CHEM 122 - GENERAL CHEMISTRY II -
Organic chemistry Question Bank
Question 1
Problem: Provide the systematic IUPAR name for the following alkane struc-
ture:
CH-CH(CH)-CH-CH(CH)-CH
Solution:
Step 1: Identify the longest continuous carbon chain. Examine the structure
to find the longest continuous sequence of carbon atoms. Here, the longest chain
contains 5 carbon atoms: CH-CH(CH)-CH-CH(CH)-CH
5 carbon atoms
denote a pentane backbone.
Step 2: Number the carbon atoms in the chain to minimize the locants of
the substituents. We number from the end that gives the lowest number to the
first substituent we encounter: So, numbering from left to right, we get: CH-
1CH(CH)-2CH-3CH(CH)-4CH Here, methyl groups are attached to carbons 2
and 3.
Step 3: Identify and name the substituents. There are two methyl groups
as substituents.
Step 4: Assign numbers to each substituent according to its position on the
main chain. From the numbering, there is one methyl group on carbon 2 and
one on carbon 3.
Step 5: Combine the names and positions to form the complete IUPAC name.
Because there are identical substituents on different carbons, use prefixes (di-,
tri-, tetra-) to indicate multiple identical groups. Thus, ”dimethyl” is used, and
the complete name becomes: 2,3-dimethylpentane
This correctly describes the structure with a pentane backbone and methyl
groups on the second and third carbons.Question 1: Naming Alkanes
Problem: Provide the systematic IUPAR name for the following
alkane structure:
CH-CH(CH)-CH-CH(CH)-CH
Solution:
Step 1: Identify the longest continuous carbon chain. Examine the
structure to find the longest continuous sequence of carbon atoms.
Here, the longest chain contains 5 carbon atoms: CH-CH(CH)-CH-
CH(CH)-CH
5 carbon atoms denote a pentane backbone.
1
Step 2: Number the carbon atoms in the chain to minimize the
locants of the substituents. We number from the end that gives the
lowest number to the first substituent we encounter: So, numbering
from left to right, we get: CH-1CH(CH)-2CH-3CH(CH)-4CH Here,
methyl groups are attached to carbons 2 and 3.
Step 3: Identify and name the substituents. There are two methyl
groups as substituents.
Step 4: Assign numbers to each substituent according to its po-
sition on the main chain. From the numbering, there is one methyl
group on carbon 2 and one on carbon 3.
Step 5: Combine the names and positions to form the complete
IUPAC name. Because there are identical substituents on different
carbons, use prefixes (di-, tri-, tetra-) to indicate multiple identical
groups. Thus, ”dimethyl” is used, and the complete name becomes:
2,3-dimethylpentane
This correctly describes the structure with a pentane backbone
and methyl groups on the second and third carbons.
Question 2
1. Step 1: Treatment of cyclohexanone with ethyl magnesium
bromide (EtMgBr) followed by acid quench. 2. Step 2: Heating the
product from Step 1 with phosphorus oxychloride (POCl3).
Step-by-Step Solution:
Step 1: Reaction with Ethyl Magnesium Bromide 1. Nucleophilic
Addition: Ethyl magnesium bromide (EtMgBr) acts as a Grignard
reagent, which is a strong nucleophile. It attacks the carbonyl group
of cyclohexanone.
Reaction: C6H10O+EtMgBr →Intermediate Alcohol
2. Formation of Alcohol: The oxygen in the carbonyl group of
cyclohexanone (ketone) gains a pair of electrons when the pi bond
breaks, and the oxygen is protonated once the acid (usually water or
dilute acid) is added in the quench step.
Product after Step 1: 1-ethylcyclohexanol.
Step 2: Heating with Phosphorus Oxychloride (POCl3) 1. Dehy-
dration Reaction: Phosphorus oxychloride is utilized in the dehydra-
tion of alcohols to yield alkenes. This process usually goes through
an elimination (E2) mechanism.
2. Mechanism Overview: - The hydroxyl group in 1-ethylcyclohexanol
will react with POCl3 forming a good leaving group. - An elimina-
tion reaction then occurs, typically via an E2 mechanism, hence a
proton is abstracted from a carbon adjacent to the carbon bearing
the leaving group, forming a double bond. - As the least sterically
hindered and most stable option, the double bond will likely form
2
at the position originally between the alpha-carbon (where OH was
attached) and the adjacent beta-carbon, giving 1-ethylcyclohexene as
the major product.
Product after Step 2: 1-ethylcyclohexene.
Final Answer: The major organic product of the reaction sequence
starting from cyclohexanone, treating with ethyl magnesium bromide,
followed by acid quench and then heating with phosphorus oxychlo-
ride, is 1-ethylcyclohexene. This product results from a nucleophilic
addition of the Grignard reagent to the ketone followed by an elim-
ination reaction to form the alkene. Question: Identify the major
organic product of the following reaction sequence:
1. Step 1: Treatment of cyclohexanone with ethyl magnesium
bromide (EtMgBr) followed by acid quench. 2. Step 2: Heating the
product from Step 1 with phosphorus oxychloride (POCl3).
Step-by-Step Solution:
Step 1: Reaction with Ethyl Magnesium Bromide 1. Nucleophilic
Addition: Ethyl magnesium bromide (EtMgBr) acts as a Grignard
reagent, which is a strong nucleophile. It attacks the carbonyl group
of cyclohexanone.
Reaction: C6H10O+EtMgBr →Intermediate Alcohol
2. Formation of Alcohol: The oxygen in the carbonyl group of
cyclohexanone (ketone) gains a pair of electrons when the pi bond
breaks, and the oxygen is protonated once the acid (usually water or
dilute acid) is added in the quench step.
Product after Step 1: 1-ethylcyclohexanol.
Step 2: Heating with Phosphorus Oxychloride (POCl3) 1. Dehy-
dration Reaction: Phosphorus oxychloride is utilized in the dehydra-
tion of alcohols to yield alkenes. This process usually goes through
an elimination (E2) mechanism.
2. Mechanism Overview: - The hydroxyl group in 1-ethylcyclohexanol
will react with POCl3 forming a good leaving group. - An elimina-
tion reaction then occurs, typically via an E2 mechanism, hence a
proton is abstracted from a carbon adjacent to the carbon bearing
the leaving group, forming a double bond. - As the least sterically
hindered and most stable option, the double bond will likely form
at the position originally between the alpha-carbon (where OH was
attached) and the adjacent beta-carbon, giving 1-ethylcyclohexene as
the major product.
Product after Step 2: 1-ethylcyclohexene.
