1 / 51100%
CHEM 301 - ORGANIC CHEMISTRY
I - Solubility and polarity calculations
Question Bank - Set 5
Liberty University
Question 1
Question
Determine which of the following compounds is most soluble in water at room
temperature based on their structures and polarity: 1. 1-decanol (C10H21OH)
2. Acetone (CH3COCH3) 3. Acetic acid (CH3COOH)
Solution
To determine the solubility of each compound in water, we need to consider the
polarity of the molecules. Compounds that can form hydrogen bonds with water
molecules are typically more soluble in water. We will analyze the structures of
each compound to determine their ability to form hydrogen bonds with water.
Step 1: Determine the polarity of each compound based on its structure: 1.
1-decanol: 1-decanol contains a hydroxyl group (OH) which can form hydrogen
bonds with water molecules. This makes it polar. 2. Acetone: Acetone does not
contain any hydrogen bonding sites. It has a polar carbonyl group, but it cannot
form hydrogen bonds with water due to the lack of hydrogen atoms bonded to
oxygen. 3. Acetic acid: Acetic acid contains a carboxyl group (COOH) which
can form hydrogen bonds with water molecules. This makes it polar.
Step 2: Based on the analysis in Step 1, the order of solubility in water
from most soluble to least soluble is: 1. Acetic acid (CH3COOH) 2. 1-decanol
(C10H21OH) 3. Acetone (CH3COCH3)
Therefore, acetic acid is the most soluble in water at room temperature
among the given compounds.
Question 2
Question
Determine which of the following compounds is most soluble in water:
1. Hexane (C6H14)
2. Acetone (C3H6O)
3. Ethanol (C2H5OH)
Solution
To determine the compound that is most soluble in water, we need to consider
the polarity of the compounds and their ability to form hydrogen bonds with
water molecules.
Step 1: Consider the chemical structures of the compounds:
1. Hexane (C6H14) - nonpolar molecule with only C-H bonds
2. Acetone (C3H6O) - polar molecule with a C=O bond
3. Ethanol (C2H5OH) - polar molecule with an -OH group that can partici-
pate in hydrogen bonding
Step 2: Evaluate the solubility of the compounds in water based on their
polarity and ability to form hydrogen bonds:
1. Hexane is nonpolar and cannot form hydrogen bonds with water. There-
fore, it is not soluble in water.
2. Acetone is a polar molecule with a C=O bond, allowing it to form hydro-
gen bonds with water. It is moderately soluble in water.
3. Ethanol is a polar molecule with an -OH group, which can form hydrogen
bonds with water. It is the most soluble compound in water among the
options given.
Therefore, the most soluble compound in water from the options provided
is Ethanol (C2H5OH).
Question 3
Question
A student is given a mixture of four compounds: hexane, ethanol, acetone, and
water. The student is asked to predict the order in which these compounds will
elute on a column chromatography setup using silica gel as the stationary phase
2
and hexane/acetone (1:1, v/v) as the mobile phase. Rank the compounds in
order of increasing elution time.
Given the following solubility data at room temperature: - hexane: insoluble
in water, soluble in acetone - ethanol: completely soluble in water and acetone
- acetone: miscible with water - water: soluble in acetone
Solution
Step 1: Based on the solubility data and the nature of the mobile phase (hex-
ane/acetone), we can rank the compounds as follows: - First to elute: ethanol
(completely soluble in hexane/acetone mixture) - Second to elute: water (solu-
ble in acetone) - Third to elute: acetone (miscible with water) - Last to elute:
hexane (soluble in acetone)
Therefore, the compounds will elute in the following order: ethanol, water,
acetone, hexane.
Question 4
Question
Determine which of the following pairs of compounds would show the most ideal
behavior in a solution:
Compound A: hexane (nonpolar) and hexanol (slightly polar) Compound B:
dichloromethane (polar) and methanol (polar)
Justify your answer based on the polarity of the compounds.
Solution
Step 1: Determine the polarity of the compounds. - Hexane: Hexane is a
nonpolar molecule because it contains only carbon and hydrogen atoms, which
have a similar electronegativity, leading to a symmetric charge distribution.
- Hexanol: Hexanol is slightly polar due to the presence of a polar hydroxyl
(OH) group, which creates an uneven charge distribution within the molecule.
- Dichloromethane: Dichloromethane is a polar molecule because of the elec-
tronegativity difference between chlorine and carbon atoms, leading to an un-
even charge distribution. - Methanol: Methanol is also a polar molecule because
of the electronegativity difference between oxygen and carbon atoms in the hy-
droxyl group.
Step 2: Predict the behavior of the compounds in a solution. - Compound
A (hexane and hexanol): In this case, hexane is nonpolar, while hexanol is
slightly polar. Nonpolar molecules tend to form non-ideal solutions with po-
lar molecules because of the differences in polarity. Hexane and hexanol would
show the least ideal behavior in a solution. - Compound B (dichloromethane
and methanol): Both dichloromethane and methanol are polar molecules. Polar
3
molecules tend to mix well with other polar molecules due to similar charge dis-
tributions. Dichloromethane and methanol would show the most ideal behavior
in a solution.
Therefore, the pair of compounds that would show the most ideal behavior
in a solution is Compound B: dichloromethane and methanol.
Question 5
Question
A student is performing a solubility experiment in organic chemistry. They
dissolve 1.5 grams of compound A in 100 mL of water at 25
°
C. The compound
fully dissolves in water with no remaining solid particles. Calculate the solubility
of compound A in water at 25
°
C in g/mL. The student also notices that the
compound does not dissolve in hexane. Based on this information, determine
the likely polarity of compound A.
Solution
To calculate the solubility of compound A in water, we need to determine the
amount of compound A that can dissolve in 1 mL of water at 25
°
C.
Step 1: Calculate the solubility of compound A in water Given: -
Mass of compound A = 1.5 grams - Volume of water = 100 mL = 0.1 L
The solubility of compound A in water can be calculated using the formula:
Solubility = Mass of compound A
Volume of water
Substitute the values into the formula:
Solubility = 1.5 g
0.1 L = 15 g/L
Therefore, the solubility of compound A in water at 25
°
C is 15 g/L.
Step 2: Determine the likely polarity of compound A Since com-
pound A dissolves in water but not in hexane, we can infer that compound A
is polar. Water is a polar solvent while hexane is non-polar. Polar compounds
tend to dissolve in polar solvents like water, while non-polar compounds dissolve
in non-polar solvents like hexane.
Therefore, compound A is likely to be a polar compound.
Question 6
Question
The solubility of compound A in water at 25
°
C is 0.03 g/100 mL, while the
solubility of compound B in water at the same temperature is 0.75 g/100 mL.
Compound A and compound B have a similar molecular weight. Which com-
pound is more soluble in water, and explain why?
4
Solution
Step 1: Calculate the molar solubility of compound A and compound B. Given
that the molecular weights are similar, we can assume the molar mass of com-
pound A is approximately equal to the molar mass of compound B.
For compound A: mA= 0.03 g V= 100 mL = 0.100 L MM = MMA≈
MMBMolar SolubilityA=0.03 g
1×1 mol
MM ×1
0.100 L =0.03
MM M
For compound B: mB= 0.75 g
Molar SolubilityB=0.75 g
1×1 mol
MM ×1
0.100 L =0.75
MM M
Step 2: Compare the molar solubilities of compound A and compound B.
Given that the molar masses are similar, the molar solubility of compound B
will be larger than compound A, since the solution was able to dissolve more
grams of compound B compared to compound A in the given volume of water.
Therefore, compound B is more soluble in water than compound A due to
its higher molar solubility.
Question 7
Question
A student is studying the solubility of different organic compounds in water.
After conducting several experiments, the student found that Compound A
is soluble in water while Compound B is insoluble in water. The molecular
structures of both compounds are provided below:
C(-[:90]H)(-[:270]H)(-[:180]H)-C(-[:90]H)(-[:270]H)(-[:180]H)-C(-[:270]H)(-
[:180]H)-C(-[:90]H)(-[:180]H)-O-H
C(-[:90]H)(-[:270]H)(-[:180]H)-C(-[:90]H)(-[:270]H)(-[:180]H)=C(-[:90]H)(-
[:270]H)-C(-[:90]H)(-[:270]H)
Based on the provided molecular structures, explain why Compound A is
soluble in water while Compound B is insoluble in water. Justify your answer
using solubility and polarity calculations.
Solution
Step 1: To determine the solubility of a compound in water, we need to con-
sider the polarity of the compound and the intermolecular forces between the
compound and water molecules.
Step 2: Compound A is a molecule with an -OH group (alcohol functional
group). The presence of the -OH group provides Compound A with the ability
to form hydrogen bonds with water molecules. This increases the solubility of
Compound A in water.
Step 3: Compound B is a hydrocarbon chain with a double bond between
two carbon atoms. This type of compound lacks functional groups like -OH that
5
can form hydrogen bonds with water molecules. As a result, Compound B does
not readily dissolve in water due to the absence of significant intermolecular
forces between the compound and water molecules.
Step 4: In addition to the presence of functional groups, the overall polarity
of a molecule also affects its solubility in water. The polarity of a compound is
determined by the electronegativity difference between atoms and the molecular
geometry.
Step 5: Compound A is more polar than Compound B because of the pres-
ence of the highly electronegative oxygen atom in the -OH group. This polarity
enhances the interactions between Compound A and water molecules, leading
to its solubility in water.
Step 6: On the other hand, Compound B is nonpolar due to the hydrocarbon
chain and the symmetrical distribution of electrons in the double bond. The lack
of polarity in Compound B results in weak interactions with water molecules,
making it insoluble in water.
Step 7: Therefore, based on the solubility and polarity calculations, Com-
pound A is soluble in water, while Compound B is insoluble in water.
Question 8
Question
A student is given a mixture of three organic compounds to separate based on
their solubility in various solvents. The student knows that Compound A is
soluble in water, Compound B is soluble in diethyl ether, and Compound C is
soluble in hexanes. The student adds the mixture to a separatory funnel and
extracts the compounds with water, diethyl ether, and hexanes successively.
After the extraction process, how can the student separate and recover each
compound individually?
Solution
To separate and recover each compound individually, the student can use the
principle of solubility in different solvents to selectively extract each compound
from the mixture. Here are the step-by-step instructions for separating and
recovering each compound:
Step 1: First, the student should extract Compound A, which is soluble in
water. This can be achieved by adding the mixture to a separatory funnel with
water and shaking the funnel. Compound A will dissolve in the aqueous layer.
Step 2: Next, the student should extract Compound B, which is soluble in
diethyl ether. By adding diethyl ether to the aqueous layer containing Com-
pound A and shaking the funnel, Compound B will transfer to the organic
diethyl ether layer.
Step 3: Finally, Compound C, which is soluble in hexanes, can be extracted
by adding hexanes to the diethyl ether layer containing Compound B. After
6
shaking the funnel, Compound C will transfer to the hexane layer.
Step 4: To recover each compound individually, the student can then sep-
arate the layers in the separatory funnel and collect each layer in a separate
container. By evaporating the solvent from each container, the student can
isolate and recover each compound separately.
This process allows the student to separate and recover each compound based
on their solubility in different solvents.
