CHEM 301 - ORGANIC CHEMISTRY I Solubility and polarity calculations Question Bank Set 5

CHEM 301 - ORGANIC CHEMISTRY

I - Solubility and polarity calculations

Question Bank - Set 5

Liberty University

Question 1

Question

Determine which of the following compounds is most soluble in water at room

temperature based on their structures and polarity: 1. 1-decanol (C10H21OH)

2. Acetone (CH3COCH3) 3. Acetic acid (CH3COOH)

Solution

To determine the solubility of each compound in water, we need to consider the

polarity of the molecules. Compounds that can form hydrogen bonds with water

molecules are typically more soluble in water. We will analyze the structures of

each compound to determine their ability to form hydrogen bonds with water.

Step 1: Determine the polarity of each compound based on its structure: 1.

1-decanol: 1-decanol contains a hydroxyl group (OH) which can form hydrogen

bonds with water molecules. This makes it polar. 2. Acetone: Acetone does not

contain any hydrogen bonding sites. It has a polar carbonyl group, but it cannot

form hydrogen bonds with water due to the lack of hydrogen atoms bonded to

oxygen. 3. Acetic acid: Acetic acid contains a carboxyl group (COOH) which

can form hydrogen bonds with water molecules. This makes it polar.

Step 2: Based on the analysis in Step 1, the order of solubility in water

from most soluble to least soluble is: 1. Acetic acid (CH3COOH) 2. 1-decanol

(C10H21OH) 3. Acetone (CH3COCH3)

Therefore, acetic acid is the most soluble in water at room temperature

among the given compounds.

Question 2

Question

Determine which of the following compounds is most soluble in water:

1. Hexane (C6H14)

2. Acetone (C3H6O)

3. Ethanol (C2H5OH)

Solution

To determine the compound that is most soluble in water, we need to consider

the polarity of the compounds and their ability to form hydrogen bonds with

water molecules.

Step 1: Consider the chemical structures of the compounds:

1. Hexane (C6H14) - nonpolar molecule with only C-H bonds

2. Acetone (C3H6O) - polar molecule with a C=O bond

3. Ethanol (C2H5OH) - polar molecule with an -OH group that can partici-

pate in hydrogen bonding

Step 2: Evaluate the solubility of the compounds in water based on their

polarity and ability to form hydrogen bonds:

1. Hexane is nonpolar and cannot form hydrogen bonds with water. There-

fore, it is not soluble in water.

2. Acetone is a polar molecule with a C=O bond, allowing it to form hydro-

gen bonds with water. It is moderately soluble in water.

3. Ethanol is a polar molecule with an -OH group, which can form hydrogen

bonds with water. It is the most soluble compound in water among the

options given.

Therefore, the most soluble compound in water from the options provided

is Ethanol (C2H5OH).

Question 3

Question

A student is given a mixture of four compounds: hexane, ethanol, acetone, and

water. The student is asked to predict the order in which these compounds will

elute on a column chromatography setup using silica gel as the stationary phase

and hexane/acetone (1:1, v/v) as the mobile phase. Rank the compounds in

order of increasing elution time.

Given the following solubility data at room temperature: - hexane: insoluble

in water, soluble in acetone - ethanol: completely soluble in water and acetone

- acetone: miscible with water - water: soluble in acetone

Solution

Step 1: Based on the solubility data and the nature of the mobile phase (hex-

ane/acetone), we can rank the compounds as follows: - First to elute: ethanol

(completely soluble in hexane/acetone mixture) - Second to elute: water (solu-

ble in acetone) - Third to elute: acetone (miscible with water) - Last to elute:

hexane (soluble in acetone)

Therefore, the compounds will elute in the following order: ethanol, water,

acetone, hexane.

Question 4

Question

Determine which of the following pairs of compounds would show the most ideal

behavior in a solution:

Compound A: hexane (nonpolar) and hexanol (slightly polar) Compound B:

dichloromethane (polar) and methanol (polar)

Justify your answer based on the polarity of the compounds.

Solution

Step 1: Determine the polarity of the compounds. - Hexane: Hexane is a

nonpolar molecule because it contains only carbon and hydrogen atoms, which

have a similar electronegativity, leading to a symmetric charge distribution.

- Hexanol: Hexanol is slightly polar due to the presence of a polar hydroxyl

(OH) group, which creates an uneven charge distribution within the molecule.

- Dichloromethane: Dichloromethane is a polar molecule because of the elec-

tronegativity difference between chlorine and carbon atoms, leading to an un-

even charge distribution. - Methanol: Methanol is also a polar molecule because

of the electronegativity difference between oxygen and carbon atoms in the hy-

droxyl group.

Step 2: Predict the behavior of the compounds in a solution. - Compound

A (hexane and hexanol): In this case, hexane is nonpolar, while hexanol is

slightly polar. Nonpolar molecules tend to form non-ideal solutions with po-

lar molecules because of the differences in polarity. Hexane and hexanol would

show the least ideal behavior in a solution. - Compound B (dichloromethane

and methanol): Both dichloromethane and methanol are polar molecules. Polar

molecules tend to mix well with other polar molecules due to similar charge dis-

tributions. Dichloromethane and methanol would show the most ideal behavior

in a solution.

Therefore, the pair of compounds that would show the most ideal behavior

in a solution is Compound B: dichloromethane and methanol.

Question 5

Question

A student is performing a solubility experiment in organic chemistry. They

dissolve 1.5 grams of compound A in 100 mL of water at 25

C. The compound

fully dissolves in water with no remaining solid particles. Calculate the solubility

of compound A in water at 25

C in g/mL. The student also notices that the

compound does not dissolve in hexane. Based on this information, determine

the likely polarity of compound A.