Final Answer: The major organic product of the reaction sequence
starting from cyclohexanone, treating with ethyl magnesium bromide,
followed by acid quench and then heating with phosphorus oxychlo-
ride, is 1-ethylcyclohexene. This product results from a nucleophilic
3
addition of the Grignard reagent to the ketone followed by an elimi-
nation reaction to form the alkene.
Question 3
Question: Draw the structures and write the balanced chemi-
cal equation for the esterification reaction between acetic acid and
ethanol. Also, name the ester product and byproduct of the reac-
tion.
Solution:
Step 1: Identify the reactants needed for the esterification reac-
tion. - Acetic Acid (CHCOOH) - Ethanol (CHCHOH)
Step 2: Understand that esterification is the reaction of a car-
boxylic acid with an alcohol in the presence of an acid catalyst (com-
monly sulfuric acid) to form an ester and water.
Step 3: Write the structural formulas of the reactants. - Acetic
Acid (CHCOOH) - Ethanol (CHCHOH)
Step 4: Combine the acetyl group from acetic acid (CHCO-) with
the ethyl group from ethanol (CHCH) to form the ester.
Step 5: Write the balanced equation for the reaction:
CHCOOH +CHCHOH →CHCOOCHCH +HO
Step 6: Name the ester product. - Ester: Ethyl acetate (CHCOOCHCH)
Step 7: Name the byproduct: - Byproduct: Water (HO)
The reaction illustrated is a typical esterification, where acetic acid
reacts with ethanol in the presence of an acid catalyst to form ethyl
acetate and water. This type of reaction is crucial for the synthesis of
various esters used in fragrances, flavorings, and solvents. Question
3: Esterification Reaction
Question: Draw the structures and write the balanced chemi-
cal equation for the esterification reaction between acetic acid and
ethanol. Also, name the ester product and byproduct of the reac-
tion.
Solution:
Step 1: Identify the reactants needed for the esterification reac-
tion. - Acetic Acid (CHCOOH) - Ethanol (CHCHOH)
Step 2: Understand that esterification is the reaction of a car-
boxylic acid with an alcohol in the presence of an acid catalyst (com-
monly sulfuric acid) to form an ester and water.
Step 3: Write the structural formulas of the reactants. - Acetic
Acid (CHCOOH) - Ethanol (CHCHOH)
Step 4: Combine the acetyl group from acetic acid (CHCO-) with
the ethyl group from ethanol (CHCH) to form the ester.
4
Step 5: Write the balanced equation for the reaction:
CHCOOH +CHCHOH →CHCOOCHCH +HO
Step 6: Name the ester product. - Ester: Ethyl acetate (CHCOOCHCH)
Step 7: Name the byproduct: - Byproduct: Water (HO)
The reaction illustrated is a typical esterification, where acetic acid
reacts with ethanol in the presence of an acid catalyst to form ethyl
acetate and water. This type of reaction is crucial for the synthesis
of various esters used in fragrances, flavorings, and solvents.
Question 4
Background: Stereoisomers are molecules that have the same molec-
ular formula and sequence of bonded atoms (constitution), but differ
in the three-dimensional orientations of their atoms in space. This
results in different chemical and physical properties, essential for un-
derstanding biochemical processes. Stereoisomerism is divided into
two main types: enantiomerism and diastereomerism.
—
Question: Design a stereochemistry problem involving cyclohex-
ane. The compound should be 1,2-dimethylcyclohexane. Provide
details on the types of stereoisomers possible for this compound and
ask for their identification and comparison.
—
Solution:
Step 1: Understanding the Structure of Cyclohexane Cyclohexane
is a six-membered ring, and when substituents are added, they can
occupy two distinct positions - axial (projecting outward, parallel to
the axis of the ring) or equatorial (projecting outward, but in the
plane of the ring).
Step 2: Identifying the Positions of the Substituents For 1,2-
dimethylcyclohexane, the two methyl groups are attached to the first
and second carbon atoms of the cyclohexane ring.
Step 3: Understanding the Concept of Stereoisomerism In 1,2-
dimethylcyclohexane, the two methyl groups can either be: - both in
axial positions - both in equatorial positions - one in an axial and one
in an equatorial position
This results in different steric configurations:
1. cis-1,2-dimethylcyclohexane: Both methyl groups are either
above or below the plane of the ring (one axial and one equatorial,
on the same side of the ring). 2. trans-1,2-dimethylcyclohexane: One
methyl group is above the plane and one is below the plane of the
ring (one axial and one equatorial, on opposite sides of the ring).
5
Step 4: Analysis of Stability Generally, substituents in the equa-
torial position are more favorable due to less steric strain and 1,3-
diaxial interactions. Therefore, the stability of these isomers usually
increases with the number of substituents in the equatorial position.
Step 5: Conceptual Question Determine and draw the most stable
conformation of cis-1,2-dimethylcyclohexane and trans-1,2-dimethylcyclohexane,
and compare their stability.
Answer: - For cis-1,2-dimethylcyclohexane, the most stable con-
formation would be where both methyl groups are equatorial. - For
trans-1,2-dimethylcyclohexane, one methyl group will be axial and
the other equatorial, but upon ring flip, the positions interchange.
Given these considerations, the cis-1,2-dimethylcyclohexane with
both methyl groups in the equatorial position is generally more stable
due to minimized steric strain.
This problem requires understanding the spatial arrangement in
cyclohexane and the effects of substituent positions on stability and
properties of molecules. Question 4: Stereoisomerism in Organic
Compounds
Background: Stereoisomers are molecules that have the same molec-
ular formula and sequence of bonded atoms (constitution), but differ
in the three-dimensional orientations of their atoms in space. This
results in different chemical and physical properties, essential for un-
derstanding biochemical processes. Stereoisomerism is divided into
two main types: enantiomerism and diastereomerism.
—
Question: Design a stereochemistry problem involving cyclohex-
ane. The compound should be 1,2-dimethylcyclohexane. Provide
details on the types of stereoisomers possible for this compound and
ask for their identification and comparison.
—
Solution:
Step 1: Understanding the Structure of Cyclohexane Cyclohexane
is a six-membered ring, and when substituents are added, they can
occupy two distinct positions - axial (projecting outward, parallel to
the axis of the ring) or equatorial (projecting outward, but in the
plane of the ring).
Step 2: Identifying the Positions of the Substituents For 1,2-
dimethylcyclohexane, the two methyl groups are attached to the first
and second carbon atoms of the cyclohexane ring.
Step 3: Understanding the Concept of Stereoisomerism In 1,2-
dimethylcyclohexane, the two methyl groups can either be: - both in
axial positions - both in equatorial positions - one in an axial and one
in an equatorial position
This results in different steric configurations:
1. cis-1,2-dimethylcyclohexane: Both methyl groups are either
above or below the plane of the ring (one axial and one equatorial,
6
on the same side of the ring). 2. trans-1,2-dimethylcyclohexane: One
methyl group is above the plane and one is below the plane of the
ring (one axial and one equatorial, on opposite sides of the ring).