Question 9
Question
Calculate the solubility of acetanilide (C8H9NO) in water at 25◦C. The solubility
product constant (Ksp) of acetanilide in water at this temperature is 7.5×10−3
moles per liter. Assume acetanilide behaves like a non-electrolyte in water.
Solution
Step 1: Write the equilibrium expression for the dissolution of acetanilide in
water:
C8H9NO(s)⇌C8H9NO(aq)
Step 2: Write the solubility product constant expression:
Ksp = [C8H9NO]eq
Step 3: Let us assume x moles of acetanilide dissolve in water to form a
solution. Therefore, the equilibrium concentrations are:
[C8H9NO]eq =xM
Step 4: Substitute the equilibrium concentrations into the solubility product
constant expression:
7.5×10−3=x
Step 5: Solve for x:
x= 7.5×10−3M
Therefore, the solubility of acetanilide in water at 25◦C is 7.5×10−3M.
Question 10
Question
A student is given a mixture of two organic compounds, compound A and
compound B. Compound A is known to be soluble in water, while compound
B is known to be insoluble in water. The student needs to separate the two
compounds in the mixture. The student decides to use a solvent extraction
method. Provide a detailed explanation of how the student can separate the
two compounds using a suitable solvent.
7
Solution
To separate the two organic compounds using solvent extraction, the student
can follow the steps outlined below:
Step 1: Start by adding the mixture of compounds A and B to a separatory
funnel.
Step 2: Add an appropriate organic solvent to the separatory funnel. The
choice of solvent should be based on the solubility characteristics of the com-
pounds. Since compound A is soluble in water and compound B is insoluble
in water, the student can choose an organic solvent in which compound B is
soluble but compound A is not.
Step 3: Carefully shake the separatory funnel to allow the two immiscible
layers (aqueous and organic) to mix.
Step 4: Allow the separatory funnel to sit until two distinct layers form.
The organic layer will contain compound B dissolved in the organic solvent,
while the aqueous layer will contain compound A dissolved in water.
Step 5: Carefully open the stopcock of the separatory funnel and drain the
aqueous layer (containing compound A) into a separate container.
Step 6: Repeat the extraction process by adding fresh organic solvent to
the mixture of compound B in the separatory funnel.
Step 7: Shake the separatory funnel again to mix the layers, allow them
to separate, and drain the organic layer (now containing compound B) into a
separate container.
Step 8: Finally, evaporate the organic solvent from the two containers to
obtain compound A and compound B in pure form.
By following these steps, the student can successfully separate the two or-
ganic compounds using solvent extraction.
Question 11
Question
Determine which of the following compounds is expected to be most soluble
in water at room temperature based on the molecular structure and polarity
considerations:
A) Cyclohexane B) Ethyl alcohol C) Diethyl ether D) Acetic acid
Consider the structures and functional groups present in each compound.
Solution
To determine the solubility of these compounds in water, we need to assess their
polarity. Compounds with polar functional groups tend to be more soluble in
water due to the ability to form hydrogen bonds with water molecules.
Step 1: Identify the functional groups in each compound:
8
A) Cyclohexane - contains only nonpolar C-C and C-H bonds, making it
nonpolar.
B) Ethyl alcohol - contains an -OH hydroxyl group, which is polar and
can form hydrogen bonds with water.
C) Diethyl ether - consists of nonpolar C-C and C-H bonds, making it
nonpolar.
D) Acetic acid - has a carboxylic acid functional group (-COOH) which is
polar and can form hydrogen bonds with water.
Step 2: Based on the functional groups present, we expect ethyl alcohol
(compound B) and acetic acid (compound D) to be more soluble in water due
to their ability to form hydrogen bonds with water molecules.
Step 3: Therefore, the compound expected to be most soluble in water at
room temperature is D) Acetic acid.
Question 12
Question
A student is conducting solubility experiments with three substances: substance
A, substance B, and substance C. The student finds that substance A is soluble
in water, substance B is soluble in hexane, and substance C is soluble in both
water and hexane. Which of these substances is most likely to have significant
polar character? Justify your answer.
Solution
To determine which substance is most likely to have significant polar character,
we need to consider the solvents in which each substance is soluble.
Step 1: Substance A is soluble in water. This indicates that substance
A is likely to have polar characteristics since water is a polar solvent. Polar
substances tend to dissolve in polar solvents.
Step 2: Substance B is soluble in hexane. Hexane is a nonpolar solvent.
Therefore, substance B is likely to be nonpolar in nature. Nonpolar substances
tend to dissolve in nonpolar solvents.
Step 3: Substance C is soluble in both water and hexane. Substance C’s
ability to dissolve in both a polar solvent (water) and a nonpolar solvent (hex-
ane) suggests that substance C is likely to have both polar and nonpolar char-
acteristics. This makes substance C amphiphilic, meaning it has both polar and
nonpolar regions in its structure.
Step 4: Conclusion Based on the solubility properties of these substances,
substance A is most likely to have significant polar character since it dissolves
in water, a polar solvent. Substance B is likely to be nonpolar as it dissolves in
hexane, a nonpolar solvent. Substance C is amphiphilic, containing both polar
and nonpolar regions in its structure.
9
Question 13
Question
Calculate the solubility of benzoic acid (C6H5COOH) in water at 25
°
C. The
solubility product constant (Ksp) of benzoic acid in water at 25
°
C is 1.7×10−3.
Assume that benzoic acid completely dissociates in water.
Solution
Step 1: Write the dissociation of benzoic acid in water.
C6H5COOH(s)⇌C6H5COO−(aq)+H+(aq)
Step 2: Write the solubility equilibrium expression for benzoic acid.
Ksp = [C6H5COO−][H+]
Step 3: Since benzoic acid dissociates completely, the concentration of C6H5COO−
will be equal to the solubility of benzoic acid (s) and the concentration of H+
will also be equal to s.
Ksp =s×s=s2
Step 4: Substitute the given value of Ksp into the equation and solve for s.
1.7×10−3=s2
s=p1.7×10−3≈0.0412 M
Therefore, the solubility of benzoic acid in water at 25
°
C is approximately
0.0412 M.
Question 14
Question
An organic compound has a solubility of 0.08 g/100 mL at 25
°
C in water and
3.2 g/100 mL in ethanol at the same temperature. Calculate the partition
coefficient of the compound between water and ethanol at 25
°
C.
Solution
Step 1: Calculate the solubility in moles per 100 mL for both water and ethanol.
Given: Solubility in water = 0.08 g/100 mL Molar mass of the compound = x
g/mol
Let’s first calculate the solubility in moles per 100 mL for water:
Solubility in moles/100 mL (water) = 0.08 g/100 mL
xg/mol =0.08
xmol/100 mL
10
Similarly, for ethanol:
Solubility in moles/100 mL (ethanol) = 3.2 g/100 mL
xg/mol =3.2
xmol/100 mL
Step 2: Calculate the partition coefficient. The partition coefficient (Kp) is
defined as the ratio of the concentration of the compound in the organic phase
to the concentration of the compound in the aqueous phase. In this case, it
refers to the concentration of the compound in ethanol to the concentration of
the compound in water.
Kp=Concentration of compound in ethanol
Concentration of compound in water
Given that we are using molarity in this context,
Kp=Solubility in moles/100 mL (ethanol)
Solubility in moles/100 mL (water)
Substitute the previously calculated values:
Kp=
3.2
xmol/100 mL
0.08
xmol/100 mL =3.2
0.08 = 40
Therefore, the partition coefficient of the compound between water and
ethanol at 25
°
C is 40.
Question 15
Question
A student is performing a solubility experiment in which they mix 10.0 g of
compound A with 50.0 g of water at 25
°
C. After stirring, compound A fully
dissolves in the water. The student then measures the solubility of compound
A in water at this temperature as 30 g per 100 g of water.
Given that the molar mass of compound A is 180 g/mol, calculate the solu-
bility product constant (Ksp) for compound A in water at 25
°
C.
Solution
Step 1: Calculate the molarity of compound A in the saturated solution. The
molarity can be calculated using the solubility as follows:
Solubility (mol/L) = Solubility (g/L)
Molar mass (g/mol)
Solubility (mol/L) = 30 g/100 g of water
180 g/mol ×1000 mL/L
1000 mL/L
11
Solubility (mol/L) = 0.1667 mol/L
1000 L/L = 0.1667 mol/L
Step 2: Write the dissolution equilibrium for compound A. The dissolution
equilibrium for compound A in water can be written as:
A⇌A(aq)
Step 3: Write the expression for the solubility product constant (Ksp). The
solubility product constant (Ksp) is given by:
Ksp = [A]
Step 4: Calculate the solubility product constant (Ksp). Since the solubility
of compound A in water at 25
°
C is 0.1667 mol/L, the Ksp is:
Ksp = (0.1667)1= 0.1667
Therefore, the solubility product constant (Ksp) for compound A in water
at 25
°
C is 0.1667.
Question 16
Question
A student has a mixture of three substances: Substance A, Substance B, and
Substance C. The solubility of each substance in water at 25
°
C is given below:
Substance A: 2.5 g/L Substance B: 0.8 g/L Substance C: 1.3 g/L
The student wants to separate the substances using solvent extraction. The
student must choose between dichloromethane (CH2Cl2) and ethanol (C2H5OH)
as the solvent. The solubility of each substance in these solvents at 25
°
C is given
below:
Substance A: - Dichloromethane: 4 g/L - Ethanol: 6 g/L
Substance B: - Dichloromethane: 1.2 g/L - Ethanol: 5 g/L
Substance C: - Dichloromethane: 3 g/L - Ethanol: 0.5 g/L
Which solvent should the student use to extract each substance in order to
obtain the greatest separation efficiency?
Solution
Step 1: Calculate the partition coefficient (K) for each substance in both sol-
vents.
The partition coefficient is calculated as the solubility of the substance in
the organic solvent divided by the solubility of the substance in water.
For Substance A: - KDichloromethane =4 g/L
2.5 g/L = 1.6 - KEthanol =6 g/L
2.5 g/L = 2.4
For Substance B: - KDichloromethane =1.2 g/L
0.8 g/L = 1.5 - KEthanol =5 g/L
0.8 g/L =
6.25
12
For Substance C: - KDichloromethane =3 g/L
1.3 g/L = 2.31 - KEthanol =0.5 g/L
1.3 g/L =
0.385
Step 2: Analyze the partition coefficients to determine the best solvent for
each substance.
Substance A: Since KEthanol > KDichloromethane, Substance A will have a
higher partition coefficient in ethanol than in dichloromethane. Therefore,
ethanol should be used to extract Substance A.
Substance B: Since KEthanol > KDichloromethane, Substance B will have a
higher partition coefficient in ethanol than in dichloromethane. Therefore,
ethanol should be used to extract Substance B.
Substance C: Since KDichloromethane > KEthanol, Substance C will have a
higher partition coefficient in dichloromethane than in ethanol. Therefore,
dichloromethane should be used to extract Substance C.
In conclusion, the student should use ethanol to extract Substance A and
Substance B, and dichloromethane to extract Substance C for the greatest sep-
aration efficiency.
Question 17
Question
A student is conducting a solubility experiment with three organic compounds:
Compound X, Compound Y, and Compound Z. The student determines that
Compound X is soluble in water, Compound Y is soluble in hexane, and Com-
pound Z is soluble in both water and hexane. Based on this information, rank
the compounds in order of increasing polarity.