Solution

To calculate the solubility of compound A in water, we need to determine the

amount of compound A that can dissolve in 1 mL of water at 25

Step 1: Calculate the solubility of compound A in water Given: -

Mass of compound A = 1.5 grams - Volume of water = 100 mL = 0.1 L

The solubility of compound A in water can be calculated using the formula:

Solubility = Mass of compound A

Volume of water

Substitute the values into the formula:

Solubility = 1.5 g

0.1 L = 15 g/L

Therefore, the solubility of compound A in water at 25

C is 15 g/L.

Step 2: Determine the likely polarity of compound A Since com-

pound A dissolves in water but not in hexane, we can infer that compound A

is polar. Water is a polar solvent while hexane is non-polar. Polar compounds

tend to dissolve in polar solvents like water, while non-polar compounds dissolve

in non-polar solvents like hexane.

Therefore, compound A is likely to be a polar compound.

Question 6

Question

The solubility of compound A in water at 25

C is 0.03 g/100 mL, while the

solubility of compound B in water at the same temperature is 0.75 g/100 mL.

Compound A and compound B have a similar molecular weight. Which com-

pound is more soluble in water, and explain why?

Solution

Step 1: Calculate the molar solubility of compound A and compound B. Given

that the molecular weights are similar, we can assume the molar mass of com-

pound A is approximately equal to the molar mass of compound B.

For compound A: mA= 0.03 g V= 100 mL = 0.100 L MM = MMA≈

MMBMolar SolubilityA=0.03 g

1×1 mol

MM ×1

0.100 L =0.03

MM M

For compound B: mB= 0.75 g

Molar SolubilityB=0.75 g

1×1 mol

MM ×1

0.100 L =0.75

MM M

Step 2: Compare the molar solubilities of compound A and compound B.

Given that the molar masses are similar, the molar solubility of compound B

will be larger than compound A, since the solution was able to dissolve more

grams of compound B compared to compound A in the given volume of water.

Therefore, compound B is more soluble in water than compound A due to

its higher molar solubility.

Question 7

Question

A student is studying the solubility of different organic compounds in water.

After conducting several experiments, the student found that Compound A

is soluble in water while Compound B is insoluble in water. The molecular

structures of both compounds are provided below:

C(-[:90]H)(-[:270]H)(-[:180]H)-C(-[:90]H)(-[:270]H)(-[:180]H)-C(-[:270]H)(-

[:180]H)-C(-[:90]H)(-[:180]H)-O-H

C(-[:90]H)(-[:270]H)(-[:180]H)-C(-[:90]H)(-[:270]H)(-[:180]H)=C(-[:90]H)(-

[:270]H)-C(-[:90]H)(-[:270]H)

Based on the provided molecular structures, explain why Compound A is

soluble in water while Compound B is insoluble in water. Justify your answer

using solubility and polarity calculations.

Solution

Step 1: To determine the solubility of a compound in water, we need to con-

sider the polarity of the compound and the intermolecular forces between the

compound and water molecules.

Step 2: Compound A is a molecule with an -OH group (alcohol functional

group). The presence of the -OH group provides Compound A with the ability

to form hydrogen bonds with water molecules. This increases the solubility of

Compound A in water.

Step 3: Compound B is a hydrocarbon chain with a double bond between

two carbon atoms. This type of compound lacks functional groups like -OH that

can form hydrogen bonds with water molecules. As a result, Compound B does

not readily dissolve in water due to the absence of significant intermolecular

forces between the compound and water molecules.

Step 4: In addition to the presence of functional groups, the overall polarity

of a molecule also affects its solubility in water. The polarity of a compound is

determined by the electronegativity difference between atoms and the molecular

geometry.

Step 5: Compound A is more polar than Compound B because of the pres-

ence of the highly electronegative oxygen atom in the -OH group. This polarity

enhances the interactions between Compound A and water molecules, leading

to its solubility in water.

Step 6: On the other hand, Compound B is nonpolar due to the hydrocarbon

chain and the symmetrical distribution of electrons in the double bond. The lack

of polarity in Compound B results in weak interactions with water molecules,

making it insoluble in water.

Step 7: Therefore, based on the solubility and polarity calculations, Com-

pound A is soluble in water, while Compound B is insoluble in water.

Question 8

Question

A student is given a mixture of three organic compounds to separate based on

their solubility in various solvents. The student knows that Compound A is

soluble in water, Compound B is soluble in diethyl ether, and Compound C is

soluble in hexanes. The student adds the mixture to a separatory funnel and

extracts the compounds with water, diethyl ether, and hexanes successively.

After the extraction process, how can the student separate and recover each

compound individually?

Solution

To separate and recover each compound individually, the student can use the

principle of solubility in different solvents to selectively extract each compound

from the mixture. Here are the step-by-step instructions for separating and

recovering each compound:

Step 1: First, the student should extract Compound A, which is soluble in

water. This can be achieved by adding the mixture to a separatory funnel with

water and shaking the funnel. Compound A will dissolve in the aqueous layer.

Step 2: Next, the student should extract Compound B, which is soluble in

diethyl ether. By adding diethyl ether to the aqueous layer containing Com-

pound A and shaking the funnel, Compound B will transfer to the organic

diethyl ether layer.

Step 3: Finally, Compound C, which is soluble in hexanes, can be extracted

by adding hexanes to the diethyl ether layer containing Compound B. After

shaking the funnel, Compound C will transfer to the hexane layer.

Step 4: To recover each compound individually, the student can then sep-

arate the layers in the separatory funnel and collect each layer in a separate

container. By evaporating the solvent from each container, the student can

isolate and recover each compound separately.

This process allows the student to separate and recover each compound based

on their solubility in different solvents.

Question 9

Question

Calculate the solubility of acetanilide (C8H9NO) in water at 25◦C. The solubility

product constant (Ksp) of acetanilide in water at this temperature is 7.5×10−3

moles per liter. Assume acetanilide behaves like a non-electrolyte in water.