Step 4: Analysis of Stability Generally, substituents in the equa-
torial position are more favorable due to less steric strain and 1,3-
diaxial interactions. Therefore, the stability of these isomers usually
increases with the number of substituents in the equatorial position.
Step 5: Conceptual Question Determine and draw the most stable
conformation of cis-1,2-dimethylcyclohexane and trans-1,2-dimethylcyclohexane,
and compare their stability.
Answer: - For cis-1,2-dimethylcyclohexane, the most stable con-
formation would be where both methyl groups are equatorial. - For
trans-1,2-dimethylcyclohexane, one methyl group will be axial and
the other equatorial, but upon ring flip, the positions interchange.
Given these considerations, the cis-1,2-dimethylcyclohexane with
both methyl groups in the equatorial position is generally more stable
due to minimized steric strain.
This problem requires understanding the spatial arrangement in
cyclohexane and the effects of substituent positions on stability and
properties of molecules.
Question 5
Question: Propose a mechanism for the acid-catalyzed esterifica-
tion of acetic acid (CH3COOH) with ethanol (CH3CH2OH) to form
ethyl acetate (CH3COOCH2CH3) and water.
—
Answer and Step-by-Step Solution:
Step 1: Acid Catalyst Protonation The first step in the mecha-
nism is the protonation of the carbonyl oxygen of acetic acid by the
sulfuric acid catalyst. The oxygen atom in the carbonyl group of
acetic acid has lone pairs which can accept a proton, leading to a
more electrophilic carbonyl carbon.
Equation:
CH3COOH +H+→CH3COOH+
2
Step 2: Nucleophilic Attack The protonated acetic acid now reacts
with ethanol. The lone pair of electrons on the oxygen atom of ethanol
attacks the electrophilic carbonyl carbon of the protonated acetic
acid. This step results in the formation of a tetrahedral intermediate.
Equation:
CH3COOH+
2+CH3CH2OH →CH3COOCH2CH3OH+
Step 3: Departure of Water In this tetrahedral intermediate, the
-OH group present in the intermediate can act as a leaving group.
7
The intermediate eliminates a molecule of water, forming the ester
ethyl acetate.
Equation:
CH3COOCH2CH3OH+→CH3COOCH2CH3+H2O
Step 4: Deprotonation The final step of the reaction involves the
removal of a proton from the ester product, catalyzed by the leftover
acid catalyst, restoring the catalyst and completing the formation of
ethyl acetate.
Equation:
CH3COOCH2CH3+H+→CH3COOCH2CH3
Summary: Through these steps, acetic acid and ethanol under
an acid catalyst undergo esterification to produce ethyl acetate and
water. This reaction is a classic example of an esterification, where
an acid reacts with an alcohol to form an ester and water, facilitated
by an acid catalyst.
Overall Equation:
CH3COOH +CH3CH2OH H+
−−→ CH3COOCH2CH3+H2O
Question 5: Esterification Reaction
Question: Propose a mechanism for the acid-catalyzed esterifica-
tion of acetic acid (CH3COOH) with ethanol (CH3CH2OH) to form
ethyl acetate (CH3COOCH2CH3) and water.
—
Answer and Step-by-Step Solution:
Step 1: Acid Catalyst Protonation The first step in the mecha-
nism is the protonation of the carbonyl oxygen of acetic acid by the
sulfuric acid catalyst. The oxygen atom in the carbonyl group of
acetic acid has lone pairs which can accept a proton, leading to a
more electrophilic carbonyl carbon.
Equation:
CH3COOH +H+→CH3COOH+
2
Step 2: Nucleophilic Attack The protonated acetic acid now reacts
with ethanol. The lone pair of electrons on the oxygen atom of ethanol
attacks the electrophilic carbonyl carbon of the protonated acetic
acid. This step results in the formation of a tetrahedral intermediate.
Equation:
CH3COOH+
2+CH3CH2OH →CH3COOCH2CH3OH+
Step 3: Departure of Water In this tetrahedral intermediate, the
-OH group present in the intermediate can act as a leaving group.
8
The intermediate eliminates a molecule of water, forming the ester
ethyl acetate.
Equation:
CH3COOCH2CH3OH+→CH3COOCH2CH3+H2O
Step 4: Deprotonation The final step of the reaction involves the
removal of a proton from the ester product, catalyzed by the leftover
acid catalyst, restoring the catalyst and completing the formation of
ethyl acetate.
Equation:
CH3COOCH2CH3+H+→CH3COOCH2CH3
Summary: Through these steps, acetic acid and ethanol under
an acid catalyst undergo esterification to produce ethyl acetate and
water. This reaction is a classic example of an esterification, where
an acid reacts with an alcohol to form an ester and water, facilitated
by an acid catalyst.
Overall Equation:
CH3COOH +CH3CH2OH H+
−−→ CH3COOCH2CH3+H2O
Question 6
Problem: Devise a synthesis route for 3-methyl-2-butanol starting
from 2-methylpropene.
Step-by-Step Solution
Step 1: Hydration of 2-methylpropene (tert-butyl alcohol forma-
tion)
- Reaction: 2-methylpropene (CH3C(CH3)=CH2)undergoes acid-
catalyzed hydration. - Mechanism: The double bond of 2-methylpropene
reacts with H2O in the presence of an acid catalyst (e.g., H2SO4). -
Product: tert-Butyl alcohol ((CH3)3COH).
Step 2: Esterification of tert-Butyl alcohol
- Reaction: tert-Butyl alcohol is treated with acetic acid under
acidic conditions to form tert-butyl acetate. - Mechanism: The hy-
droxyl group of tert-Butyl alcohol reacts with the carboxyl group
of acetic acid, eliminating water and forming tert-butyl acetate. -
Product: tert-Butyl acetate ((CH3)3COOCCH3).
Step 3: Grignard Reagent Formation
- Reaction: Methyl magnesium bromide is formed from methyl
bromide and magnesium in dry ether. - Mechanism: Bromine in
methyl bromide interacts with the magnesium atom to form methyl
magnesium bromide. - Product: Methyl magnesium bromide (CH3MgBr).
9
Step 4: Reaction of Methyl magnesium bromide with tert-Butyl
acetate
- Reaction: Methyl magnesium bromide reacts with tert-butyl ac-
etate. - Mechanism: This Grignard reaction involves the nucleophilic
attack of the methyl anion (from methyl magnesium bromide) on the
carbonyl carbon of tert-butyl acetate. - Intermediate: Ketone inter-
mediate (2-methyl-2-pentanone). - Further Reaction: Water is added
to protonate the intermediate, yielding the ketone.