Solution
Step 1: Determine the polarity of water and hexane. Water is a polar solvent
due to its high dielectric constant and ability to form hydrogen bonds. Hexane
is a nonpolar solvent because it is a hydrocarbon with only C-H bonds.
Step 2: Analyze the solubility behaviors of the compounds. - Compound X
is soluble in water: this indicates that Compound X is also polar because like
dissolves like (polar compounds dissolve in polar solvents). - Compound Y is
soluble in hexane: this suggests that Compound Y is nonpolar since nonpolar
compounds dissolve in nonpolar solvents. - Compound Z is soluble in both
water and hexane: this implies that Compound Z has both polar and nonpolar
characteristics, making it a polar compound.
Step 3: Rank the compounds in order of increasing polarity. - Compound
Y: This compound is soluble in hexane, a nonpolar solvent, indicating that it is
nonpolar. - Compound X: This compound is soluble in water, a polar solvent,
indicating that it is polar. - Compound Z: This compound is soluble in both
water and hexane, suggesting it has both polar and nonpolar characteristics,
making it the most polar compound.
13
Therefore, the compounds should be ranked in increasing order of polarity
as Compound Y ¡ Compound X ¡ Compound Z.
Question 18
Question
Calculate the solubility of benzoic acid (C6H5COOH) in water at 25◦C. The
solubility product constant (Ksp) for benzoic acid at this temperature is 2.6×
10−4.
Solution
Step 1: The equilibrium expression for the dissolution of benzoic acid in water
is:
C6H5COOH ⇌C6H5COO−+ H+
Step 2: Let x be the solubility of benzoic acid. Then at equilibrium, the
concentrations of C6H5COOH, C6H5COO−, and H+are:
[C6H5COOH] = 1 −x
[C6H5COO−] = x
[H+] = x
Step 3: Substitute these concentrations into the expression for Ksp:
Ksp = [C6H5COO−][H+] = x2
Step 4: Since Ksp = 2.6×10−4, we have:
x2= 2.6×10−4
x=p2.6×10−4
Step 5: Calculating the solubility of benzoic acid:
x=p2.6×10−4
x≈0.0161 M
Therefore, the solubility of benzoic acid in water at 25◦C is approximately
0.0161 M.
Question 19
Question
Determine which of the following compounds is expected to be the most soluble
in water based on their polarity: 1. Ethanol (CH3CH2OH) 2. Diethyl ether
(CH3CH2OCH2CH3) 3. 1,2-dichloroethane (CH2ClCH2Cl)
14
Solution
To determine the solubility of each compound in water based on polarity, we
need to consider the polarity of the compound and the polarity of water. Com-
pounds are generally more soluble in water if they can form hydrogen bonds
with water molecules.
Step 1: Determine the polarity of each compound. 1. Ethanol (CH3CH2OH)
- Ethanol contains a hydroxyl group (OH), making it polar. 2. Diethyl ether
(CH3CH2OCH2CH3) - Diethyl ether does not contain any polar groups, making
it nonpolar. 3. 1,2-dichloroethane (CH2ClCH2Cl) - 1,2-dichloroethane contains
polar C-Cl bonds but overall has a symmetrical structure that cancels out the
polarity, making it nonpolar.
Step 2: Consider the solubility in water based on polarity. - Ethanol is
polar and can form hydrogen bonds with water molecules, so it is expected
to be soluble in water. - Diethyl ether is nonpolar and does not form hydro-
gen bonds with water molecules, so it is expected to be insoluble in water. -
1,2-dichloroethane is nonpolar and does not form hydrogen bonds with water
molecules, so it is expected to be insoluble in water.
Therefore, the most soluble compound in water among the given options is
Ethanol (CH3CH2OH).
Question 20
Question
Calculate the solubility of benzoic acid (C6H5COOH, M m = 122.12 g/mol) in
water at 25◦C. The solubility product of benzoic acid in water is 0.34 g/L.
Solution
Step 1: Write the dissolution reaction of benzoic acid in water.
C6H5COOH(s) ⇌C6H5COOH(aq)
Step 2: Write the equilibrium expression for the solubility product.
Ksp = [C6H5COOH]aq = 0.34 g/L
Step 3: Calculate the molar solubility using the molar mass of benzoic acid.
Molar solubility = 0.34 g/L
122.12 g/mol = 0.00279 mol/L
Therefore, the solubility of benzoic acid in water at 25◦Cis 0.00279 mol/L.
15
Question 21
Question
An organic compound with the molecular formula C6H10O2is known to be
soluble in water. Determine the most likely functional group present in this
compound. Justify your answer.
Solution
Step 1: Calculate the degree of unsaturation (DU) using the formula:
DU = 2C+ 2 −H+N−X
2
where: - Cis the number of carbon atoms (6 in this case), - His the number
of hydrogen atoms (10 in this case), - Nis the number of nitrogen atoms (0 in
this case), - Xis the number of halogen atoms (0 in this case).
DU = 2(6) + 2 −10 + 0 −0
2= 3
Since the degree of unsaturation is 3, there are likely to be multiple bonds
or rings in the compound.
Step 2: Determine potential functional groups with the given molecular
formula. Possible structures with a molecular formula of C6H10O2and 3 degrees
of unsaturation include: - Esters (R−COO −R) - Carboxylic acids (RCOOH)
- Lactones (O=C−O−R)
Step 3: Considering the solubility of the compound in water, the most likely
functional group present is the carboxylic acid group (RCOOH). Carboxylic
acids are generally soluble in water due to the formation of hydrogen bonds with
water molecules through the -COOH group.
Therefore, the most likely functional group present in the compound is a
carboxylic acid.
Question 22
Question
A student is given a mixture of three compounds: a polar compound (X), a
moderately polar compound (Y), and a nonpolar compound (Z). The student
has to separate these compounds based on their solubility in a nonpolar solvent.
The solubilities of X, Y, and Z in the nonpolar solvent are 0.5 g/mL, 0.9 g/mL,
and 1.2 g/mL, respectively. If the mixture contains 3.0 g of each compound,
what volume of the nonpolar solvent is needed to dissolve all of the compounds
completely?
16
Solution
Step 1: Calculate the mass of each compound that can be dissolved in 1 mL
of the nonpolar solvent: - Compound X: 0.5 g/mL - Compound Y: 0.9 g/mL -
Compound Z: 1.2 g/mL
Step 2: Determine the total mass of the mixture: Total mass = 3.0 g (X) +
3.0 g (Y) + 3.0 g (Z) = 9.0 g
Step 3: Calculate the total volume of the nonpolar solvent required to dis-
solve all the compounds completely: - Volume of nonpolar solvent for X = 3.0
g / 0.5 g/mL = 6 mL - Volume of nonpolar solvent for Y = 3.0 g / 0.9 g/mL
3.33 mL - Volume of nonpolar solvent for Z = 3.0 g / 1.2 g/mL = 2.5 mL
Step 4: Add up the volumes needed for each compound: Total volume = 6
mL (X) + 3.33 mL (Y) + 2.5 mL (Z) = 11.83 mL
Therefore, the student will need approximately 11.83 mL of the nonpolar
solvent to dissolve all of the compounds completely.
Question 23
Question
Calculate the solubility of benzoic acid (C7H6O2) in water at 25◦C. Given that
the solubility of benzoic acid in water is 3.4 g per 100 mL at this temperature,
determine the molarity and the mole fraction of benzoic acid in the saturated
solution.
Solution
Step 1: Calculate the molar mass of benzoic acid. Step 2: Convert the given
solubility from grams per 100 mL to grams per liter. Step 3: Calculate the
molarity of the benzoic acid solution. Step 4: Calculate the mole fraction of
benzoic acid in the saturated solution.
Step 1: The molar mass of benzoic acid (C7H6O2) can be calculated as:
Molar M ass = 7×Atomic Mass of Carbon+6×Atomic Mass of Hydrogen+2×Atomic M ass of Oxygen
Molar Mass = (7 ×12.01) + (6 ×1.01) + (2 ×16.00) = 122.12 g/mol
Step 2: Given that the solubility of benzoic acid in water is 3.4 g per 100
mL, we can convert this to grams per liter:
3.4g/100 mL ×1L
1000 mL = 0.034 g/mL
Step 3: Now, let’s calculate the molarity of the benzoic acid solution using
the solubility in grams per liter:
Molarity =M ass of Solute (g)
Molar Mass (g/mol)×V olume of Solvent (L)
17
Molarity =0.034 g
122.12 g/mol ×1L= 0.000278 mol/L
Step 4: Now, we can calculate the mole fraction of benzoic acid in the
saturated solution:
Mole F raction (X) = M oles of Solute
T otal M oles
Since the total moles come mainly from water, we can approximate the moles
of water to the volume of water (1 L) for our calculation.
Mole F raction (Xbenzoic acid) = 0.000278 mol
0.000278 mol + 55.5mol =0.000278
55.5+0.000278 ≈5.01×10−6
Therefore, the molarity of the benzoic acid solution is 0.000278 mol/L and
the mole fraction of benzoic acid in the saturated solution is approximately
5.01 ×10−6.
Question 24
Question
Calculate the solubility of ethyl cinnamate (C11H12O2) in water at 25◦C. The
solubility product of ethyl cinnamate at 25◦C is 3.2×10−4mol/L.
Solution
Step 1: Write the balanced equation for the dissolution of ethyl cinnamate in
water:
C11H12O2⇌C11H12O2(aq)
Step 2: Represent the equilibrium expression for the solubility of ethyl cin-
namate in water:
Ksp = [C11H12O2]1
Step 3: Substitute the given solubility product constant into the equilibrium
expression:
3.2×10−4= [C11H12O2]
Step 4: Solve for the concentration of ethyl cinnamate in water:
[C11H12O2]=3.2×10−4mol/L
Therefore, the solubility of ethyl cinnamate in water at 25◦C is 3.2×10−4
mol/L.
18
Question 25
Question
Calculate the solubility of benzoic acid (C6H5COOH,Ksp = 3.8×10−4at
25
º
C) in water. Assume that the volume change upon dissolving benzoic acid
in water is negligible.
Solution
Step 1: Write the equation for the dissolution of benzoic acid in water. Step 2:
Write the equilibrium expression for the dissolution of benzoic acid. Step 3: Set
up the solubility equilibrium expression and solve for the solubility of benzoic
acid.
Step 1:
The dissolution of benzoic acid in water can be represented by the equation:
C6H5COOH(s)⇌C6H5COOH(aq)
Step 2:
The equilibrium expression for this dissolution is:
Ksp = [C6H5COOH]
Step 3:
Given that Ksp = 3.8×10−4at 25
º
C, the solubility of benzoic acid can be
calculated by:
Ksp = [C6H5COOH] = 3.8×10−4M
Therefore, the solubility of benzoic acid in water at 25
º
C is 3.8×10−4M.
Question 26
Question
Predict which of the following compounds is most soluble in water based on its
polarity:
Compound A: CH3CH2CH2CH2OH
Compound B: CH3OCH3
Compound C: CH3CH2CH2CH2CH2CH3Compound C: CH3CH2CH2CH2CH2CH3Compound C: CH3CH2CH2CH2CH2CH3Compound C: CH3CH2CH2CH2CH2CH3
19
Solution
Step 1: Determine the polarity of each compound based on its functional groups.