Solution

Step 1: Write the equilibrium expression for the dissolution of acetanilide in

water:

C8H9NO(s)⇌C8H9NO(aq)

Step 2: Write the solubility product constant expression:

Ksp = [C8H9NO]eq

Step 3: Let us assume x moles of acetanilide dissolve in water to form a

solution. Therefore, the equilibrium concentrations are:

[C8H9NO]eq =xM

Step 4: Substitute the equilibrium concentrations into the solubility product

constant expression:

7.5×10−3=x

Step 5: Solve for x:

x= 7.5×10−3M

Therefore, the solubility of acetanilide in water at 25◦C is 7.5×10−3M.

Question 10

Question

A student is given a mixture of two organic compounds, compound A and

compound B. Compound A is known to be soluble in water, while compound

B is known to be insoluble in water. The student needs to separate the two

compounds in the mixture. The student decides to use a solvent extraction

method. Provide a detailed explanation of how the student can separate the

two compounds using a suitable solvent.

Solution

To separate the two organic compounds using solvent extraction, the student

can follow the steps outlined below:

Step 1: Start by adding the mixture of compounds A and B to a separatory

funnel.

Step 2: Add an appropriate organic solvent to the separatory funnel. The

choice of solvent should be based on the solubility characteristics of the com-

pounds. Since compound A is soluble in water and compound B is insoluble

in water, the student can choose an organic solvent in which compound B is

soluble but compound A is not.

Step 3: Carefully shake the separatory funnel to allow the two immiscible

layers (aqueous and organic) to mix.

Step 4: Allow the separatory funnel to sit until two distinct layers form.

The organic layer will contain compound B dissolved in the organic solvent,

while the aqueous layer will contain compound A dissolved in water.

Step 5: Carefully open the stopcock of the separatory funnel and drain the

aqueous layer (containing compound A) into a separate container.

Step 6: Repeat the extraction process by adding fresh organic solvent to

the mixture of compound B in the separatory funnel.

Step 7: Shake the separatory funnel again to mix the layers, allow them

to separate, and drain the organic layer (now containing compound B) into a

separate container.

Step 8: Finally, evaporate the organic solvent from the two containers to

obtain compound A and compound B in pure form.

By following these steps, the student can successfully separate the two or-

ganic compounds using solvent extraction.

Question 11

Question

Determine which of the following compounds is expected to be most soluble

in water at room temperature based on the molecular structure and polarity

considerations:

A) Cyclohexane B) Ethyl alcohol C) Diethyl ether D) Acetic acid

Consider the structures and functional groups present in each compound.

Solution

To determine the solubility of these compounds in water, we need to assess their

polarity. Compounds with polar functional groups tend to be more soluble in

water due to the ability to form hydrogen bonds with water molecules.

Step 1: Identify the functional groups in each compound:



A) Cyclohexane - contains only nonpolar C-C and C-H bonds, making it

nonpolar.



B) Ethyl alcohol - contains an -OH hydroxyl group, which is polar and

can form hydrogen bonds with water.



C) Diethyl ether - consists of nonpolar C-C and C-H bonds, making it

nonpolar.



D) Acetic acid - has a carboxylic acid functional group (-COOH) which is

polar and can form hydrogen bonds with water.

Step 2: Based on the functional groups present, we expect ethyl alcohol

(compound B) and acetic acid (compound D) to be more soluble in water due

to their ability to form hydrogen bonds with water molecules.

Step 3: Therefore, the compound expected to be most soluble in water at

room temperature is D) Acetic acid.

Question 12

Question

A student is conducting solubility experiments with three substances: substance

A, substance B, and substance C. The student finds that substance A is soluble

in water, substance B is soluble in hexane, and substance C is soluble in both

water and hexane. Which of these substances is most likely to have significant

polar character? Justify your answer.

Solution

To determine which substance is most likely to have significant polar character,

we need to consider the solvents in which each substance is soluble.

Step 1: Substance A is soluble in water. This indicates that substance

A is likely to have polar characteristics since water is a polar solvent. Polar

substances tend to dissolve in polar solvents.

Step 2: Substance B is soluble in hexane. Hexane is a nonpolar solvent.

Therefore, substance B is likely to be nonpolar in nature. Nonpolar substances

tend to dissolve in nonpolar solvents.

Step 3: Substance C is soluble in both water and hexane. Substance C’s

ability to dissolve in both a polar solvent (water) and a nonpolar solvent (hex-

ane) suggests that substance C is likely to have both polar and nonpolar char-

acteristics. This makes substance C amphiphilic, meaning it has both polar and

nonpolar regions in its structure.

Step 4: Conclusion Based on the solubility properties of these substances,

substance A is most likely to have significant polar character since it dissolves

in water, a polar solvent. Substance B is likely to be nonpolar as it dissolves in

hexane, a nonpolar solvent. Substance C is amphiphilic, containing both polar

and nonpolar regions in its structure.

Question 13

Question

Calculate the solubility of benzoic acid (C6H5COOH) in water at 25

C. The

solubility product constant (Ksp) of benzoic acid in water at 25

C is 1.7×10−3.

Assume that benzoic acid completely dissociates in water.

Solution

Step 1: Write the dissociation of benzoic acid in water.

C6H5COOH(s)⇌C6H5COO−(aq)+H+(aq)

Step 2: Write the solubility equilibrium expression for benzoic acid.

Ksp = [C6H5COO−][H+]

Step 3: Since benzoic acid dissociates completely, the concentration of C6H5COO−

will be equal to the solubility of benzoic acid (s) and the concentration of H+

will also be equal to s.

Ksp =s×s=s2

Step 4: Substitute the given value of Ksp into the equation and solve for s.

1.7×10−3=s2

s=p1.7×10−3≈0.0412 M

Therefore, the solubility of benzoic acid in water at 25

C is approximately

0.0412 M.

Question 14

Question

An organic compound has a solubility of 0.08 g/100 mL at 25

C in water and

3.2 g/100 mL in ethanol at the same temperature. Calculate the partition

coefficient of the compound between water and ethanol at 25

Solution

Step 1: Calculate the solubility in moles per 100 mL for both water and ethanol.