Step 5: Reduction of the Ketone
- Reaction: Reduction of 2-methyl-2-pentanone using sodium boro-
hydride (NaBH4). - Mechanism: The borohydride ion (BH−
4) reduces
the carbonyl group to a hydroxyl group. - Product: 3-methyl-2-
butanol.
This synthesis route demonstrates a process involving hydration,
esterification, formation and use of a Grignard reagent, and reduction,
to synthesize 3-methyl-2-butanol from 2-methylpropene. Question 6:
Synthesis of 3-methyl-2-butanol
Problem: Devise a synthesis route for 3-methyl-2-butanol starting
from 2-methylpropene.
Step-by-Step Solution
Step 1: Hydration of 2-methylpropene (tert-butyl alcohol forma-
tion)
- Reaction: 2-methylpropene (CH3C(CH3)=CH2)undergoes acid-
catalyzed hydration. - Mechanism: The double bond of 2-methylpropene
reacts with H2O in the presence of an acid catalyst (e.g., H2SO4). -
Product: tert-Butyl alcohol ((CH3)3COH).
Step 2: Esterification of tert-Butyl alcohol
- Reaction: tert-Butyl alcohol is treated with acetic acid under
acidic conditions to form tert-butyl acetate. - Mechanism: The hy-
droxyl group of tert-Butyl alcohol reacts with the carboxyl group
of acetic acid, eliminating water and forming tert-butyl acetate. -
Product: tert-Butyl acetate ((CH3)3COOCCH3).
Step 3: Grignard Reagent Formation
- Reaction: Methyl magnesium bromide is formed from methyl
bromide and magnesium in dry ether. - Mechanism: Bromine in
methyl bromide interacts with the magnesium atom to form methyl
magnesium bromide. - Product: Methyl magnesium bromide (CH3MgBr).
Step 4: Reaction of Methyl magnesium bromide with tert-Butyl
acetate
- Reaction: Methyl magnesium bromide reacts with tert-butyl ac-
etate. - Mechanism: This Grignard reaction involves the nucleophilic
attack of the methyl anion (from methyl magnesium bromide) on the
carbonyl carbon of tert-butyl acetate. - Intermediate: Ketone inter-
mediate (2-methyl-2-pentanone). - Further Reaction: Water is added
to protonate the intermediate, yielding the ketone.
Step 5: Reduction of the Ketone
10
- Reaction: Reduction of 2-methyl-2-pentanone using sodium boro-
hydride (NaBH4). - Mechanism: The borohydride ion (BH−
4) reduces
the carbonyl group to a hydroxyl group. - Product: 3-methyl-2-
butanol.
This synthesis route demonstrates a process involving hydration,
esterification, formation and use of a Grignard reagent, and reduction,
to synthesize 3-methyl-2-butanol from 2-methylpropene.
Question 7
Given the alkene 2-methyl-2-butene, predict the product when it
reacts with hydrogen bromide (HBr).
Step-by-Step Solution:
Step 1: Identify the Structure of the Alkene 2-methyl-2-butene
is an alkene, meaning it contains a carbon-carbon double bond. Its
structure can be drawn or visualized as follows: - Carbon chain: CH3-
C(CH3)=C(CH3)-CH3
Step 2: Understand Hydrohalogenation Hydrohalogenation is the
addition of hydrogen halides like HBr to alkenes. This reaction typi-
cally follows Markovnikov’s rule, where the hydrogen atom from the
hydrogen halide forms a bond with the carbon of the double bond that
has the greater number of hydrogen atoms, and the halide (bromine,
in this case) bonds with the other carbon atom.
Step 3: Applying Markovnikov’s Rule - The structure of 2-methyl-
2-butene is symmetrical around the double bond. Therefore, either
carbon of the double bond can add hydrogen or bromine without
an initial preference since both carbons have the same number of
hydrogen atoms. - However, consider the secondary and tertiary
carbon classification: the CH3-C(CH3)=C(CH3)-CH3 has a tertiary
carbon at either carbon of the double bond.
Step 4: Predict the Product Formation - Both carbons of the dou-
ble bond in 2-methyl-2-butene are tertiary. According to Markovnikov’s
rule, bromine (Br) will attach to either carbon (as it doesn’t make
a difference in this overly symmetrical case), breaking the double
bond, while hydrogen (H) will attach to the other. - This leads us to
the same product, no matter at which carbon the hydrogen attaches
because of the symmetry: 2-bromo-2-methylbutane.
Formulate the Molecular Formula of the Product: - Hydrogen
attaches to one of the tertiary carbons, breaking the double bond,
and the bromine attaches to the other tertiary carbon. This results
in the product 2-bromo-2-methylbutane (C5H11Br).
Step 5: Confirm Chirality or Other Stereochemistry (if required)
- Since symmetrical addition to a symmetrical alkene does not lead
to chirality, the product (2-bromo-2-methylbutane) does not have a
chiral center.
11
Conclusion: The reaction of 2-methyl-2-butene with HBr yields 2-
bromo-2-methylbutane following the principles of hydrohalogenation
and Markovnikov’s rule. Question 7: Alkene Reactions - Hydrohalo-
genation
Given the alkene 2-methyl-2-butene, predict the product when it
reacts with hydrogen bromide (HBr).
Step-by-Step Solution:
Step 1: Identify the Structure of the Alkene 2-methyl-2-butene
is an alkene, meaning it contains a carbon-carbon double bond. Its
structure can be drawn or visualized as follows: - Carbon chain: CH3-
C(CH3)=C(CH3)-CH3
Step 2: Understand Hydrohalogenation Hydrohalogenation is the
addition of hydrogen halides like HBr to alkenes. This reaction typi-
cally follows Markovnikov’s rule, where the hydrogen atom from the
hydrogen halide forms a bond with the carbon of the double bond that
has the greater number of hydrogen atoms, and the halide (bromine,
in this case) bonds with the other carbon atom.
Step 3: Applying Markovnikov’s Rule - The structure of 2-methyl-
2-butene is symmetrical around the double bond. Therefore, either
carbon of the double bond can add hydrogen or bromine without
an initial preference since both carbons have the same number of
hydrogen atoms. - However, consider the secondary and tertiary
carbon classification: the CH3-C(CH3)=C(CH3)-CH3 has a tertiary
carbon at either carbon of the double bond.