- Compound A: CH3CH2CH2CH2OH is an alcohol with a hydroxyl group (OH)
which can form hydrogen bonds with water molecules, making it polar. - Com-
pound B: CH3OCH3is an ether with an oxygen atom between two alkyl groups,
but it does not have any hydrogen bonding capabilities, making it less likely to be
soluble in water. - Compound C: CH3CH2CH2CH2CH2CH3isanalkanewithonlycarbon−
carbonandcarbon −hydrogenbonds, makingitnon −polar.
Step 2: Predict solubility based on polarity. - Compounds that are polar
(like Compound A) are more likely to be soluble in water because they can
form hydrogen bonds with the water molecules. - Non-polar compounds (like
Compound C) are less likely to be soluble in water because water is a polar
solvent.
Step 3: Conclusion Therefore, the most soluble compound in water among
the given options is Compound A: CH3CH2CH2CH2OH.
Question 27
Question
A student is performing a solubility experiment with two organic compounds:
Compound A and Compound B. Compound A has a molar mass of 178 g/mol
and is soluble in water, while Compound B has a molar mass of 244 g/mol and
is insoluble in water. Which of the two compounds is likely to be more polar?
Justify your answer using relevant concepts from organic chemistry.
Solution
To determine which compound is more polar, we need to consider the solubility
behavior of the compounds in water and their molar masses.
Step 1: Calculate the molar mass difference First, calculate the dif-
ference in molar mass between the two compounds:
Molar mass difference = Molar mass of Compound B−Molar mass of Compound A
Molar mass difference = 244 g/mol −178 g/mol = 66 g/mol
Step 2: Analyze the solubility behavior Since Compound A is soluble
in water while Compound B is insoluble, we can infer that Compound A is more
polar than Compound B. This is because polar compounds tend to dissolve in
polar solvents like water, while nonpolar compounds do not.
Step 3: Rationalize the solubility behavior The greater the molar
mass difference between two compounds, the larger the polarity difference. In
this case, since Compound B has a higher molar mass than Compound A, it is
likely less polar. This difference in polarity is likely the reason for the differing
solubility behaviors observed in water.
20
Therefore, Compound A is likely more polar than Compound B due to its
solubility in water and the molar mass difference between the two compounds.
Question 28
Question
A student is investigating the solubility of two organic compounds, Compound
A and Compound B, in different solvents. Compound A has a molecular weight
of 116.3 g/mol and a partition coefficient (Kp) of 1.6 in water/n-octanol. Com-
pound B has a molecular weight of 204.4 g/mol and a partition coefficient (Kp)
of 0.8 in water/n-octanol.
Determine the solubility of Compound A in water and n-octanol, as well as
the solubility of Compound B in water and n-octanol.
(Hint: Use the relationship between partition coefficient, solubility in the
two solvents, and molecular weight.)
Solution
Step 1: Calculate the solubility of Compound A in water and n-octanol.
Given: MA= 116.3 g/mol KpA= 1.6
Let SAbe the solubility of Compound A in water and SoctA be the solubility
of Compound A in n-octanol.
The relationship between partition coefficient, solubility in the two solvents,
and molecular weight is given by:
KpA=SA
SoctA
=MWoctA
MWA
1.6 = SA
SoctA
=MA
MoctA
1.6 = SA
SoctA
=116.3
MoctA
MoctA =116.3
1.6= 72.69 g/mol
Therefore, the solubility of Compound A in water is 116.3 g/L and in n-
octanol is 72.69 g/L.
Step 2: Calculate the solubility of Compound B in water and n-octanol.
Given: MB= 204.4 g/mol KpB= 0.8
Let SBbe the solubility of Compound B in water and SoctB be the solubility
of Compound B in n-octanol.
Using the same relationship,
KpB=SB
SoctB
=MWB
MWoctB
21
0.8 = SB
SoctB
=MB
MoctB
0.8 = SB
SoctB
=204.4
MoctB
MoctB =204.4
0.8= 255.5 g/mol
Therefore, the solubility of Compound B in water is 204.4 g/L and in n-
octanol is 255.5 g/L.
Question 29
Question
A student is trying to determine the solubility of a compound in different sol-
vents. The student performs a solubility test and finds that the compound is
soluble in water, diethyl ether, and toluene, but insoluble in hexane. Based
on this information, determine the polarity of the compound and explain your
reasoning.
Solution
To determine the polarity of the compound, we can analyze its solubility be-
havior in different solvents.
Step 1: Water is a polar solvent, while hexane is nonpolar. The fact that
the compound is only soluble in water and not in hexane suggests that the
compound is likely polar. This is because like dissolves like - polar compounds
are more likely to dissolve in polar solvents, while nonpolar compounds are more
likely to dissolve in nonpolar solvents.
Step 2: The compound is also soluble in diethyl ether and toluene, which
are both organic solvents. This further supports the idea that the compound is
polar, as it is able to dissolve in these nonpolar solvents as well.
Step 3: Therefore, based on the solubility behavior of the compound in
different solvents, we can conclude that the compound is polar. It has both
polar and nonpolar characteristics, allowing it to dissolve in a variety of solvents
with different polarities.
Question 30
Question
A student is given a compound and asked to predict its solubility in water. The
compound has the following structure:
CH3(CH2)7CH(CH3)CH2(CH2)2OH
22
Determine whether the compound is likely to be soluble in water based on
its structure. Provide a rationale for your answer.
Solution
1. Identify the functional group in the compound. The compound contains an
alcohol functional group (-OH).
2. Assess the compound’s solubility in water based on the presence of the
alcohol functional group. Since the compound contains an alcohol group, it is
likely to be soluble in water. Alcohols are generally soluble in water due to the
ability to form hydrogen bonds between the -OH group of the alcohol and water
molecules.
3. In this specific compound, the alcohol functional group is located at the
end of a relatively long carbon chain, which includes a total of 10 carbon atoms.
The long hydrophobic carbon chain may reduce the overall solubility of the
compound in water compared to smaller alcohols, as the nonpolar carbon chain
could decrease the interactions between the alcohol group and water molecules.
4. Therefore, although the compound contains an alcohol functional group
that can form hydrogen bonds with water, the overall solubility in water may
be lower due to the presence of a long hydrophobic carbon chain. Thus, the
compound may be only sparingly soluble or insoluble in water.
Question 31
Question
Calculate the solubility (in g/L) of benzoic acid (C7H6O2) in water at 25
°
C.
The solubility of benzoic acid is 3.4 g/100 mL in water at this temperature.
Solution
Step 1: Calculate the molar mass of benzoic acid (C7H6O2). The molar mass
of benzoic acid is:
7×Atomic mass of C + 6 ×Atomic mass of H + 2 ×Atomic mass of O
= 7 ×12.01 g/mol + 6 ×1.008 g/mol + 2 ×16.00 g/mol
= 84.07 g/mol
Step 2: Calculate the solubility of benzoic acid in water in g/L. Since the
given solubility is 3.4 g/100 mL, first convert this to g/L:
3.4 g/100 mL = 34 g/L
23
Step 3: Calculate the molarity of benzoic acid in water. The molarity (M)
is defined as moles of solute per liter of solution. We need to first convert the
solubility in g/L to moles/L by dividing by the molar mass.
Moles of benzoic acid = 34 g/L
84.07 g/mol
Moles of benzoic acid = 0.404 mol/L
Step 4: Calculate the solubility of benzoic acid in water at 25
°
C. The solu-
bility in g/L can be calculated by multiplying the molarity by the molar mass.
Solubility of benzoic acid = 0.404 mol/L ×84.07 g/mol
Solubility of benzoic acid = 34 g/L
Therefore, the solubility of benzoic acid in water at 25
°
C is 34 g/L.
Question 32
Question
A student is trying to determine the solubility of two organic compounds, com-
pound A and compound B, in water at 25
°
C. Compound A has a calculated
LogP value of 1.5 and compound B has a calculated LogP value of 3.2. Based
on the LogP values, predict which compound would be more soluble in water.
Justify your answer.
Solution
Step 1: LogP Values The LogP value is a measure of the hydrophobicity of a
compound. A higher LogP value indicates a more hydrophobic compound.
Step 2: Prediction Since water is a polar solvent, it tends to dissolve po-
lar or hydrophilic compounds better than nonpolar or hydrophobic compounds.
In this case, compound A with a lower LogP value of 1.5 is more polar (less
hydrophobic) compared to compound B with a higher LogP value of 3.2. There-
fore, compound A is predicted to be more soluble in water due to its relatively
higher polarity.
Step 3: Justification The prediction is based on the principle that ”like
dissolves like.” Water is a polar solvent (due to its dipole nature), so it readily
dissolves other polar molecules. Since compound A is relatively more polar than
compound B, it is expected to have stronger interactions with water molecules,
resulting in higher solubility. Compound B, being more hydrophobic, will have
weaker interactions with water and therefore lower solubility in water.
24
Question 33
Question
Using the solubility rules, predict whether the following compounds are soluble
or insoluble in water: n-pentane, potassium iodide, and acetone.
Solution
1. Solubility of n-pentane: n-pentane is a nonpolar molecule due to the pres-
ence of only carbon-carbon and carbon-hydrogen bonds. Nonpolar molecules are
generally insoluble in water because water is a polar solvent. Thus, n-pentane
is insoluble in water.
2. Solubility of potassium iodide (KI): According to the solubility rules,
all compounds containing alkali metal cations (e.g., potassium) are soluble in
water. Additionally, iodide salts are soluble unless paired with silver, lead, or
mercury(II) ions. Therefore, potassium iodide (KI) is soluble in water.
3. Solubility of acetone (CH3COCH3): Acetone is a polar molecule
due to the presence of a carbonyl group (C=O), which imparts a significant
dipole moment. As water is also a polar solvent, acetone is soluble in water due
to the ability of polar molecules to dissolve in other polar substances.
Question 34
Question
Determine which of the following compounds is most soluble in water based on
their chemical structures:
A) CH3CH2OH B) CH3CH2CH2CH3C) CH3CH2COOH D) CH3OCH3
Solution
Step 1: Analyze the chemical structures of the compounds. - Compound A
is ethanol. - Compound B is butane. - Compound C is propanoic acid. -
Compound D is dimethyl ether.
Step 2: Determine the most soluble compound in water. - Water is a polar
molecule, which means it can dissolve other polar compounds or compounds
that can form hydrogen bonds. - Among the given compounds, compound C
(propanoic acid) is the most soluble in water because it can form hydrogen
bonds with water molecules through its carboxylic acid functional group. -
Compounds A and D are partially soluble in water as they contain a hydroxyl
group and an ether group, respectively. - Compound B (butane) is the least
soluble in water as it is nonpolar and cannot form any significant interactions
with water molecules.
25
Therefore, compound C) CH3CH2COOH (propanoic acid) is the most
soluble in water among the given compounds.
Question 35
Question
Calculate the solubility of benzoic acid (CHO) in water at 25
°
C. The Ksp of
benzoic acid at this temperature is 6.3×10−5.