Given: Solubility in water = 0.08 g/100 mL Molar mass of the compound = x

g/mol

Let’s first calculate the solubility in moles per 100 mL for water:

Solubility in moles/100 mL (water) = 0.08 g/100 mL

xg/mol =0.08

xmol/100 mL

Similarly, for ethanol:

Solubility in moles/100 mL (ethanol) = 3.2 g/100 mL

xg/mol =3.2

xmol/100 mL

Step 2: Calculate the partition coefficient. The partition coefficient (Kp) is

defined as the ratio of the concentration of the compound in the organic phase

to the concentration of the compound in the aqueous phase. In this case, it

refers to the concentration of the compound in ethanol to the concentration of

the compound in water.

Kp=Concentration of compound in ethanol

Concentration of compound in water

Given that we are using molarity in this context,

Kp=Solubility in moles/100 mL (ethanol)

Solubility in moles/100 mL (water)

Substitute the previously calculated values:

Kp=

3.2

xmol/100 mL

0.08

xmol/100 mL =3.2

0.08 = 40

Therefore, the partition coefficient of the compound between water and

ethanol at 25

C is 40.

Question 15

Question

A student is performing a solubility experiment in which they mix 10.0 g of

compound A with 50.0 g of water at 25

C. After stirring, compound A fully

dissolves in the water. The student then measures the solubility of compound

A in water at this temperature as 30 g per 100 g of water.

Given that the molar mass of compound A is 180 g/mol, calculate the solu-

bility product constant (Ksp) for compound A in water at 25

Solution

Step 1: Calculate the molarity of compound A in the saturated solution. The

molarity can be calculated using the solubility as follows:

Solubility (mol/L) = Solubility (g/L)

Molar mass (g/mol)

Solubility (mol/L) = 30 g/100 g of water

180 g/mol ×1000 mL/L

1000 mL/L

Solubility (mol/L) = 0.1667 mol/L

1000 L/L = 0.1667 mol/L

Step 2: Write the dissolution equilibrium for compound A. The dissolution

equilibrium for compound A in water can be written as:

A⇌A(aq)

Step 3: Write the expression for the solubility product constant (Ksp). The

solubility product constant (Ksp) is given by:

Ksp = [A]

Step 4: Calculate the solubility product constant (Ksp). Since the solubility

of compound A in water at 25

C is 0.1667 mol/L, the Ksp is:

Ksp = (0.1667)1= 0.1667

Therefore, the solubility product constant (Ksp) for compound A in water

at 25

C is 0.1667.

Question 16

Question

A student has a mixture of three substances: Substance A, Substance B, and

Substance C. The solubility of each substance in water at 25

C is given below:

Substance A: 2.5 g/L Substance B: 0.8 g/L Substance C: 1.3 g/L

The student wants to separate the substances using solvent extraction. The

student must choose between dichloromethane (CH2Cl2) and ethanol (C2H5OH)

as the solvent. The solubility of each substance in these solvents at 25

C is given

below:

Substance A: - Dichloromethane: 4 g/L - Ethanol: 6 g/L

Substance B: - Dichloromethane: 1.2 g/L - Ethanol: 5 g/L

Substance C: - Dichloromethane: 3 g/L - Ethanol: 0.5 g/L

Which solvent should the student use to extract each substance in order to

obtain the greatest separation efficiency?

Solution

Step 1: Calculate the partition coefficient (K) for each substance in both sol-

vents.

The partition coefficient is calculated as the solubility of the substance in

the organic solvent divided by the solubility of the substance in water.

For Substance A: - KDichloromethane =4 g/L

2.5 g/L = 1.6 - KEthanol =6 g/L

2.5 g/L = 2.4

For Substance B: - KDichloromethane =1.2 g/L

0.8 g/L = 1.5 - KEthanol =5 g/L

0.8 g/L =

6.25

For Substance C: - KDichloromethane =3 g/L

1.3 g/L = 2.31 - KEthanol =0.5 g/L

1.3 g/L =

0.385

Step 2: Analyze the partition coefficients to determine the best solvent for

each substance.

Substance A: Since KEthanol > KDichloromethane, Substance A will have a

higher partition coefficient in ethanol than in dichloromethane. Therefore,

ethanol should be used to extract Substance A.

Substance B: Since KEthanol > KDichloromethane, Substance B will have a

higher partition coefficient in ethanol than in dichloromethane. Therefore,

ethanol should be used to extract Substance B.

Substance C: Since KDichloromethane > KEthanol, Substance C will have a

higher partition coefficient in dichloromethane than in ethanol. Therefore,

dichloromethane should be used to extract Substance C.

In conclusion, the student should use ethanol to extract Substance A and

Substance B, and dichloromethane to extract Substance C for the greatest sep-

aration efficiency.

Question 17

Question

A student is conducting a solubility experiment with three organic compounds:

Compound X, Compound Y, and Compound Z. The student determines that

Compound X is soluble in water, Compound Y is soluble in hexane, and Com-

pound Z is soluble in both water and hexane. Based on this information, rank

the compounds in order of increasing polarity.

Solution

Step 1: Determine the polarity of water and hexane. Water is a polar solvent

due to its high dielectric constant and ability to form hydrogen bonds. Hexane

is a nonpolar solvent because it is a hydrocarbon with only C-H bonds.

Step 2: Analyze the solubility behaviors of the compounds. - Compound X

is soluble in water: this indicates that Compound X is also polar because like

dissolves like (polar compounds dissolve in polar solvents). - Compound Y is

soluble in hexane: this suggests that Compound Y is nonpolar since nonpolar

compounds dissolve in nonpolar solvents. - Compound Z is soluble in both

water and hexane: this implies that Compound Z has both polar and nonpolar

characteristics, making it a polar compound.

Step 3: Rank the compounds in order of increasing polarity. - Compound

Y: This compound is soluble in hexane, a nonpolar solvent, indicating that it is

nonpolar. - Compound X: This compound is soluble in water, a polar solvent,

indicating that it is polar. - Compound Z: This compound is soluble in both

water and hexane, suggesting it has both polar and nonpolar characteristics,

making it the most polar compound.