Step 4: Predict the Product Formation - Both carbons of the dou-
ble bond in 2-methyl-2-butene are tertiary. According to Markovnikov’s
rule, bromine (Br) will attach to either carbon (as it doesn’t make
a difference in this overly symmetrical case), breaking the double
bond, while hydrogen (H) will attach to the other. - This leads us to
the same product, no matter at which carbon the hydrogen attaches
because of the symmetry: 2-bromo-2-methylbutane.
Formulate the Molecular Formula of the Product: - Hydrogen
attaches to one of the tertiary carbons, breaking the double bond,
and the bromine attaches to the other tertiary carbon. This results
in the product 2-bromo-2-methylbutane (C5H11Br).
Step 5: Confirm Chirality or Other Stereochemistry (if required)
- Since symmetrical addition to a symmetrical alkene does not lead
to chirality, the product (2-bromo-2-methylbutane) does not have a
chiral center.
Conclusion: The reaction of 2-methyl-2-butene with HBr yields 2-
bromo-2-methylbutane following the principles of hydrohalogenation
and Markovnikov’s rule.
12
Question 8
Question: What is the outcome of the reaction between benzalde-
hyde (C6H5CHO) and acetophenone (C6H5COCH3) in the presence
of an alkali such as NaOH?
Step-by-Step Solution:
Step 1: Understand the components involved. - Benzaldehyde: An
aromatic aldehyde with the formula C6H5CHO. - Acetophenone: An
aromatic ketone with the formula C6H5COCH3. - NaOH: Sodium
hydroxide, a strong base.
Step 2: Identify the Type of Reaction The reaction between ben-
zaldehyde and acetophenone in basic conditions involves a condensa-
tion process known as an aldol condensation.
Step 3: Mechanism of Aldol Condensation 1. Base Addition: In
the presence of NaOH, the hydroxide ion (OH-) acts as a base and
deprotonates the alpha-hydrogen of acetophenone. This forms an
enolate ion from the acetophenone.
2. Nucleophilic Attack: The enolate ion from acetophenone acts
as a nucleophile and attacks the electrophilic carbonyl carbon of ben-
zaldehyde.
3. Formation of Alcohol: The attack leads to the formation of a
beta-hydroxyketone.
Step 4: Water Elimination 4. Under basic conditions, further
heating causes dehydration of the beta-hydroxyketone, leading to the
formation of an ,-unsaturated ketone.
Step 5: Product Formation 5. The final product from the reaction
between benzaldehyde and acetophenone under aldol condensation
and subsequent dehydration is benzylideneacetophenone (chalcone),
generally represented as C6H5CH=CHCOCH3.
Summary: The reaction between benzaldehyde and acetophenone
in the presence of NaOH leads to the formation of benzylideneace-
tophenone (chalcone) through an aldol condensation followed by a
dehydration reaction. This is an essential reaction in organic synthe-
sis for the formation of chalcone compounds, which are important in
various chemical and pharmacological syntheses. Organic Chemistry
Question for Liberty University - Question 8
Question: What is the outcome of the reaction between benzalde-
hyde (C6H5CHO) and acetophenone (C6H5COCH3) in the presence
of an alkali such as NaOH?
Step-by-Step Solution:
Step 1: Understand the components involved. - Benzaldehyde: An
aromatic aldehyde with the formula C6H5CHO. - Acetophenone: An
aromatic ketone with the formula C6H5COCH3. - NaOH: Sodium
hydroxide, a strong base.
Step 2: Identify the Type of Reaction The reaction between ben-
zaldehyde and acetophenone in basic conditions involves a condensa-
13
tion process known as an aldol condensation.
Step 3: Mechanism of Aldol Condensation 1. Base Addition: In
the presence of NaOH, the hydroxide ion (OH-) acts as a base and
deprotonates the alpha-hydrogen of acetophenone. This forms an
enolate ion from the acetophenone.
2. Nucleophilic Attack: The enolate ion from acetophenone acts
as a nucleophile and attacks the electrophilic carbonyl carbon of ben-
zaldehyde.
3. Formation of Alcohol: The attack leads to the formation of a
beta-hydroxyketone.
Step 4: Water Elimination 4. Under basic conditions, further
heating causes dehydration of the beta-hydroxyketone, leading to the
formation of an ,-unsaturated ketone.
Step 5: Product Formation 5. The final product from the reaction
between benzaldehyde and acetophenone under aldol condensation
and subsequent dehydration is benzylideneacetophenone (chalcone),
generally represented as C6H5CH=CHCOCH3.
Summary: The reaction between benzaldehyde and acetophenone
in the presence of NaOH leads to the formation of benzylideneace-
tophenone (chalcone) through an aldol condensation followed by a
dehydration reaction. This is an essential reaction in organic synthe-
sis for the formation of chalcone compounds, which are important in
various chemical and pharmacological syntheses.
Question 9
How would you distinguish between the structural isomers of bu-
tanol using infrared spectroscopy (IR) and nuclear magnetic reso-
nance (NMR) spectroscopy? Consider the four isomers: 1-butanol,
2-butanol, iso-butanol, and tert-butanol.
—
Answer and Explanation:
Step 1: Understanding the Structure of Isomers - 1-butanol: A
straight-chain primary alcohol (CHCHCHCHOH). - 2-butanol: A
secondary alcohol where the -OH group is on the second carbon of the
straight chain (CHCH(OH)CHCH). - iso-butanol (isobutanol): An-
other form of a secondary alcohol, but arranged differently (CH)CHCHOH.
- tert-butanol: A tertiary alcohol, with the -OH group attached to a
carbon that itself is connected to three other carbons (C(CH)OH).
Step 2: Using Infrared Spectroscopy (IR) - OH Stretch: All iso-
mers show a broad O-H stretch typically around 3200-3600 cm−1, indicatingthepresenceof analcoholgroup.−
C−HandC−OStretches :−1−butanoland2−butanol :T hesewillshowsimilarstretchesforC−
Haround2900cm−1andC−Oaround1050−1150cm−1.−iso−butanol :SimilarC−
Hstretch, possibleslightshif tsinC −Ostretchduetodif ferentenvironment. −
tert−butanol :Duetosterichindrancearoundthetertiarycarbon, tert−butanolmighthaveslightshiftsorvariationsintheintensityof peaks.
14
Step 3: Using Nuclear Magnetic Resonance (NMR) Spectroscopy
- 1-butanol: - 1H NMR: A triplet for the -CHOH group, quartet for
the -CH- next to -OH, and multiplets for other methylene groups. -
13C NMR: Four distinct peaks for each type of carbon. - 2-butanol:
- 1H NMR: A singlet for the -OH, a quartet for the -CH(OH)-, and
triplets/multiplets for other -CH and -CH groups. - 13C NMR: Dis-
tinct peaks for the carbon bearing the OH, separate from the other
carbons. - iso-butanol: - 1H NMR: Similar to 2-butanol but different
splitting due to branching. - 13C NMR: Unique peak for the carbon
bearing OH; three other carbons showing varying environments. -
tert-butanol: - 1H NMR: All nine hydrogens appear as a singlet due
to the symmetric environment of the tert-butyl group. - 13C NMR:
Only one prominent carbon signal for the tertiary carbon, distinct
from signals seen in other alcohols.