Solution
Step 1: Write the equilibrium equation for the dissolution of benzoic acid in
water:
CHO(s)⇌CHO(aq)
Step 2: Write the expression for the solubility product (Ksp):
Ksp = [CHO] = 6.3×10−5
Step 3: Define the initial amount of benzoic acid dissolved as x (mol/L). At
equilibrium, the concentration of benzoic acid is also x mol/L.
Step 4: Substitute the equilibrium concentration into the Ksp expression:
6.3×10−5=x×x
x2= 6.3×10−5
Step 5: Solve for x to find the solubility of benzoic acid in water:
x=p6.3×10−5= 0.0079 mol/L
Therefore, the solubility of benzoic acid in water at 25
°
C is 0.0079 mol/L.
26
Question 2
Question
Determine which of the following compounds is most soluble in water:
1. Hexane (C6H14)
2. Acetone (C3H6O)
3. Ethanol (C2H5OH)
Solution
To determine the compound that is most soluble in water, we need to consider
the polarity of the compounds and their ability to form hydrogen bonds with
water molecules.
Step 1: Consider the chemical structures of the compounds:
1. Hexane (C6H14) - nonpolar molecule with only C-H bonds
2. Acetone (C3H6O) - polar molecule with a C=O bond
3. Ethanol (C2H5OH) - polar molecule with an -OH group that can partici-
pate in hydrogen bonding
Step 2: Evaluate the solubility of the compounds in water based on their
polarity and ability to form hydrogen bonds:
1. Hexane is nonpolar and cannot form hydrogen bonds with water. There-
fore, it is not soluble in water.
2. Acetone is a polar molecule with a C=O bond, allowing it to form hydro-
gen bonds with water. It is moderately soluble in water.
3. Ethanol is a polar molecule with an -OH group, which can form hydrogen
bonds with water. It is the most soluble compound in water among the
options given.
Therefore, the most soluble compound in water from the options provided
is Ethanol (C2H5OH).
Question 3
Question
A student is given a mixture of four compounds: hexane, ethanol, acetone, and
water. The student is asked to predict the order in which these compounds will
elute on a column chromatography setup using silica gel as the stationary phase
2
and hexane/acetone (1:1, v/v) as the mobile phase. Rank the compounds in
order of increasing elution time.
Given the following solubility data at room temperature: - hexane: insoluble
in water, soluble in acetone - ethanol: completely soluble in water and acetone
- acetone: miscible with water - water: soluble in acetone
Solution
Step 1: Based on the solubility data and the nature of the mobile phase (hex-
ane/acetone), we can rank the compounds as follows: - First to elute: ethanol
(completely soluble in hexane/acetone mixture) - Second to elute: water (solu-
ble in acetone) - Third to elute: acetone (miscible with water) - Last to elute:
hexane (soluble in acetone)
Therefore, the compounds will elute in the following order: ethanol, water,
acetone, hexane.
Question 4
Question
Determine which of the following pairs of compounds would show the most ideal
behavior in a solution:
Compound A: hexane (nonpolar) and hexanol (slightly polar) Compound B:
dichloromethane (polar) and methanol (polar)
Justify your answer based on the polarity of the compounds.
Solution
Step 1: Determine the polarity of the compounds. - Hexane: Hexane is a
nonpolar molecule because it contains only carbon and hydrogen atoms, which
have a similar electronegativity, leading to a symmetric charge distribution.
- Hexanol: Hexanol is slightly polar due to the presence of a polar hydroxyl
(OH) group, which creates an uneven charge distribution within the molecule.
- Dichloromethane: Dichloromethane is a polar molecule because of the elec-
tronegativity difference between chlorine and carbon atoms, leading to an un-
even charge distribution. - Methanol: Methanol is also a polar molecule because
of the electronegativity difference between oxygen and carbon atoms in the hy-
droxyl group.
Step 2: Predict the behavior of the compounds in a solution. - Compound
A (hexane and hexanol): In this case, hexane is nonpolar, while hexanol is
slightly polar. Nonpolar molecules tend to form non-ideal solutions with po-
lar molecules because of the differences in polarity. Hexane and hexanol would
show the least ideal behavior in a solution. - Compound B (dichloromethane
and methanol): Both dichloromethane and methanol are polar molecules. Polar
3
molecules tend to mix well with other polar molecules due to similar charge dis-
tributions. Dichloromethane and methanol would show the most ideal behavior
in a solution.
Therefore, the pair of compounds that would show the most ideal behavior
in a solution is Compound B: dichloromethane and methanol.
Question 5
Question
A student is performing a solubility experiment in organic chemistry. They
dissolve 1.5 grams of compound A in 100 mL of water at 25
°
C. The compound
fully dissolves in water with no remaining solid particles. Calculate the solubility
of compound A in water at 25
°
C in g/mL. The student also notices that the
compound does not dissolve in hexane. Based on this information, determine
the likely polarity of compound A.
Solution
To calculate the solubility of compound A in water, we need to determine the
amount of compound A that can dissolve in 1 mL of water at 25
°
C.
Step 1: Calculate the solubility of compound A in water Given: -
Mass of compound A = 1.5 grams - Volume of water = 100 mL = 0.1 L
The solubility of compound A in water can be calculated using the formula:
Solubility = Mass of compound A
Volume of water
Substitute the values into the formula:
Solubility = 1.5 g
0.1 L = 15 g/L
Therefore, the solubility of compound A in water at 25
°
C is 15 g/L.
Step 2: Determine the likely polarity of compound A Since com-
pound A dissolves in water but not in hexane, we can infer that compound A
is polar. Water is a polar solvent while hexane is non-polar. Polar compounds
tend to dissolve in polar solvents like water, while non-polar compounds dissolve
in non-polar solvents like hexane.
Therefore, compound A is likely to be a polar compound.
Question 6
Question
The solubility of compound A in water at 25
°
C is 0.03 g/100 mL, while the
solubility of compound B in water at the same temperature is 0.75 g/100 mL.
Compound A and compound B have a similar molecular weight. Which com-
pound is more soluble in water, and explain why?
4
Solution
Step 1: Calculate the molar solubility of compound A and compound B. Given
that the molecular weights are similar, we can assume the molar mass of com-
pound A is approximately equal to the molar mass of compound B.
For compound A: mA= 0.03 g V= 100 mL = 0.100 L MM = MMA≈
MMBMolar SolubilityA=0.03 g
1×1 mol
MM ×1
0.100 L =0.03
MM M
For compound B: mB= 0.75 g
Molar SolubilityB=0.75 g
1×1 mol
MM ×1
0.100 L =0.75
MM M
Step 2: Compare the molar solubilities of compound A and compound B.
Given that the molar masses are similar, the molar solubility of compound B
will be larger than compound A, since the solution was able to dissolve more
grams of compound B compared to compound A in the given volume of water.
Therefore, compound B is more soluble in water than compound A due to
its higher molar solubility.
Question 7
Question
A student is studying the solubility of different organic compounds in water.
After conducting several experiments, the student found that Compound A
is soluble in water while Compound B is insoluble in water. The molecular
structures of both compounds are provided below:
C(-[:90]H)(-[:270]H)(-[:180]H)-C(-[:90]H)(-[:270]H)(-[:180]H)-C(-[:270]H)(-
[:180]H)-C(-[:90]H)(-[:180]H)-O-H
C(-[:90]H)(-[:270]H)(-[:180]H)-C(-[:90]H)(-[:270]H)(-[:180]H)=C(-[:90]H)(-
[:270]H)-C(-[:90]H)(-[:270]H)
Based on the provided molecular structures, explain why Compound A is
soluble in water while Compound B is insoluble in water. Justify your answer
using solubility and polarity calculations.
Solution
Step 1: To determine the solubility of a compound in water, we need to con-
sider the polarity of the compound and the intermolecular forces between the
compound and water molecules.
Step 2: Compound A is a molecule with an -OH group (alcohol functional
group). The presence of the -OH group provides Compound A with the ability
to form hydrogen bonds with water molecules. This increases the solubility of
Compound A in water.
Step 3: Compound B is a hydrocarbon chain with a double bond between
two carbon atoms. This type of compound lacks functional groups like -OH that
5
can form hydrogen bonds with water molecules. As a result, Compound B does
not readily dissolve in water due to the absence of significant intermolecular
forces between the compound and water molecules.
Step 4: In addition to the presence of functional groups, the overall polarity
of a molecule also affects its solubility in water. The polarity of a compound is
determined by the electronegativity difference between atoms and the molecular
geometry.
Step 5: Compound A is more polar than Compound B because of the pres-
ence of the highly electronegative oxygen atom in the -OH group. This polarity
enhances the interactions between Compound A and water molecules, leading
to its solubility in water.
Step 6: On the other hand, Compound B is nonpolar due to the hydrocarbon
chain and the symmetrical distribution of electrons in the double bond. The lack
of polarity in Compound B results in weak interactions with water molecules,
making it insoluble in water.
Step 7: Therefore, based on the solubility and polarity calculations, Com-
pound A is soluble in water, while Compound B is insoluble in water.
Question 8
Question
A student is given a mixture of three organic compounds to separate based on
their solubility in various solvents. The student knows that Compound A is
soluble in water, Compound B is soluble in diethyl ether, and Compound C is
soluble in hexanes. The student adds the mixture to a separatory funnel and
extracts the compounds with water, diethyl ether, and hexanes successively.
After the extraction process, how can the student separate and recover each
compound individually?
Solution
To separate and recover each compound individually, the student can use the
principle of solubility in different solvents to selectively extract each compound
from the mixture. Here are the step-by-step instructions for separating and
recovering each compound:
Step 1: First, the student should extract Compound A, which is soluble in
water. This can be achieved by adding the mixture to a separatory funnel with
water and shaking the funnel. Compound A will dissolve in the aqueous layer.
Step 2: Next, the student should extract Compound B, which is soluble in
diethyl ether. By adding diethyl ether to the aqueous layer containing Com-
pound A and shaking the funnel, Compound B will transfer to the organic
diethyl ether layer.
Step 3: Finally, Compound C, which is soluble in hexanes, can be extracted
by adding hexanes to the diethyl ether layer containing Compound B. After
6
shaking the funnel, Compound C will transfer to the hexane layer.
Step 4: To recover each compound individually, the student can then sep-
arate the layers in the separatory funnel and collect each layer in a separate
container. By evaporating the solvent from each container, the student can
isolate and recover each compound separately.
This process allows the student to separate and recover each compound based
on their solubility in different solvents.
Question 9
Question
Calculate the solubility of acetanilide (C8H9NO) in water at 25◦C. The solubility
product constant (Ksp) of acetanilide in water at this temperature is 7.5×10−3
moles per liter. Assume acetanilide behaves like a non-electrolyte in water.
Solution
Step 1: Write the equilibrium expression for the dissolution of acetanilide in
water:
C8H9NO(s)⇌C8H9NO(aq)
Step 2: Write the solubility product constant expression:
Ksp = [C8H9NO]eq
Step 3: Let us assume x moles of acetanilide dissolve in water to form a
solution. Therefore, the equilibrium concentrations are:
[C8H9NO]eq =xM
Step 4: Substitute the equilibrium concentrations into the solubility product
constant expression:
7.5×10−3=x
Step 5: Solve for x:
x= 7.5×10−3M
Therefore, the solubility of acetanilide in water at 25◦C is 7.5×10−3M.
