl2 in the presence of
water?
a) 1-chloropropane
b) 2-chloropropane
c) 1,2-dichloropropane
d) 1-chloro-2-propanol
Answer: d) 1-chloro-2-propanol
48. Which of the following is not a method for the synthesis of alkyl halides?
a) Addition of HX to alkenes
b) Reaction of alcohols with PBr3
c) Sandmeyer reaction
d) Hydrohalogenation of alkynes
Answer: d) Hydrohalogenation of alkynes
49. What is the product of the reaction between acetone and HCN?
a) 2-hydroxy-2-methylpropanenitrile
b) 2-hydroxypropanenitrile
c) 2-methyl-2-propanol
d) Acetone cyanohydrin
Answer: d) Acetone cyanohydrin (Note: This is the same as option a, but using its common
name)
50. Which of the following compounds would be most reactive in electrophilic aromatic
substitution?
a) Nitrobenzene
b) Toluene
c) Benzene
d) Chlorobenzene
Answer: b) Toluene
26. Which of the following is an example of a nucleophile?
a) H+
b) BF3
c) CN-
d) NO2+
Answer: c) CN-
27. What is the product of the Diels-Alder reaction between 1,3-butadiene and ethene?
a) Cyclohexene
b) Cyclohexane
c) Benzene
d) Cyclobutane
Answer: a) Cyclohexene
28. Which of the following reagents would you use to convert a carboxylic acid to an acid
chloride?
a) NaBH4
b) LiAlH4
c) SOCl2
d) NaOH
Answer: c) SOCl2
29. What is the major product of the reaction between propene and Br2 in water?
a) 1-bromopropane
b) 2-bromopropane
c) 1,2-dibromopropane
d) 1-bromo-2-propanol
Answer: d) 1-bromo-2-propanol
30. Which of the following compounds exhibits the highest boiling point?
a) CH3CH2CH2CH3
b) CH3CH2CH2OH
c) CH3CH2OCH2CH3
d) CH3CH2CHO
Answer: b) CH3CH2CH2OH
31. What type of reaction is represented by the conversion of acetone to 2-propanol?
a) Oxidation
b) Reduction
c) Substitution
d) Elimination
Answer: b) Reduction
32. Which of the following is not a characteristic of an SN2 reaction?
a) Second-order kinetics
b) Inversion of configuration
c) Rearrangement of carbocation intermediate
d) Preference for primary substrates
Answer: c) Rearrangement of carbocation intermediate
33. What is the IUPAC name for the compound CH3-C(CH3)2-CH2-CHO?
a) 3,3-dimethylbutanal
b) 2,2-dimethylpentanal
c) 4,4-dimethylpentanal
d) 3,3-dimethylpentanal
Answer: a) 3,3-dimethylbutanal
34. Which of the following is an example of a Grignard reagent?
a) CH3MgBr
b) CH3Li
c) (CH3)2CuLi
d) CH3ONa
Answer: a) CH3MgBr
35. What is the product of the reaction between ethylene oxide and water in acidic conditions?
a) Ethanol
b) Ethylene glycol
c) Acetaldehyde
d) Acetic acid
Answer: b) Ethylene glycol
36. Which of the following is not a method for preparing ethers?
a) Williamson ether synthesis
b) Dehydration of alcohols
c) Alkoxymercuration-demercuration
d) Nucleophilic addition to carbonyls
Answer: d) Nucleophilic addition to carbonyls
37. What is the major product of the reaction between benzene and propene in the presence of
H2SO4?
a) Ethylbenzene
b) Isopropylbenzene
c) n-propylbenzene
d) tert-butylbenzene
Answer: b) Isopropylbenzene
38. Which of the following is an example of a protecting group for alcohols?
a) Acetyl chloride
b) tert-butyldimethylsilyl chloride (TBDMSCl)
c) Sodium borohydride
d) Potassium permanganate
Answer: b) tert-butyldimethylsilyl chloride (TBDMSCl)