Step 4: Distinguishing Based on Spectroscopic Data - IR Spec-
troscopy: OH group identification is similar across all; look for subtle
differences in C-H and C-O stretches. - NMR Spectroscopy: Provides
clear differentiation based on the environment around the OH group
and the number and type of hydrogen environments: - 1-butanol:
Complex splitting patterns in 1H NMR. - 2-butanol: Clear secondary
alcohol indication with quartet for CH(OH). - iso-butanol: Secondary,
but different pattern from 2-butanol. - tert-butanol: Simplest spectra
with fewer signals.
Conclusion: Careful analysis of NMR is most effective for distin-
guishing these isomers due to variations in carbon and hydrogen en-
vironments directly reflected in the spectra. IR can corroborate the
presence of alcohol but is less definitive for differentiating isomers
unless combined with NMR data.Question 9: Isomer Identification
in Butanol
How would you distinguish between the structural isomers of bu-
tanol using infrared spectroscopy (IR) and nuclear magnetic reso-
nance (NMR) spectroscopy? Consider the four isomers: 1-butanol,
2-butanol, iso-butanol, and tert-butanol.
—
Answer and Explanation:
Step 1: Understanding the Structure of Isomers - 1-butanol: A
straight-chain primary alcohol (CHCHCHCHOH). - 2-butanol: A
secondary alcohol where the -OH group is on the second carbon of the
straight chain (CHCH(OH)CHCH). - iso-butanol (isobutanol): An-
other form of a secondary alcohol, but arranged differently (CH)CHCHOH.
- tert-butanol: A tertiary alcohol, with the -OH group attached to a
carbon that itself is connected to three other carbons (C(CH)OH).
Step 2: Using Infrared Spectroscopy (IR) - OH Stretch: All iso-
mers show a broad O-H stretch typically around 3200-3600 cm−1, indicatingthepresenceof analcoholgroup.−
C−HandC−OStretches :−1−butanoland2−butanol :T hesewillshowsimilarstretchesforC−
Haround2900cm−1andC−Oaround1050−1150cm−1.−iso−butanol :SimilarC−
15
Hstretch, possibleslightshif tsinC −Ostretchduetodif ferentenvironment. −
tert−butanol :Duetosterichindrancearoundthetertiarycarbon, tert−butanolmighthaveslightshiftsorvariationsintheintensityof peaks.
Step 3: Using Nuclear Magnetic Resonance (NMR) Spectroscopy
- 1-butanol: - 1H NMR: A triplet for the -CHOH group, quartet for
the -CH- next to -OH, and multiplets for other methylene groups. -
13C NMR: Four distinct peaks for each type of carbon. - 2-butanol:
- 1H NMR: A singlet for the -OH, a quartet for the -CH(OH)-, and
triplets/multiplets for other -CH and -CH groups. - 13C NMR: Dis-
tinct peaks for the carbon bearing the OH, separate from the other
carbons. - iso-butanol: - 1H NMR: Similar to 2-butanol but different
splitting due to branching. - 13C NMR: Unique peak for the carbon
bearing OH; three other carbons showing varying environments. -
tert-butanol: - 1H NMR: All nine hydrogens appear as a singlet due
to the symmetric environment of the tert-butyl group. - 13C NMR:
Only one prominent carbon signal for the tertiary carbon, distinct
from signals seen in other alcohols.
Step 4: Distinguishing Based on Spectroscopic Data - IR Spec-
troscopy: OH group identification is similar across all; look for subtle
differences in C-H and C-O stretches. - NMR Spectroscopy: Provides
clear differentiation based on the environment around the OH group
and the number and type of hydrogen environments: - 1-butanol:
Complex splitting patterns in 1H NMR. - 2-butanol: Clear secondary
alcohol indication with quartet for CH(OH). - iso-butanol: Secondary,
but different pattern from 2-butanol. - tert-butanol: Simplest spectra
with fewer signals.
Conclusion: Careful analysis of NMR is most effective for distin-
guishing these isomers due to variations in carbon and hydrogen en-
vironments directly reflected in the spectra. IR can corroborate the
presence of alcohol but is less definitive for differentiating isomers
unless combined with NMR data.
Question 10
A student at Liberty University is learning about nucleophilic sub-
stitution reactions in their Organic Chemistry course. Given the
molecules below, predict which will primarily undergo an SN1 reac-
tion and which will primarily undergo an SN2 reaction. Explain why
based on the structure of the molecule.
Molecules: 1. 2-bromo-2-methylpropane 2. 1-bromobutane
Provide the major product for each reaction type.
—
Step-by-Step Solution
Part A: Determining Reaction Types
1. 2-bromo-2-methylpropane:
16
- Structure: This molecule is a tertiary alkyl halide. - Reaction
Type: Tertiary alkyl halides like 2-bromo-2-methylpropane primarily
undergo SN1 reactions. This is because the carbon atom bonded to
the halide (bromine here) is surrounded by three alkyl groups, which
can stabilize the carbocation intermediate formed during the reaction
through inductive effect and hyperconjugation.
2. 1-bromobutane:
- Structure: This molecule is a primary alkyl halide. - Reaction
Type: Primary alkyl halides like 1-bromobutane primarily undergo
SN2 reactions. This is because the carbon atom bonded to the halide
(bromine here) is only attached to one alkyl group, offering little
steric hindrance to the attacking nucleophile. Also, primary alkyl
halides do not form stable carbocations needed for SN1 reactions.
Part B: Reaction Products
1. 2-bromo-2-methylpropane (SN1 Reaction):
Mechanism:
- Step 1: The leaving group (bromide ion, Br) departs, forming
a carbocation. The carbon attached to the Br becomes a positively
charged carbocation. - Step 2: A nucleophile (e.g., water in a solvol-
ysis reaction) attacks the carbocation.
Major Product:
- The major product would be 2-methyl-2-propanol if water acts as
the nucleophiles. This involves nucleophilic attack on the carbocation
followed by deprotonation.
2. 1-bromobutane (SN2 Reaction):
Mechanism:
- A single step mechanism where the nucleophile attacks the car-
bon bonded to bromine from the opposite side of the leaving group,
leading to inversion of configuration.