Question 10
Question
A student is given a mixture of two organic compounds, compound A and
compound B. Compound A is known to be soluble in water, while compound
B is known to be insoluble in water. The student needs to separate the two
compounds in the mixture. The student decides to use a solvent extraction
method. Provide a detailed explanation of how the student can separate the
two compounds using a suitable solvent.
7
Solution
To separate the two organic compounds using solvent extraction, the student
can follow the steps outlined below:
Step 1: Start by adding the mixture of compounds A and B to a separatory
funnel.
Step 2: Add an appropriate organic solvent to the separatory funnel. The
choice of solvent should be based on the solubility characteristics of the com-
pounds. Since compound A is soluble in water and compound B is insoluble
in water, the student can choose an organic solvent in which compound B is
soluble but compound A is not.
Step 3: Carefully shake the separatory funnel to allow the two immiscible
layers (aqueous and organic) to mix.
Step 4: Allow the separatory funnel to sit until two distinct layers form.
The organic layer will contain compound B dissolved in the organic solvent,
while the aqueous layer will contain compound A dissolved in water.
Step 5: Carefully open the stopcock of the separatory funnel and drain the
aqueous layer (containing compound A) into a separate container.
Step 6: Repeat the extraction process by adding fresh organic solvent to
the mixture of compound B in the separatory funnel.
Step 7: Shake the separatory funnel again to mix the layers, allow them
to separate, and drain the organic layer (now containing compound B) into a
separate container.
Step 8: Finally, evaporate the organic solvent from the two containers to
obtain compound A and compound B in pure form.
By following these steps, the student can successfully separate the two or-
ganic compounds using solvent extraction.
Question 11
Question
Determine which of the following compounds is expected to be most soluble
in water at room temperature based on the molecular structure and polarity
considerations:
A) Cyclohexane B) Ethyl alcohol C) Diethyl ether D) Acetic acid
Consider the structures and functional groups present in each compound.
Solution
To determine the solubility of these compounds in water, we need to assess their
polarity. Compounds with polar functional groups tend to be more soluble in
water due to the ability to form hydrogen bonds with water molecules.
Step 1: Identify the functional groups in each compound:
8
A) Cyclohexane - contains only nonpolar C-C and C-H bonds, making it
nonpolar.
B) Ethyl alcohol - contains an -OH hydroxyl group, which is polar and
can form hydrogen bonds with water.
C) Diethyl ether - consists of nonpolar C-C and C-H bonds, making it
nonpolar.
D) Acetic acid - has a carboxylic acid functional group (-COOH) which is
polar and can form hydrogen bonds with water.
Step 2: Based on the functional groups present, we expect ethyl alcohol
(compound B) and acetic acid (compound D) to be more soluble in water due
to their ability to form hydrogen bonds with water molecules.
Step 3: Therefore, the compound expected to be most soluble in water at
room temperature is D) Acetic acid.
Question 12
Question
A student is conducting solubility experiments with three substances: substance
A, substance B, and substance C. The student finds that substance A is soluble
in water, substance B is soluble in hexane, and substance C is soluble in both
water and hexane. Which of these substances is most likely to have significant
polar character? Justify your answer.
Solution
To determine which substance is most likely to have significant polar character,
we need to consider the solvents in which each substance is soluble.
Step 1: Substance A is soluble in water. This indicates that substance
A is likely to have polar characteristics since water is a polar solvent. Polar
substances tend to dissolve in polar solvents.
Step 2: Substance B is soluble in hexane. Hexane is a nonpolar solvent.
Therefore, substance B is likely to be nonpolar in nature. Nonpolar substances
tend to dissolve in nonpolar solvents.
Step 3: Substance C is soluble in both water and hexane. Substance C’s
ability to dissolve in both a polar solvent (water) and a nonpolar solvent (hex-
ane) suggests that substance C is likely to have both polar and nonpolar char-
acteristics. This makes substance C amphiphilic, meaning it has both polar and
nonpolar regions in its structure.
Step 4: Conclusion Based on the solubility properties of these substances,
substance A is most likely to have significant polar character since it dissolves
in water, a polar solvent. Substance B is likely to be nonpolar as it dissolves in
hexane, a nonpolar solvent. Substance C is amphiphilic, containing both polar
and nonpolar regions in its structure.
9
Question 13
Question
Calculate the solubility of benzoic acid (C6H5COOH) in water at 25
°
C. The
solubility product constant (Ksp) of benzoic acid in water at 25
°
C is 1.7×10−3.
Assume that benzoic acid completely dissociates in water.
Solution
Step 1: Write the dissociation of benzoic acid in water.
C6H5COOH(s)⇌C6H5COO−(aq)+H+(aq)
Step 2: Write the solubility equilibrium expression for benzoic acid.
Ksp = [C6H5COO−][H+]
Step 3: Since benzoic acid dissociates completely, the concentration of C6H5COO−
will be equal to the solubility of benzoic acid (s) and the concentration of H+
will also be equal to s.
Ksp =s×s=s2
Step 4: Substitute the given value of Ksp into the equation and solve for s.
1.7×10−3=s2
s=p1.7×10−3≈0.0412 M
Therefore, the solubility of benzoic acid in water at 25
°
C is approximately
0.0412 M.
Question 14
Question
An organic compound has a solubility of 0.08 g/100 mL at 25
°
C in water and
3.2 g/100 mL in ethanol at the same temperature. Calculate the partition
coefficient of the compound between water and ethanol at 25
°
C.
Solution
Step 1: Calculate the solubility in moles per 100 mL for both water and ethanol.
Given: Solubility in water = 0.08 g/100 mL Molar mass of the compound = x
g/mol
Let’s first calculate the solubility in moles per 100 mL for water:
Solubility in moles/100 mL (water) = 0.08 g/100 mL
xg/mol =0.08
xmol/100 mL
10
Similarly, for ethanol:
Solubility in moles/100 mL (ethanol) = 3.2 g/100 mL
xg/mol =3.2
xmol/100 mL
Step 2: Calculate the partition coefficient. The partition coefficient (Kp) is
defined as the ratio of the concentration of the compound in the organic phase
to the concentration of the compound in the aqueous phase. In this case, it
refers to the concentration of the compound in ethanol to the concentration of
the compound in water.
Kp=Concentration of compound in ethanol
Concentration of compound in water
Given that we are using molarity in this context,
Kp=Solubility in moles/100 mL (ethanol)
Solubility in moles/100 mL (water)
Substitute the previously calculated values:
Kp=
3.2
xmol/100 mL
0.08
xmol/100 mL =3.2
0.08 = 40
Therefore, the partition coefficient of the compound between water and
ethanol at 25
°
C is 40.
Question 15
Question
A student is performing a solubility experiment in which they mix 10.0 g of
compound A with 50.0 g of water at 25
°
C. After stirring, compound A fully
dissolves in the water. The student then measures the solubility of compound
A in water at this temperature as 30 g per 100 g of water.
Given that the molar mass of compound A is 180 g/mol, calculate the solu-
bility product constant (Ksp) for compound A in water at 25
°
C.
Solution
Step 1: Calculate the molarity of compound A in the saturated solution. The
molarity can be calculated using the solubility as follows:
Solubility (mol/L) = Solubility (g/L)
Molar mass (g/mol)
Solubility (mol/L) = 30 g/100 g of water
180 g/mol ×1000 mL/L
1000 mL/L
11
Solubility (mol/L) = 0.1667 mol/L
1000 L/L = 0.1667 mol/L
Step 2: Write the dissolution equilibrium for compound A. The dissolution
equilibrium for compound A in water can be written as:
A⇌A(aq)
Step 3: Write the expression for the solubility product constant (Ksp). The
solubility product constant (Ksp) is given by:
Ksp = [A]
Step 4: Calculate the solubility product constant (Ksp). Since the solubility
of compound A in water at 25
°
C is 0.1667 mol/L, the Ksp is:
Ksp = (0.1667)1= 0.1667
Therefore, the solubility product constant (Ksp) for compound A in water
at 25
°
C is 0.1667.
Question 16
Question
A student has a mixture of three substances: Substance A, Substance B, and
Substance C. The solubility of each substance in water at 25
°
C is given below:
Substance A: 2.5 g/L Substance B: 0.8 g/L Substance C: 1.3 g/L
The student wants to separate the substances using solvent extraction. The
student must choose between dichloromethane (CH2Cl2) and ethanol (C2H5OH)
as the solvent. The solubility of each substance in these solvents at 25
°
C is given
below:
Substance A: - Dichloromethane: 4 g/L - Ethanol: 6 g/L
Substance B: - Dichloromethane: 1.2 g/L - Ethanol: 5 g/L
Substance C: - Dichloromethane: 3 g/L - Ethanol: 0.5 g/L
Which solvent should the student use to extract each substance in order to
obtain the greatest separation efficiency?
Solution
Step 1: Calculate the partition coefficient (K) for each substance in both sol-
vents.
The partition coefficient is calculated as the solubility of the substance in
the organic solvent divided by the solubility of the substance in water.
For Substance A: - KDichloromethane =4 g/L
2.5 g/L = 1.6 - KEthanol =6 g/L
2.5 g/L = 2.4
For Substance B: - KDichloromethane =1.2 g/L
0.8 g/L = 1.5 - KEthanol =5 g/L
0.8 g/L =
6.25
12
For Substance C: - KDichloromethane =3 g/L
1.3 g/L = 2.31 - KEthanol =0.5 g/L
1.3 g/L =
0.385
Step 2: Analyze the partition coefficients to determine the best solvent for
each substance.
Substance A: Since KEthanol > KDichloromethane, Substance A will have a
higher partition coefficient in ethanol than in dichloromethane. Therefore,
ethanol should be used to extract Substance A.
Substance B: Since KEthanol > KDichloromethane, Substance B will have a
higher partition coefficient in ethanol than in dichloromethane. Therefore,
ethanol should be used to extract Substance B.
Substance C: Since KDichloromethane > KEthanol, Substance C will have a
higher partition coefficient in dichloromethane than in ethanol. Therefore,
dichloromethane should be used to extract Substance C.
In conclusion, the student should use ethanol to extract Substance A and
Substance B, and dichloromethane to extract Substance C for the greatest sep-
aration efficiency.
Question 17
Question
A student is conducting a solubility experiment with three organic compounds:
Compound X, Compound Y, and Compound Z. The student determines that
Compound X is soluble in water, Compound Y is soluble in hexane, and Com-
pound Z is soluble in both water and hexane. Based on this information, rank
the compounds in order of increasing polarity.
Solution
Step 1: Determine the polarity of water and hexane. Water is a polar solvent
due to its high dielectric constant and ability to form hydrogen bonds. Hexane
is a nonpolar solvent because it is a hydrocarbon with only C-H bonds.
Step 2: Analyze the solubility behaviors of the compounds. - Compound X
is soluble in water: this indicates that Compound X is also polar because like
dissolves like (polar compounds dissolve in polar solvents). - Compound Y is
soluble in hexane: this suggests that Compound Y is nonpolar since nonpolar
compounds dissolve in nonpolar solvents. - Compound Z is soluble in both
water and hexane: this implies that Compound Z has both polar and nonpolar
characteristics, making it a polar compound.