39. What is the product of the reaction between acetylene and two equivalents of HCN?
a) Acrylonitrile
b) Succinonitrile
c) Malononitrile
d) Fumaronitrile
Answer: c) Malononitrile
40. Which of the following compounds would have the highest pKa?
a) Phenol
b) Ethanol
c) Acetic acid
d) Benzoic acid
Answer: b) Ethanol
41. What type of reaction is involved in the conversion of an alkyl halide to a Grignard reagent?
a) Oxidation
b) Reduction
c) Substitution
d) Addition
Answer: b) Reduction
42. Which of the following is not a method for the synthesis of amines?
a) Reduction of nitro compounds
b) Reductive amination
c) Gabriel synthesis
d) Williamson ether synthesis
Answer: d) Williamson ether synthesis
43. What is the major product of the reaction between cyclohexene and m-chloroperoxybenzoic
acid (m-CPBA)?
a) Cyclohexanol
b) Cyclohexanone
c) Cyclohexene oxide
d) Chlorocyclohexane
Answer: c) Cyclohexene oxide
44. Which of the following reagents would you use to convert an aldehyde to a primary alcohol?
a) H2/Pt
b) LiAlH4
c) PCC
d) H2CrO4
Answer: b) LiAlH4
45. What is the product of the Claisen condensation of ethyl acetate?
a) Acetoacetic ester
b) Ethyl propionate
c) Diethyl succinate
d) Ethyl 3-oxobutanoate
Answer: a) Acetoacetic ester
46. Which of the following is an example of a leaving group in nucleophilic substitution
reactions?
a) OH-
b) NH2-
c) Cl-
d) CH3O-
Answer: c) Cl-
47. What is the major product of the reaction between propene and Cl2 in the presence of
water?
a) 1-chloropropane
b) 2-chloropropane
c) 1,2-dichloropropane
d) 1-chloro-2-propanol
Answer: d) 1-chloro-2-propanol
48. Which of the following is not a method for the synthesis of alkyl halides?
a) Addition of HX to alkenes
b) Reaction of alcohols with PBr3
c) Sandmeyer reaction
d) Hydrohalogenation of alkynes
Answer: d) Hydrohalogenation of alkynes
49. What is the product of the reaction between acetone and HCN?
a) 2-hydroxy-2-methylpropanenitrile
b) 2-hydroxypropanenitrile
c) 2-methyl-2-propanol
d) Acetone cyanohydrin
Answer: d) Acetone cyanohydrin (Note: This is the same as option a, but using its common
name)
50. Which of the following compounds would be most reactive in electrophilic aromatic
substitution?
a) Nitrobenzene
b) Toluene
c) Benzene
d) Chlorobenzene
Answer: b) Toluene
1. What is the de Broglie wavelength equation?
a) λ = h/p
b) λ = h/mv
c) λ = hc/E
d) λ = h/E
Answer: a) λ = h/p
2. Which of the following is not a postulate of the Bohr model?
a) Electrons orbit the nucleus in circular orbits
b) Electrons can have any energy
c) Atoms emit radiation when electrons jump from higher to lower energy levels
d) Angular momentum of electrons is quantized
Answer: b) Electrons can have any energy
3. What does the Schrödinger equation describe?
a) The motion of particles
b) The wave function of a quantum system
c) The uncertainty principle
d) The photoelectric effect
Answer: b) The wave function of a quantum system
4. Which quantum number describes the shape of an orbital?
a) n (principal quantum number)
b) l (angular momentum quantum number)
c) ml (magnetic quantum number)
d) ms (spin quantum number)
Answer: b) l (angular momentum quantum number)
5. What is the maximum number of electrons that can occupy a p subshell?
a) 2
b) 6
c) 10
d) 14
Answer: b) 6
6. Which of the following is true about the wave function (ψ)?
a) It has a direct physical meaning
b) Its square gives the probability density
c) It can be directly measured
d) It is always real-valued
Answer: b) Its square gives the probability density
7. What is the ground state electron configuration of carbon?
a) 1s² 2s² 2p¹
b) 1s² 2s² 2p²
c) 1s² 2s¹ 2p³
d) 1s² 2s² 2p⁴
Answer: b) 1s² 2s² 2p²
8. Which of the following is not a valid combination of quantum numbers for an electron in a 3d
orbital?