Therefore, the compounds should be ranked in increasing order of polarity

as Compound Y ¡ Compound X ¡ Compound Z.

Question 18

Question

Calculate the solubility of benzoic acid (C6H5COOH) in water at 25◦C. The

solubility product constant (Ksp) for benzoic acid at this temperature is 2.6×

10−4.

Solution

Step 1: The equilibrium expression for the dissolution of benzoic acid in water

is:

C6H5COOH ⇌C6H5COO−+ H+

Step 2: Let x be the solubility of benzoic acid. Then at equilibrium, the

concentrations of C6H5COOH, C6H5COO−, and H+are:

[C6H5COOH] = 1 −x

[C6H5COO−] = x

[H+] = x

Step 3: Substitute these concentrations into the expression for Ksp:

Ksp = [C6H5COO−][H+] = x2

Step 4: Since Ksp = 2.6×10−4, we have:

x2= 2.6×10−4

x=p2.6×10−4

Step 5: Calculating the solubility of benzoic acid:

x=p2.6×10−4

x≈0.0161 M

Therefore, the solubility of benzoic acid in water at 25◦C is approximately

0.0161 M.

Question 19

Question

Determine which of the following compounds is expected to be the most soluble

in water based on their polarity: 1. Ethanol (CH3CH2OH) 2. Diethyl ether

(CH3CH2OCH2CH3) 3. 1,2-dichloroethane (CH2ClCH2Cl)

Solution

To determine the solubility of each compound in water based on polarity, we

need to consider the polarity of the compound and the polarity of water. Com-

pounds are generally more soluble in water if they can form hydrogen bonds

with water molecules.

Step 1: Determine the polarity of each compound. 1. Ethanol (CH3CH2OH)

- Ethanol contains a hydroxyl group (OH), making it polar. 2. Diethyl ether

(CH3CH2OCH2CH3) - Diethyl ether does not contain any polar groups, making

it nonpolar. 3. 1,2-dichloroethane (CH2ClCH2Cl) - 1,2-dichloroethane contains

polar C-Cl bonds but overall has a symmetrical structure that cancels out the

polarity, making it nonpolar.

Step 2: Consider the solubility in water based on polarity. - Ethanol is

polar and can form hydrogen bonds with water molecules, so it is expected

to be soluble in water. - Diethyl ether is nonpolar and does not form hydro-

gen bonds with water molecules, so it is expected to be insoluble in water. -

1,2-dichloroethane is nonpolar and does not form hydrogen bonds with water

molecules, so it is expected to be insoluble in water.

Therefore, the most soluble compound in water among the given options is

Ethanol (CH3CH2OH).

Question 20

Question

Calculate the solubility of benzoic acid (C6H5COOH, M m = 122.12 g/mol) in

water at 25◦C. The solubility product of benzoic acid in water is 0.34 g/L.

Solution

Step 1: Write the dissolution reaction of benzoic acid in water.

C6H5COOH(s) ⇌C6H5COOH(aq)

Step 2: Write the equilibrium expression for the solubility product.

Ksp = [C6H5COOH]aq = 0.34 g/L

Step 3: Calculate the molar solubility using the molar mass of benzoic acid.

Molar solubility = 0.34 g/L

122.12 g/mol = 0.00279 mol/L

Therefore, the solubility of benzoic acid in water at 25◦Cis 0.00279 mol/L.

Question 21

Question

An organic compound with the molecular formula C6H10O2is known to be

soluble in water. Determine the most likely functional group present in this

compound. Justify your answer.

Solution

Step 1: Calculate the degree of unsaturation (DU) using the formula:

DU = 2C+ 2 −H+N−X

where: - Cis the number of carbon atoms (6 in this case), - His the number

of hydrogen atoms (10 in this case), - Nis the number of nitrogen atoms (0 in

this case), - Xis the number of halogen atoms (0 in this case).

DU = 2(6) + 2 −10 + 0 −0

2= 3

Since the degree of unsaturation is 3, there are likely to be multiple bonds

or rings in the compound.

Step 2: Determine potential functional groups with the given molecular

formula. Possible structures with a molecular formula of C6H10O2and 3 degrees

of unsaturation include: - Esters (R−COO −R) - Carboxylic acids (RCOOH)

- Lactones (O=C−O−R)

Step 3: Considering the solubility of the compound in water, the most likely

functional group present is the carboxylic acid group (RCOOH). Carboxylic

acids are generally soluble in water due to the formation of hydrogen bonds with

water molecules through the -COOH group.

Therefore, the most likely functional group present in the compound is a

carboxylic acid.

Question 22

Question

A student is given a mixture of three compounds: a polar compound (X), a

moderately polar compound (Y), and a nonpolar compound (Z). The student

has to separate these compounds based on their solubility in a nonpolar solvent.

The solubilities of X, Y, and Z in the nonpolar solvent are 0.5 g/mL, 0.9 g/mL,

and 1.2 g/mL, respectively. If the mixture contains 3.0 g of each compound,

what volume of the nonpolar solvent is needed to dissolve all of the compounds

completely?

Solution

Step 1: Calculate the mass of each compound that can be dissolved in 1 mL

of the nonpolar solvent: - Compound X: 0.5 g/mL - Compound Y: 0.9 g/mL -

Compound Z: 1.2 g/mL

Step 2: Determine the total mass of the mixture: Total mass = 3.0 g (X) +

3.0 g (Y) + 3.0 g (Z) = 9.0 g

Step 3: Calculate the total volume of the nonpolar solvent required to dis-

solve all the compounds completely: - Volume of nonpolar solvent for X = 3.0

g / 0.5 g/mL = 6 mL - Volume of nonpolar solvent for Y = 3.0 g / 0.9 g/mL

3.33 mL - Volume of nonpolar solvent for Z = 3.0 g / 1.2 g/mL = 2.5 mL

Step 4: Add up the volumes needed for each compound: Total volume = 6

mL (X) + 3.33 mL (Y) + 2.5 mL (Z) = 11.83 mL

Therefore, the student will need approximately 11.83 mL of the nonpolar

solvent to dissolve all of the compounds completely.