Step 3: Rank the compounds in order of increasing polarity. - Compound
Y: This compound is soluble in hexane, a nonpolar solvent, indicating that it is
nonpolar. - Compound X: This compound is soluble in water, a polar solvent,
indicating that it is polar. - Compound Z: This compound is soluble in both
water and hexane, suggesting it has both polar and nonpolar characteristics,
making it the most polar compound.
13
Therefore, the compounds should be ranked in increasing order of polarity
as Compound Y ¡ Compound X ¡ Compound Z.
Question 18
Question
Calculate the solubility of benzoic acid (C6H5COOH) in water at 25◦C. The
solubility product constant (Ksp) for benzoic acid at this temperature is 2.6×
10−4.
Solution
Step 1: The equilibrium expression for the dissolution of benzoic acid in water
is:
C6H5COOH ⇌C6H5COO−+ H+
Step 2: Let x be the solubility of benzoic acid. Then at equilibrium, the
concentrations of C6H5COOH, C6H5COO−, and H+are:
[C6H5COOH] = 1 −x
[C6H5COO−] = x
[H+] = x
Step 3: Substitute these concentrations into the expression for Ksp:
Ksp = [C6H5COO−][H+] = x2
Step 4: Since Ksp = 2.6×10−4, we have:
x2= 2.6×10−4
x=p2.6×10−4
Step 5: Calculating the solubility of benzoic acid:
x=p2.6×10−4
x≈0.0161 M
Therefore, the solubility of benzoic acid in water at 25◦C is approximately
0.0161 M.
Question 19
Question
Determine which of the following compounds is expected to be the most soluble
in water based on their polarity: 1. Ethanol (CH3CH2OH) 2. Diethyl ether
(CH3CH2OCH2CH3) 3. 1,2-dichloroethane (CH2ClCH2Cl)
14
Solution
To determine the solubility of each compound in water based on polarity, we
need to consider the polarity of the compound and the polarity of water. Com-
pounds are generally more soluble in water if they can form hydrogen bonds
with water molecules.
Step 1: Determine the polarity of each compound. 1. Ethanol (CH3CH2OH)
- Ethanol contains a hydroxyl group (OH), making it polar. 2. Diethyl ether
(CH3CH2OCH2CH3) - Diethyl ether does not contain any polar groups, making
it nonpolar. 3. 1,2-dichloroethane (CH2ClCH2Cl) - 1,2-dichloroethane contains
polar C-Cl bonds but overall has a symmetrical structure that cancels out the
polarity, making it nonpolar.
Step 2: Consider the solubility in water based on polarity. - Ethanol is
polar and can form hydrogen bonds with water molecules, so it is expected
to be soluble in water. - Diethyl ether is nonpolar and does not form hydro-
gen bonds with water molecules, so it is expected to be insoluble in water. -
1,2-dichloroethane is nonpolar and does not form hydrogen bonds with water
molecules, so it is expected to be insoluble in water.
Therefore, the most soluble compound in water among the given options is
Ethanol (CH3CH2OH).
Question 20
Question
Calculate the solubility of benzoic acid (C6H5COOH, M m = 122.12 g/mol) in
water at 25◦C. The solubility product of benzoic acid in water is 0.34 g/L.
Solution
Step 1: Write the dissolution reaction of benzoic acid in water.
C6H5COOH(s) ⇌C6H5COOH(aq)
Step 2: Write the equilibrium expression for the solubility product.
Ksp = [C6H5COOH]aq = 0.34 g/L
Step 3: Calculate the molar solubility using the molar mass of benzoic acid.
Molar solubility = 0.34 g/L
122.12 g/mol = 0.00279 mol/L
Therefore, the solubility of benzoic acid in water at 25◦Cis 0.00279 mol/L.
15
Question 21
Question
An organic compound with the molecular formula C6H10O2is known to be
soluble in water. Determine the most likely functional group present in this
compound. Justify your answer.
Solution
Step 1: Calculate the degree of unsaturation (DU) using the formula:
DU = 2C+ 2 −H+N−X
2
where: - Cis the number of carbon atoms (6 in this case), - His the number
of hydrogen atoms (10 in this case), - Nis the number of nitrogen atoms (0 in
this case), - Xis the number of halogen atoms (0 in this case).
DU = 2(6) + 2 −10 + 0 −0
2= 3
Since the degree of unsaturation is 3, there are likely to be multiple bonds
or rings in the compound.
Step 2: Determine potential functional groups with the given molecular
formula. Possible structures with a molecular formula of C6H10O2and 3 degrees
of unsaturation include: - Esters (R−COO −R) - Carboxylic acids (RCOOH)
- Lactones (O=C−O−R)
Step 3: Considering the solubility of the compound in water, the most likely
functional group present is the carboxylic acid group (RCOOH). Carboxylic
acids are generally soluble in water due to the formation of hydrogen bonds with
water molecules through the -COOH group.
Therefore, the most likely functional group present in the compound is a
carboxylic acid.
Question 22
Question
A student is given a mixture of three compounds: a polar compound (X), a
moderately polar compound (Y), and a nonpolar compound (Z). The student
has to separate these compounds based on their solubility in a nonpolar solvent.
The solubilities of X, Y, and Z in the nonpolar solvent are 0.5 g/mL, 0.9 g/mL,
and 1.2 g/mL, respectively. If the mixture contains 3.0 g of each compound,
what volume of the nonpolar solvent is needed to dissolve all of the compounds
completely?
16
Solution
Step 1: Calculate the mass of each compound that can be dissolved in 1 mL
of the nonpolar solvent: - Compound X: 0.5 g/mL - Compound Y: 0.9 g/mL -
Compound Z: 1.2 g/mL
Step 2: Determine the total mass of the mixture: Total mass = 3.0 g (X) +
3.0 g (Y) + 3.0 g (Z) = 9.0 g
Step 3: Calculate the total volume of the nonpolar solvent required to dis-
solve all the compounds completely: - Volume of nonpolar solvent for X = 3.0
g / 0.5 g/mL = 6 mL - Volume of nonpolar solvent for Y = 3.0 g / 0.9 g/mL
3.33 mL - Volume of nonpolar solvent for Z = 3.0 g / 1.2 g/mL = 2.5 mL
Step 4: Add up the volumes needed for each compound: Total volume = 6
mL (X) + 3.33 mL (Y) + 2.5 mL (Z) = 11.83 mL
Therefore, the student will need approximately 11.83 mL of the nonpolar
solvent to dissolve all of the compounds completely.
Question 23
Question
Calculate the solubility of benzoic acid (C7H6O2) in water at 25◦C. Given that
the solubility of benzoic acid in water is 3.4 g per 100 mL at this temperature,
determine the molarity and the mole fraction of benzoic acid in the saturated
solution.
Solution
Step 1: Calculate the molar mass of benzoic acid. Step 2: Convert the given
solubility from grams per 100 mL to grams per liter. Step 3: Calculate the
molarity of the benzoic acid solution. Step 4: Calculate the mole fraction of
benzoic acid in the saturated solution.
Step 1: The molar mass of benzoic acid (C7H6O2) can be calculated as:
Molar M ass = 7×Atomic Mass of Carbon+6×Atomic Mass of Hydrogen+2×Atomic M ass of Oxygen
Molar Mass = (7 ×12.01) + (6 ×1.01) + (2 ×16.00) = 122.12 g/mol
Step 2: Given that the solubility of benzoic acid in water is 3.4 g per 100
mL, we can convert this to grams per liter:
3.4g/100 mL ×1L
1000 mL = 0.034 g/mL
Step 3: Now, let’s calculate the molarity of the benzoic acid solution using
the solubility in grams per liter:
Molarity =M ass of Solute (g)
Molar Mass (g/mol)×V olume of Solvent (L)
17
Molarity =0.034 g
122.12 g/mol ×1L= 0.000278 mol/L
Step 4: Now, we can calculate the mole fraction of benzoic acid in the
saturated solution:
Mole F raction (X) = M oles of Solute
T otal M oles
Since the total moles come mainly from water, we can approximate the moles
of water to the volume of water (1 L) for our calculation.
Mole F raction (Xbenzoic acid) = 0.000278 mol
0.000278 mol + 55.5mol =0.000278
55.5+0.000278 ≈5.01×10−6
Therefore, the molarity of the benzoic acid solution is 0.000278 mol/L and
the mole fraction of benzoic acid in the saturated solution is approximately
5.01 ×10−6.
Question 24
Question
Calculate the solubility of ethyl cinnamate (C11H12O2) in water at 25◦C. The
solubility product of ethyl cinnamate at 25◦C is 3.2×10−4mol/L.
Solution
Step 1: Write the balanced equation for the dissolution of ethyl cinnamate in
water:
C11H12O2⇌C11H12O2(aq)
Step 2: Represent the equilibrium expression for the solubility of ethyl cin-
namate in water:
Ksp = [C11H12O2]1
Step 3: Substitute the given solubility product constant into the equilibrium
expression:
3.2×10−4= [C11H12O2]
Step 4: Solve for the concentration of ethyl cinnamate in water:
[C11H12O2]=3.2×10−4mol/L
Therefore, the solubility of ethyl cinnamate in water at 25◦C is 3.2×10−4
mol/L.
18
Question 25
Question
Calculate the solubility of benzoic acid (C6H5COOH,Ksp = 3.8×10−4at
25
º
C) in water. Assume that the volume change upon dissolving benzoic acid
in water is negligible.
Solution
Step 1: Write the equation for the dissolution of benzoic acid in water. Step 2:
Write the equilibrium expression for the dissolution of benzoic acid. Step 3: Set
up the solubility equilibrium expression and solve for the solubility of benzoic
acid.
Step 1:
The dissolution of benzoic acid in water can be represented by the equation:
C6H5COOH(s)⇌C6H5COOH(aq)
Step 2:
The equilibrium expression for this dissolution is:
Ksp = [C6H5COOH]
Step 3:
Given that Ksp = 3.8×10−4at 25
º
C, the solubility of benzoic acid can be
calculated by:
Ksp = [C6H5COOH] = 3.8×10−4M
Therefore, the solubility of benzoic acid in water at 25
º
C is 3.8×10−4M.
Question 26
Question
Predict which of the following compounds is most soluble in water based on its
polarity:
Compound A: CH3CH2CH2CH2OH
Compound B: CH3OCH3
Compound C: CH3CH2CH2CH2CH2CH3Compound C: CH3CH2CH2CH2CH2CH3Compound C: CH3CH2CH2CH2CH2CH3Compound C: CH3CH2CH2CH2CH2CH3
19
Solution
Step 1: Determine the polarity of each compound based on its functional groups.
- Compound A: CH3CH2CH2CH2OH is an alcohol with a hydroxyl group (OH)
which can form hydrogen bonds with water molecules, making it polar. - Com-
pound B: CH3OCH3is an ether with an oxygen atom between two alkyl groups,
but it does not have any hydrogen bonding capabilities, making it less likely to be
soluble in water. - Compound C: CH3CH2CH2CH2CH2CH3isanalkanewithonlycarbon−
carbonandcarbon −hydrogenbonds, makingitnon −polar.