Major Product:
- Assuming the nucleophile is hydroxide (OH), the major product
will be 1-butanol. The OH attacks from the opposite side of the Br
departure, leading to an inversion of stereochemistry and forming the
alcohol.
Conclusion
Through understanding the structure and stability of intermedi-
ates (carbocations for SN1 and steric hindrance for SN2), students
at Liberty University can predict the type of nucleophilic substitu-
tion reaction that an alkyl halide will undergo, as well as the major
products formed in these reactions.Question 10: Understanding SN1
and SN2 Reactions
A student at Liberty University is learning about nucleophilic sub-
stitution reactions in their Organic Chemistry course. Given the
molecules below, predict which will primarily undergo an SN1 reac-
tion and which will primarily undergo an SN2 reaction. Explain why
based on the structure of the molecule.
17
Molecules: 1. 2-bromo-2-methylpropane 2. 1-bromobutane
Provide the major product for each reaction type.
—
Step-by-Step Solution
Part A: Determining Reaction Types
1. 2-bromo-2-methylpropane:
- Structure: This molecule is a tertiary alkyl halide. - Reaction
Type: Tertiary alkyl halides like 2-bromo-2-methylpropane primarily
undergo SN1 reactions. This is because the carbon atom bonded to
the halide (bromine here) is surrounded by three alkyl groups, which
can stabilize the carbocation intermediate formed during the reaction
through inductive effect and hyperconjugation.
2. 1-bromobutane:
- Structure: This molecule is a primary alkyl halide. - Reaction
Type: Primary alkyl halides like 1-bromobutane primarily undergo
SN2 reactions. This is because the carbon atom bonded to the halide
(bromine here) is only attached to one alkyl group, offering little
steric hindrance to the attacking nucleophile. Also, primary alkyl
halides do not form stable carbocations needed for SN1 reactions.
Part B: Reaction Products
1. 2-bromo-2-methylpropane (SN1 Reaction):
Mechanism:
- Step 1: The leaving group (bromide ion, Br) departs, forming
a carbocation. The carbon attached to the Br becomes a positively
charged carbocation. - Step 2: A nucleophile (e.g., water in a solvol-
ysis reaction) attacks the carbocation.
Major Product:
- The major product would be 2-methyl-2-propanol if water acts as
the nucleophiles. This involves nucleophilic attack on the carbocation
followed by deprotonation.
2. 1-bromobutane (SN2 Reaction):
Mechanism:
- A single step mechanism where the nucleophile attacks the car-
bon bonded to bromine from the opposite side of the leaving group,
leading to inversion of configuration.
Major Product:
- Assuming the nucleophile is hydroxide (OH), the major product
will be 1-butanol. The OH attacks from the opposite side of the Br
departure, leading to an inversion of stereochemistry and forming the
alcohol.
Conclusion
Through understanding the structure and stability of intermedi-
ates (carbocations for SN1 and steric hindrance for SN2), students
at Liberty University can predict the type of nucleophilic substitu-
tion reaction that an alkyl halide will undergo, as well as the major
products formed in these reactions.
18
Step 2: Number the carbon atoms in the chain to minimize the
locants of the substituents. We number from the end that gives the
lowest number to the first substituent we encounter: So, numbering
from left to right, we get: CH-1CH(CH)-2CH-3CH(CH)-4CH Here,
methyl groups are attached to carbons 2 and 3.
Step 3: Identify and name the substituents. There are two methyl
groups as substituents.
Step 4: Assign numbers to each substituent according to its po-
sition on the main chain. From the numbering, there is one methyl
group on carbon 2 and one on carbon 3.
Step 5: Combine the names and positions to form the complete
IUPAC name. Because there are identical substituents on different
carbons, use prefixes (di-, tri-, tetra-) to indicate multiple identical
groups. Thus, ”dimethyl” is used, and the complete name becomes:
2,3-dimethylpentane
This correctly describes the structure with a pentane backbone
and methyl groups on the second and third carbons.
Question 2
1. Step 1: Treatment of cyclohexanone with ethyl magnesium
bromide (EtMgBr) followed by acid quench. 2. Step 2: Heating the
product from Step 1 with phosphorus oxychloride (POCl3).
Step-by-Step Solution:
Step 1: Reaction with Ethyl Magnesium Bromide 1. Nucleophilic
Addition: Ethyl magnesium bromide (EtMgBr) acts as a Grignard
reagent, which is a strong nucleophile. It attacks the carbonyl group
of cyclohexanone.
Reaction: C6H10O+EtMgBr →Intermediate Alcohol
2. Formation of Alcohol: The oxygen in the carbonyl group of
cyclohexanone (ketone) gains a pair of electrons when the pi bond
breaks, and the oxygen is protonated once the acid (usually water or
dilute acid) is added in the quench step.
Product after Step 1: 1-ethylcyclohexanol.
Step 2: Heating with Phosphorus Oxychloride (POCl3) 1. Dehy-
dration Reaction: Phosphorus oxychloride is utilized in the dehydra-
tion of alcohols to yield alkenes. This process usually goes through
an elimination (E2) mechanism.
2. Mechanism Overview: - The hydroxyl group in 1-ethylcyclohexanol
will react with POCl3 forming a good leaving group. - An elimina-
tion reaction then occurs, typically via an E2 mechanism, hence a
proton is abstracted from a carbon adjacent to the carbon bearing
the leaving group, forming a double bond. - As the least sterically
hindered and most stable option, the double bond will likely form
2
at the position originally between the alpha-carbon (where OH was
attached) and the adjacent beta-carbon, giving 1-ethylcyclohexene as
the major product.
Product after Step 2: 1-ethylcyclohexene.
Final Answer: The major organic product of the reaction sequence
starting from cyclohexanone, treating with ethyl magnesium bromide,
followed by acid quench and then heating with phosphorus oxychlo-
ride, is 1-ethylcyclohexene. This product results from a nucleophilic
addition of the Grignard reagent to the ketone followed by an elim-
ination reaction to form the alkene. Question: Identify the major
organic product of the following reaction sequence:
1. Step 1: Treatment of cyclohexanone with ethyl magnesium
bromide (EtMgBr) followed by acid quench. 2. Step 2: Heating the
product from Step 1 with phosphorus oxychloride (POCl3).
Step-by-Step Solution:
Step 1: Reaction with Ethyl Magnesium Bromide 1. Nucleophilic
Addition: Ethyl magnesium bromide (EtMgBr) acts as a Grignard
reagent, which is a strong nucleophile. It attacks the carbonyl group
of cyclohexanone.
Reaction: C6H10O+EtMgBr →Intermediate Alcohol
2. Formation of Alcohol: The oxygen in the carbonyl group of
cyclohexanone (ketone) gains a pair of electrons when the pi bond
breaks, and the oxygen is protonated once the acid (usually water or
dilute acid) is added in the quench step.