Question 23

Question

Calculate the solubility of benzoic acid (C7H6O2) in water at 25◦C. Given that

the solubility of benzoic acid in water is 3.4 g per 100 mL at this temperature,

determine the molarity and the mole fraction of benzoic acid in the saturated

solution.

Solution

Step 1: Calculate the molar mass of benzoic acid. Step 2: Convert the given

solubility from grams per 100 mL to grams per liter. Step 3: Calculate the

molarity of the benzoic acid solution. Step 4: Calculate the mole fraction of

benzoic acid in the saturated solution.

Step 1: The molar mass of benzoic acid (C7H6O2) can be calculated as:

Molar M ass = 7×Atomic Mass of Carbon+6×Atomic Mass of Hydrogen+2×Atomic M ass of Oxygen

Molar Mass = (7 ×12.01) + (6 ×1.01) + (2 ×16.00) = 122.12 g/mol

Step 2: Given that the solubility of benzoic acid in water is 3.4 g per 100

mL, we can convert this to grams per liter:

3.4g/100 mL ×1L

1000 mL = 0.034 g/mL

Step 3: Now, let’s calculate the molarity of the benzoic acid solution using

the solubility in grams per liter:

Molarity =M ass of Solute (g)

Molar Mass (g/mol)×V olume of Solvent (L)

Molarity =0.034 g

122.12 g/mol ×1L= 0.000278 mol/L

Step 4: Now, we can calculate the mole fraction of benzoic acid in the

saturated solution:

Mole F raction (X) = M oles of Solute

T otal M oles

Since the total moles come mainly from water, we can approximate the moles

of water to the volume of water (1 L) for our calculation.

Mole F raction (Xbenzoic acid) = 0.000278 mol

0.000278 mol + 55.5mol =0.000278

55.5+0.000278 ≈5.01×10−6

Therefore, the molarity of the benzoic acid solution is 0.000278 mol/L and

the mole fraction of benzoic acid in the saturated solution is approximately

5.01 ×10−6.

Question 24

Question

Calculate the solubility of ethyl cinnamate (C11H12O2) in water at 25◦C. The

solubility product of ethyl cinnamate at 25◦C is 3.2×10−4mol/L.

Solution

Step 1: Write the balanced equation for the dissolution of ethyl cinnamate in

water:

C11H12O2⇌C11H12O2(aq)

Step 2: Represent the equilibrium expression for the solubility of ethyl cin-

namate in water:

Ksp = [C11H12O2]1

Step 3: Substitute the given solubility product constant into the equilibrium

expression:

3.2×10−4= [C11H12O2]

Step 4: Solve for the concentration of ethyl cinnamate in water:

[C11H12O2]=3.2×10−4mol/L

Therefore, the solubility of ethyl cinnamate in water at 25◦C is 3.2×10−4

mol/L.

Question 25

Question

Calculate the solubility of benzoic acid (C6H5COOH,Ksp = 3.8×10−4at

C) in water. Assume that the volume change upon dissolving benzoic acid

in water is negligible.

Solution

Step 1: Write the equation for the dissolution of benzoic acid in water. Step 2:

Write the equilibrium expression for the dissolution of benzoic acid. Step 3: Set

up the solubility equilibrium expression and solve for the solubility of benzoic

acid.

Step 1:

The dissolution of benzoic acid in water can be represented by the equation:

C6H5COOH(s)⇌C6H5COOH(aq)

Step 2:

The equilibrium expression for this dissolution is:

Ksp = [C6H5COOH]

Step 3:

Given that Ksp = 3.8×10−4at 25

C, the solubility of benzoic acid can be

calculated by:

Ksp = [C6H5COOH] = 3.8×10−4M

Therefore, the solubility of benzoic acid in water at 25

C is 3.8×10−4M.

Question 26

Question

Predict which of the following compounds is most soluble in water based on its

polarity:

Compound A: CH3CH2CH2CH2OH

Compound B: CH3OCH3

Compound C: CH3CH2CH2CH2CH2CH3Compound C: CH3CH2CH2CH2CH2CH3Compound C: CH3CH2CH2CH2CH2CH3Compound C: CH3CH2CH2CH2CH2CH3

Solution

Step 1: Determine the polarity of each compound based on its functional groups.

- Compound A: CH3CH2CH2CH2OH is an alcohol with a hydroxyl group (OH)

which can form hydrogen bonds with water molecules, making it polar. - Com-

pound B: CH3OCH3is an ether with an oxygen atom between two alkyl groups,

but it does not have any hydrogen bonding capabilities, making it less likely to be

soluble in water. - Compound C: CH3CH2CH2CH2CH2CH3isanalkanewithonlycarbon−

carbonandcarbon −hydrogenbonds, makingitnon −polar.

Step 2: Predict solubility based on polarity. - Compounds that are polar

(like Compound A) are more likely to be soluble in water because they can

form hydrogen bonds with the water molecules. - Non-polar compounds (like

Compound C) are less likely to be soluble in water because water is a polar

solvent.

Step 3: Conclusion Therefore, the most soluble compound in water among

the given options is Compound A: CH3CH2CH2CH2OH.

Question 27

Question

A student is performing a solubility experiment with two organic compounds:

Compound A and Compound B. Compound A has a molar mass of 178 g/mol

and is soluble in water, while Compound B has a molar mass of 244 g/mol and

is insoluble in water. Which of the two compounds is likely to be more polar?

Justify your answer using relevant concepts from organic chemistry.

Solution

To determine which compound is more polar, we need to consider the solubility

behavior of the compounds in water and their molar masses.