Step 2: Predict solubility based on polarity. - Compounds that are polar
(like Compound A) are more likely to be soluble in water because they can
form hydrogen bonds with the water molecules. - Non-polar compounds (like
Compound C) are less likely to be soluble in water because water is a polar
solvent.
Step 3: Conclusion Therefore, the most soluble compound in water among
the given options is Compound A: CH3CH2CH2CH2OH.
Question 27
Question
A student is performing a solubility experiment with two organic compounds:
Compound A and Compound B. Compound A has a molar mass of 178 g/mol
and is soluble in water, while Compound B has a molar mass of 244 g/mol and
is insoluble in water. Which of the two compounds is likely to be more polar?
Justify your answer using relevant concepts from organic chemistry.
Solution
To determine which compound is more polar, we need to consider the solubility
behavior of the compounds in water and their molar masses.
Step 1: Calculate the molar mass difference First, calculate the dif-
ference in molar mass between the two compounds:
Molar mass difference = Molar mass of Compound B−Molar mass of Compound A
Molar mass difference = 244 g/mol −178 g/mol = 66 g/mol
Step 2: Analyze the solubility behavior Since Compound A is soluble
in water while Compound B is insoluble, we can infer that Compound A is more
polar than Compound B. This is because polar compounds tend to dissolve in
polar solvents like water, while nonpolar compounds do not.
Step 3: Rationalize the solubility behavior The greater the molar
mass difference between two compounds, the larger the polarity difference. In
this case, since Compound B has a higher molar mass than Compound A, it is
likely less polar. This difference in polarity is likely the reason for the differing
solubility behaviors observed in water.
20
Therefore, Compound A is likely more polar than Compound B due to its
solubility in water and the molar mass difference between the two compounds.
Question 28
Question
A student is investigating the solubility of two organic compounds, Compound
A and Compound B, in different solvents. Compound A has a molecular weight
of 116.3 g/mol and a partition coefficient (Kp) of 1.6 in water/n-octanol. Com-
pound B has a molecular weight of 204.4 g/mol and a partition coefficient (Kp)
of 0.8 in water/n-octanol.
Determine the solubility of Compound A in water and n-octanol, as well as
the solubility of Compound B in water and n-octanol.
(Hint: Use the relationship between partition coefficient, solubility in the
two solvents, and molecular weight.)
Solution
Step 1: Calculate the solubility of Compound A in water and n-octanol.
Given: MA= 116.3 g/mol KpA= 1.6
Let SAbe the solubility of Compound A in water and SoctA be the solubility
of Compound A in n-octanol.
The relationship between partition coefficient, solubility in the two solvents,
and molecular weight is given by:
KpA=SA
SoctA
=MWoctA
MWA
1.6 = SA
SoctA
=MA
MoctA
1.6 = SA
SoctA
=116.3
MoctA
MoctA =116.3
1.6= 72.69 g/mol
Therefore, the solubility of Compound A in water is 116.3 g/L and in n-
octanol is 72.69 g/L.
Step 2: Calculate the solubility of Compound B in water and n-octanol.
Given: MB= 204.4 g/mol KpB= 0.8
Let SBbe the solubility of Compound B in water and SoctB be the solubility
of Compound B in n-octanol.
Using the same relationship,
KpB=SB
SoctB
=MWB
MWoctB
21
0.8 = SB
SoctB
=MB
MoctB
0.8 = SB
SoctB
=204.4
MoctB
MoctB =204.4
0.8= 255.5 g/mol
Therefore, the solubility of Compound B in water is 204.4 g/L and in n-
octanol is 255.5 g/L.
Question 29
Question
A student is trying to determine the solubility of a compound in different sol-
vents. The student performs a solubility test and finds that the compound is
soluble in water, diethyl ether, and toluene, but insoluble in hexane. Based
on this information, determine the polarity of the compound and explain your
reasoning.
Solution
To determine the polarity of the compound, we can analyze its solubility be-
havior in different solvents.
Step 1: Water is a polar solvent, while hexane is nonpolar. The fact that
the compound is only soluble in water and not in hexane suggests that the
compound is likely polar. This is because like dissolves like - polar compounds
are more likely to dissolve in polar solvents, while nonpolar compounds are more
likely to dissolve in nonpolar solvents.
Step 2: The compound is also soluble in diethyl ether and toluene, which
are both organic solvents. This further supports the idea that the compound is
polar, as it is able to dissolve in these nonpolar solvents as well.
Step 3: Therefore, based on the solubility behavior of the compound in
different solvents, we can conclude that the compound is polar. It has both
polar and nonpolar characteristics, allowing it to dissolve in a variety of solvents
with different polarities.
Question 30
Question
A student is given a compound and asked to predict its solubility in water. The
compound has the following structure:
CH3(CH2)7CH(CH3)CH2(CH2)2OH
22
Determine whether the compound is likely to be soluble in water based on
its structure. Provide a rationale for your answer.
Solution
1. Identify the functional group in the compound. The compound contains an
alcohol functional group (-OH).
2. Assess the compound’s solubility in water based on the presence of the
alcohol functional group. Since the compound contains an alcohol group, it is
likely to be soluble in water. Alcohols are generally soluble in water due to the
ability to form hydrogen bonds between the -OH group of the alcohol and water
molecules.
3. In this specific compound, the alcohol functional group is located at the
end of a relatively long carbon chain, which includes a total of 10 carbon atoms.
The long hydrophobic carbon chain may reduce the overall solubility of the
compound in water compared to smaller alcohols, as the nonpolar carbon chain
could decrease the interactions between the alcohol group and water molecules.
4. Therefore, although the compound contains an alcohol functional group
that can form hydrogen bonds with water, the overall solubility in water may
be lower due to the presence of a long hydrophobic carbon chain. Thus, the
compound may be only sparingly soluble or insoluble in water.
Question 31
Question
Calculate the solubility (in g/L) of benzoic acid (C7H6O2) in water at 25
°
C.
The solubility of benzoic acid is 3.4 g/100 mL in water at this temperature.
Solution
Step 1: Calculate the molar mass of benzoic acid (C7H6O2). The molar mass
of benzoic acid is:
7×Atomic mass of C + 6 ×Atomic mass of H + 2 ×Atomic mass of O
= 7 ×12.01 g/mol + 6 ×1.008 g/mol + 2 ×16.00 g/mol
= 84.07 g/mol
Step 2: Calculate the solubility of benzoic acid in water in g/L. Since the
given solubility is 3.4 g/100 mL, first convert this to g/L:
3.4 g/100 mL = 34 g/L
23
Step 3: Calculate the molarity of benzoic acid in water. The molarity (M)
is defined as moles of solute per liter of solution. We need to first convert the
solubility in g/L to moles/L by dividing by the molar mass.
Moles of benzoic acid = 34 g/L
84.07 g/mol
Moles of benzoic acid = 0.404 mol/L
Step 4: Calculate the solubility of benzoic acid in water at 25
°
C. The solu-
bility in g/L can be calculated by multiplying the molarity by the molar mass.
Solubility of benzoic acid = 0.404 mol/L ×84.07 g/mol
Solubility of benzoic acid = 34 g/L
Therefore, the solubility of benzoic acid in water at 25
°
C is 34 g/L.
Question 32
Question
A student is trying to determine the solubility of two organic compounds, com-
pound A and compound B, in water at 25
°
C. Compound A has a calculated
LogP value of 1.5 and compound B has a calculated LogP value of 3.2. Based
on the LogP values, predict which compound would be more soluble in water.
Justify your answer.
Solution
Step 1: LogP Values The LogP value is a measure of the hydrophobicity of a
compound. A higher LogP value indicates a more hydrophobic compound.
Step 2: Prediction Since water is a polar solvent, it tends to dissolve po-
lar or hydrophilic compounds better than nonpolar or hydrophobic compounds.
In this case, compound A with a lower LogP value of 1.5 is more polar (less
hydrophobic) compared to compound B with a higher LogP value of 3.2. There-
fore, compound A is predicted to be more soluble in water due to its relatively
higher polarity.
Step 3: Justification The prediction is based on the principle that ”like
dissolves like.” Water is a polar solvent (due to its dipole nature), so it readily
dissolves other polar molecules. Since compound A is relatively more polar than
compound B, it is expected to have stronger interactions with water molecules,
resulting in higher solubility. Compound B, being more hydrophobic, will have
weaker interactions with water and therefore lower solubility in water.
24
Question 33
Question
Using the solubility rules, predict whether the following compounds are soluble
or insoluble in water: n-pentane, potassium iodide, and acetone.
Solution
1. Solubility of n-pentane: n-pentane is a nonpolar molecule due to the pres-
ence of only carbon-carbon and carbon-hydrogen bonds. Nonpolar molecules are
generally insoluble in water because water is a polar solvent. Thus, n-pentane
is insoluble in water.
2. Solubility of potassium iodide (KI): According to the solubility rules,
all compounds containing alkali metal cations (e.g., potassium) are soluble in
water. Additionally, iodide salts are soluble unless paired with silver, lead, or
mercury(II) ions. Therefore, potassium iodide (KI) is soluble in water.
3. Solubility of acetone (CH3COCH3): Acetone is a polar molecule
due to the presence of a carbonyl group (C=O), which imparts a significant
dipole moment. As water is also a polar solvent, acetone is soluble in water due
to the ability of polar molecules to dissolve in other polar substances.
Question 34
Question
Determine which of the following compounds is most soluble in water based on
their chemical structures:
A) CH3CH2OH B) CH3CH2CH2CH3C) CH3CH2COOH D) CH3OCH3
Solution
Step 1: Analyze the chemical structures of the compounds. - Compound A
is ethanol. - Compound B is butane. - Compound C is propanoic acid. -
Compound D is dimethyl ether.
Step 2: Determine the most soluble compound in water. - Water is a polar
molecule, which means it can dissolve other polar compounds or compounds
that can form hydrogen bonds. - Among the given compounds, compound C
(propanoic acid) is the most soluble in water because it can form hydrogen
bonds with water molecules through its carboxylic acid functional group. -
Compounds A and D are partially soluble in water as they contain a hydroxyl
group and an ether group, respectively. - Compound B (butane) is the least
soluble in water as it is nonpolar and cannot form any significant interactions
with water molecules.
25
Therefore, compound C) CH3CH2COOH (propanoic acid) is the most
soluble in water among the given compounds.
Question 35
Question
Calculate the solubility of benzoic acid (CHO) in water at 25
°
C. The Ksp of
benzoic acid at this temperature is 6.3×10−5.
Solution
Step 1: Write the equilibrium equation for the dissolution of benzoic acid in
water:
CHO(s)⇌CHO(aq)
Step 2: Write the expression for the solubility product (Ksp):
Ksp = [CHO] = 6.3×10−5
Step 3: Define the initial amount of benzoic acid dissolved as x (mol/L). At
equilibrium, the concentration of benzoic acid is also x mol/L.
Step 4: Substitute the equilibrium concentration into the Ksp expression:
6.3×10−5=x×x
x2= 6.3×10−5
Step 5: Solve for x to find the solubility of benzoic acid in water:
x=p6.3×10−5= 0.0079 mol/L
Therefore, the solubility of benzoic acid in water at 25
°
C is 0.0079 mol/L.
26
Students also viewed