a) n=3, l=2, ml=0, ms=+1/2
b) n=3, l=2, ml=+1, ms=-1/2
c) n=3, l=2, ml=+3, ms=+1/2
d) n=3, l=2, ml=-2, ms=-1/2
Answer: c) n=3, l=2, ml=+3, ms=+1/2
9. What is the energy of a photon with a wavelength of 500 nm?
a) 2.48 eV
b) 3.98 eV
c) 1.24 eV
d) 4.96 eV
Answer: a) 2.48 eV
10. Which of the following best describes the Pauli exclusion principle?
a) No two electrons in an atom can have the same set of quantum numbers
b) Electrons can only occupy certain energy levels
c) The total angular momentum of an electron is quantized
d) The energy of an electron is inversely proportional to its wavelength
Answer: a) No two electrons in an atom can have the same set of quantum numbers
11. What is the hybridization of the carbon atom in methane (CH )?₄
a) sp
b) sp²
c) sp³
d) unhybridized
Answer: c) sp³
12. Which of the following is true about the uncertainty principle?
a) It applies only to macroscopic objects
b) It states that the position and momentum of a particle can be known precisely
c) It is a consequence of the wave nature of matter
d) It was proposed by Einstein
Answer: c) It is a consequence of the wave nature of matter
13. What is the ground state term symbol for a carbon atom?
a) ¹S₀
b) ²P /₁ ₂
c) ³P₀
d) ⁴S /₃ ₂
Answer: c) ³P₀
14. Which of the following is not a method for approximating molecular orbitals?
a) Linear Combination of Atomic Orbitals (LCAO)
b) Valence Bond Theory
c) Molecular Orbital Theory
d) Bohr-Sommerfeld Model
Answer: d) Bohr-Sommerfeld Model
15. What is the degeneracy of a d subshell?
a) 2
b) 3
c) 5
d) 7
Answer: c) 5
16. Which of the following best describes the Born-Oppenheimer approximation?
a) Electrons move much faster than nuclei
b) Nuclei move much faster than electrons
c) Electrons and nuclei move at the same speed
d) The motion of electrons and nuclei is uncorrelated
Answer: a) Electrons move much faster than nuclei
17. What is the zero-point energy?
a) The lowest possible energy of a quantum mechanical system
b) The energy of a system at absolute zero
c) The energy difference between the ground state and first excited state
d) The energy of a free particle
Answer: a) The lowest possible energy of a quantum mechanical system
18. Which of the following is true about atomic orbitals?
a) They have definite boundaries
b) They represent regions of high electron probability
c) They are always spherical
d) They can contain an unlimited number of electrons
Answer: b) They represent regions of high electron probability
19. What is the selection rule for electronic transitions in atoms?
a) Δn = ±1
b) Δl = ±1
c) Δml = 0, ±1
d) Δms = ±1
Answer: b) Δl = ±1
20. Which of the following is not a fundamental force in nature?
a) Strong nuclear force
b) Weak nuclear force
c) Electromagnetic force
d) Quantum force
Answer: d) Quantum force
21. What is the ground state electron configuration of a chlorine atom?
a) [Ne] 3s² 3p⁴
b) [Ne] 3s² 3p⁵
c) [Ne] 3s² 3p⁶
d) [Ar] 4s¹
Answer: b) [Ne] 3s² 3p⁵
22. Which of the following best describes the Stern-Gerlach experiment?
a) It demonstrated the quantization of angular momentum
b) It proved the existence of electron spin
c) It showed the wave nature of electrons
d) It discovered the photoelectric effect
Answer: b) It proved the existence of electron spin
23. What is the total number of nodes in a 3p orbital?
a) 0
b) 1
c) 2
d) 3
Answer: c) 2
24. Which of the following is true about the variational principle in quantum mechanics?
a) The calculated energy is always higher than the true ground state energy
b) The calculated energy is always lower than the true ground state energy
c) The calculated energy is exactly equal to the true ground state energy
d) It has no relation to the ground state energy
Answer: a) The calculated energy is always higher than the true ground state energy
25. What is the term symbol for the ground state of a nitrogen atom?
a) ²S /₁ ₂
b) ³P₀
c) ⁴S /₃ ₂
d) ⁵D₀
Answer: c) ⁴S /₃ ₂