Step 1: Calculate the molar mass difference First, calculate the dif-

ference in molar mass between the two compounds:

Molar mass difference = Molar mass of Compound B−Molar mass of Compound A

Molar mass difference = 244 g/mol −178 g/mol = 66 g/mol

Step 2: Analyze the solubility behavior Since Compound A is soluble

in water while Compound B is insoluble, we can infer that Compound A is more

polar than Compound B. This is because polar compounds tend to dissolve in

polar solvents like water, while nonpolar compounds do not.

Step 3: Rationalize the solubility behavior The greater the molar

mass difference between two compounds, the larger the polarity difference. In

this case, since Compound B has a higher molar mass than Compound A, it is

likely less polar. This difference in polarity is likely the reason for the differing

solubility behaviors observed in water.

Therefore, Compound A is likely more polar than Compound B due to its

solubility in water and the molar mass difference between the two compounds.

Question 28

Question

A student is investigating the solubility of two organic compounds, Compound

A and Compound B, in different solvents. Compound A has a molecular weight

of 116.3 g/mol and a partition coefficient (Kp) of 1.6 in water/n-octanol. Com-

pound B has a molecular weight of 204.4 g/mol and a partition coefficient (Kp)

of 0.8 in water/n-octanol.

Determine the solubility of Compound A in water and n-octanol, as well as

the solubility of Compound B in water and n-octanol.

(Hint: Use the relationship between partition coefficient, solubility in the

two solvents, and molecular weight.)

Solution

Step 1: Calculate the solubility of Compound A in water and n-octanol.

Given: MA= 116.3 g/mol KpA= 1.6

Let SAbe the solubility of Compound A in water and SoctA be the solubility

of Compound A in n-octanol.

The relationship between partition coefficient, solubility in the two solvents,

and molecular weight is given by:

KpA=SA

SoctA

=MWoctA

MWA

1.6 = SA

SoctA

=MA

MoctA

1.6 = SA

SoctA

=116.3

MoctA

MoctA =116.3

1.6= 72.69 g/mol

Therefore, the solubility of Compound A in water is 116.3 g/L and in n-

octanol is 72.69 g/L.

Step 2: Calculate the solubility of Compound B in water and n-octanol.

Given: MB= 204.4 g/mol KpB= 0.8

Let SBbe the solubility of Compound B in water and SoctB be the solubility

of Compound B in n-octanol.

Using the same relationship,

KpB=SB

SoctB

=MWB

MWoctB

0.8 = SB

SoctB

=MB

MoctB

0.8 = SB

SoctB

=204.4

MoctB

MoctB =204.4

0.8= 255.5 g/mol

Therefore, the solubility of Compound B in water is 204.4 g/L and in n-

octanol is 255.5 g/L.

Question 29

Question

A student is trying to determine the solubility of a compound in different sol-

vents. The student performs a solubility test and finds that the compound is

soluble in water, diethyl ether, and toluene, but insoluble in hexane. Based

on this information, determine the polarity of the compound and explain your

reasoning.

Solution

To determine the polarity of the compound, we can analyze its solubility be-

havior in different solvents.

Step 1: Water is a polar solvent, while hexane is nonpolar. The fact that

the compound is only soluble in water and not in hexane suggests that the

compound is likely polar. This is because like dissolves like - polar compounds

are more likely to dissolve in polar solvents, while nonpolar compounds are more

likely to dissolve in nonpolar solvents.

Step 2: The compound is also soluble in diethyl ether and toluene, which

are both organic solvents. This further supports the idea that the compound is

polar, as it is able to dissolve in these nonpolar solvents as well.

Step 3: Therefore, based on the solubility behavior of the compound in

different solvents, we can conclude that the compound is polar. It has both

polar and nonpolar characteristics, allowing it to dissolve in a variety of solvents

with different polarities.

Question 30

Question

A student is given a compound and asked to predict its solubility in water. The

compound has the following structure:

CH3(CH2)7CH(CH3)CH2(CH2)2OH

Determine whether the compound is likely to be soluble in water based on

its structure. Provide a rationale for your answer.

Solution

1. Identify the functional group in the compound. The compound contains an

alcohol functional group (-OH).

2. Assess the compound’s solubility in water based on the presence of the

alcohol functional group. Since the compound contains an alcohol group, it is

likely to be soluble in water. Alcohols are generally soluble in water due to the

ability to form hydrogen bonds between the -OH group of the alcohol and water

molecules.

3. In this specific compound, the alcohol functional group is located at the

end of a relatively long carbon chain, which includes a total of 10 carbon atoms.

The long hydrophobic carbon chain may reduce the overall solubility of the

compound in water compared to smaller alcohols, as the nonpolar carbon chain

could decrease the interactions between the alcohol group and water molecules.

4. Therefore, although the compound contains an alcohol functional group

that can form hydrogen bonds with water, the overall solubility in water may

be lower due to the presence of a long hydrophobic carbon chain. Thus, the

compound may be only sparingly soluble or insoluble in water.

Question 31

Question

Calculate the solubility (in g/L) of benzoic acid (C7H6O2) in water at 25

The solubility of benzoic acid is 3.4 g/100 mL in water at this temperature.

Solution

Step 1: Calculate the molar mass of benzoic acid (C7H6O2). The molar mass

of benzoic acid is:

7×Atomic mass of C + 6 ×Atomic mass of H + 2 ×Atomic mass of O

= 7 ×12.01 g/mol + 6 ×1.008 g/mol + 2 ×16.00 g/mol

= 84.07 g/mol

Step 2: Calculate the solubility of benzoic acid in water in g/L. Since the

given solubility is 3.4 g/100 mL, first convert this to g/L:

3.4 g/100 mL = 34 g/L

Step 3: Calculate the molarity of benzoic acid in water. The molarity (M)

is defined as moles of solute per liter of solution. We need to first convert the

solubility in g/L to moles/L by dividing by the molar mass.

Moles of benzoic acid = 34 g/L

84.07 g/mol

Moles of benzoic acid = 0.404 mol/L

Step 4: Calculate the solubility of benzoic acid in water at 25

C. The solu-

bility in g/L can be calculated by multiplying the molarity by the molar mass.

Solubility of benzoic acid = 0.404 mol/L ×84.07 g/mol

Solubility of benzoic acid = 34 g/L

Therefore, the solubility of benzoic acid in water at 25

C is 34 g/L.

Question 32

Question

A student is trying to determine the solubility of two organic compounds, com-

pound A and compound B, in water at 25

C. Compound A has a calculated

LogP value of 1.5 and compound B has a calculated LogP value of 3.2. Based

on the LogP values, predict which compound would be more soluble in water.

Justify your answer.

Solution

Step 1: LogP Values The LogP value is a measure of the hydrophobicity of a

compound. A higher LogP value indicates a more hydrophobic compound.

Step 2: Prediction Since water is a polar solvent, it tends to dissolve po-

lar or hydrophilic compounds better than nonpolar or hydrophobic compounds.

In this case, compound A with a lower LogP value of 1.5 is more polar (less

hydrophobic) compared to compound B with a higher LogP value of 3.2. There-

fore, compound A is predicted to be more soluble in water due to its relatively

higher polarity.

Step 3: Justification The prediction is based on the principle that ”like

dissolves like.” Water is a polar solvent (due to its dipole nature), so it readily

dissolves other polar molecules. Since compound A is relatively more polar than

compound B, it is expected to have stronger interactions with water molecules,

resulting in higher solubility. Compound B, being more hydrophobic, will have

weaker interactions with water and therefore lower solubility in water.

Question 33

Question

Using the solubility rules, predict whether the following compounds are soluble

or insoluble in water: n-pentane, potassium iodide, and acetone.

Solution

1. Solubility of n-pentane: n-pentane is a nonpolar molecule due to the pres-

ence of only carbon-carbon and carbon-hydrogen bonds. Nonpolar molecules are

generally insoluble in water because water is a polar solvent. Thus, n-pentane

is insoluble in water.

2. Solubility of potassium iodide (KI): According to the solubility rules,

all compounds containing alkali metal cations (e.g., potassium) are soluble in

water. Additionally, iodide salts are soluble unless paired with silver, lead, or

mercury(II) ions. Therefore, potassium iodide (KI) is soluble in water.

3. Solubility of acetone (CH3COCH3): Acetone is a polar molecule

due to the presence of a carbonyl group (C=O), which imparts a significant

dipole moment. As water is also a polar solvent, acetone is soluble in water due

to the ability of polar molecules to dissolve in other polar substances.

Question 34

Question

Determine which of the following compounds is most soluble in water based on

their chemical structures:

A) CH3CH2OH B) CH3CH2CH2CH3C) CH3CH2COOH D) CH3OCH3

Solution

Step 1: Analyze the chemical structures of the compounds. - Compound A

is ethanol. - Compound B is butane. - Compound C is propanoic acid. -

Compound D is dimethyl ether.

Step 2: Determine the most soluble compound in water. - Water is a polar

molecule, which means it can dissolve other polar compounds or compounds

that can form hydrogen bonds. - Among the given compounds, compound C

(propanoic acid) is the most soluble in water because it can form hydrogen

bonds with water molecules through its carboxylic acid functional group. -

Compounds A and D are partially soluble in water as they contain a hydroxyl

group and an ether group, respectively. - Compound B (butane) is the least

soluble in water as it is nonpolar and cannot form any significant interactions

with water molecules.

Therefore, compound C) CH3CH2COOH (propanoic acid) is the most

soluble in water among the given compounds.

Question 35

Question

Calculate the solubility of benzoic acid (CHO) in water at 25

C. The Ksp of

benzoic acid at this temperature is 6.3×10−5.

Solution

Step 1: Write the equilibrium equation for the dissolution of benzoic acid in

water:

CHO(s)⇌CHO(aq)

Step 2: Write the expression for the solubility product (Ksp):

Ksp = [CHO] = 6.3×10−5

Step 3: Define the initial amount of benzoic acid dissolved as x (mol/L). At

equilibrium, the concentration of benzoic acid is also x mol/L.

Step 4: Substitute the equilibrium concentration into the Ksp expression:

6.3×10−5=x×x

x2= 6.3×10−5

Step 5: Solve for x to find the solubility of benzoic acid in water:

x=p6.3×10−5= 0.0079 mol/L

Therefore, the solubility of benzoic acid in water at 25

C is 0.0079 mol/L.

Question 2

Question

Determine which of the following compounds is most soluble in water:

1. Hexane (C6H14)

2. Acetone (C3H6O)

3. Ethanol (C2H5OH)

Solution

To determine the compound that is most soluble in water, we need to consider

the polarity of the compounds and their ability to form hydrogen bonds with

water molecules.

Step 1: Consider the chemical structures of the compounds:

1. Hexane (C6H14) - nonpolar molecule with only C-H bonds

2. Acetone (C3H6O) - polar molecule with a C=O bond

3. Ethanol (C2H5OH) - polar molecule with an -OH group that can partici-

pate in hydrogen bonding

Step 2: Evaluate the solubility of the compounds in water based on their

polarity and ability to form hydrogen bonds:

1. Hexane is nonpolar and cannot form hydrogen bonds with water. There-

fore, it is not soluble in water.

2. Acetone is a polar molecule with a C=O bond, allowing it to form hydro-

gen bonds with water. It is moderately soluble in water.

3. Ethanol is a polar molecule with an -OH group, which can form hydrogen

bonds with water. It is the most soluble compound in water among the

options given.

Therefore, the most soluble compound in water from the options provided

is Ethanol (C2H5OH).

Question 3

Question

A student is given a mixture of four compounds: hexane, ethanol, acetone, and

water. The student is asked to predict the order in which these compounds will

elute on a column chromatography setup using silica gel as the stationary phase