Product after Step 1: 1-ethylcyclohexanol.
Step 2: Heating with Phosphorus Oxychloride (POCl3) 1. Dehy-
dration Reaction: Phosphorus oxychloride is utilized in the dehydra-
tion of alcohols to yield alkenes. This process usually goes through
an elimination (E2) mechanism.
2. Mechanism Overview: - The hydroxyl group in 1-ethylcyclohexanol
will react with POCl3 forming a good leaving group. - An elimina-
tion reaction then occurs, typically via an E2 mechanism, hence a
proton is abstracted from a carbon adjacent to the carbon bearing
the leaving group, forming a double bond. - As the least sterically
hindered and most stable option, the double bond will likely form
at the position originally between the alpha-carbon (where OH was
attached) and the adjacent beta-carbon, giving 1-ethylcyclohexene as
the major product.
Product after Step 2: 1-ethylcyclohexene.
Final Answer: The major organic product of the reaction sequence
starting from cyclohexanone, treating with ethyl magnesium bromide,
followed by acid quench and then heating with phosphorus oxychlo-
ride, is 1-ethylcyclohexene. This product results from a nucleophilic
3
addition of the Grignard reagent to the ketone followed by an elimi-
nation reaction to form the alkene.
Question 3
Question: Draw the structures and write the balanced chemi-
cal equation for the esterification reaction between acetic acid and
ethanol. Also, name the ester product and byproduct of the reac-
tion.
Solution:
Step 1: Identify the reactants needed for the esterification reac-
tion. - Acetic Acid (CHCOOH) - Ethanol (CHCHOH)
Step 2: Understand that esterification is the reaction of a car-
boxylic acid with an alcohol in the presence of an acid catalyst (com-
monly sulfuric acid) to form an ester and water.
Step 3: Write the structural formulas of the reactants. - Acetic
Acid (CHCOOH) - Ethanol (CHCHOH)
Step 4: Combine the acetyl group from acetic acid (CHCO-) with
the ethyl group from ethanol (CHCH) to form the ester.
Step 5: Write the balanced equation for the reaction:
CHCOOH +CHCHOH →CHCOOCHCH +HO
Step 6: Name the ester product. - Ester: Ethyl acetate (CHCOOCHCH)
Step 7: Name the byproduct: - Byproduct: Water (HO)
The reaction illustrated is a typical esterification, where acetic acid
reacts with ethanol in the presence of an acid catalyst to form ethyl
acetate and water. This type of reaction is crucial for the synthesis of
various esters used in fragrances, flavorings, and solvents. Question
3: Esterification Reaction
Question: Draw the structures and write the balanced chemi-
cal equation for the esterification reaction between acetic acid and
ethanol. Also, name the ester product and byproduct of the reac-
tion.
Solution:
Step 1: Identify the reactants needed for the esterification reac-
tion. - Acetic Acid (CHCOOH) - Ethanol (CHCHOH)
Step 2: Understand that esterification is the reaction of a car-
boxylic acid with an alcohol in the presence of an acid catalyst (com-
monly sulfuric acid) to form an ester and water.
Step 3: Write the structural formulas of the reactants. - Acetic
Acid (CHCOOH) - Ethanol (CHCHOH)
Step 4: Combine the acetyl group from acetic acid (CHCO-) with
the ethyl group from ethanol (CHCH) to form the ester.
4
Step 5: Write the balanced equation for the reaction:
CHCOOH +CHCHOH →CHCOOCHCH +HO
Step 6: Name the ester product. - Ester: Ethyl acetate (CHCOOCHCH)
Step 7: Name the byproduct: - Byproduct: Water (HO)
The reaction illustrated is a typical esterification, where acetic acid
reacts with ethanol in the presence of an acid catalyst to form ethyl
acetate and water. This type of reaction is crucial for the synthesis
of various esters used in fragrances, flavorings, and solvents.
Question 4
Background: Stereoisomers are molecules that have the same molec-
ular formula and sequence of bonded atoms (constitution), but differ
in the three-dimensional orientations of their atoms in space. This
results in different chemical and physical properties, essential for un-
derstanding biochemical processes. Stereoisomerism is divided into
two main types: enantiomerism and diastereomerism.
—
Question: Design a stereochemistry problem involving cyclohex-
ane. The compound should be 1,2-dimethylcyclohexane. Provide
details on the types of stereoisomers possible for this compound and
ask for their identification and comparison.
—
Solution:
Step 1: Understanding the Structure of Cyclohexane Cyclohexane
is a six-membered ring, and when substituents are added, they can
occupy two distinct positions - axial (projecting outward, parallel to
the axis of the ring) or equatorial (projecting outward, but in the
plane of the ring).
Step 2: Identifying the Positions of the Substituents For 1,2-
dimethylcyclohexane, the two methyl groups are attached to the first
and second carbon atoms of the cyclohexane ring.
Step 3: Understanding the Concept of Stereoisomerism In 1,2-
dimethylcyclohexane, the two methyl groups can either be: - both in
axial positions - both in equatorial positions - one in an axial and one
in an equatorial position
This results in different steric configurations:
1. cis-1,2-dimethylcyclohexane: Both methyl groups are either
above or below the plane of the ring (one axial and one equatorial,
on the same side of the ring). 2. trans-1,2-dimethylcyclohexane: One
methyl group is above the plane and one is below the plane of the
ring (one axial and one equatorial, on opposite sides of the ring).
5
Step 4: Analysis of Stability Generally, substituents in the equa-
torial position are more favorable due to less steric strain and 1,3-
diaxial interactions. Therefore, the stability of these isomers usually
increases with the number of substituents in the equatorial position.
Step 5: Conceptual Question Determine and draw the most stable
conformation of cis-1,2-dimethylcyclohexane and trans-1,2-dimethylcyclohexane,
and compare their stability.
Answer: - For cis-1,2-dimethylcyclohexane, the most stable con-
formation would be where both methyl groups are equatorial. - For
trans-1,2-dimethylcyclohexane, one methyl group will be axial and
the other equatorial, but upon ring flip, the positions interchange.
Given these considerations, the cis-1,2-dimethylcyclohexane with
both methyl groups in the equatorial position is generally more stable
due to minimized steric strain.
This problem requires understanding the spatial arrangement in
cyclohexane and the effects of substituent positions on stability and
properties of molecules. Question 4: Stereoisomerism in Organic
Compounds
Background: Stereoisomers are molecules that have the same molec-
ular formula and sequence of bonded atoms (constitution), but differ
in the three-dimensional orientations of their atoms in space. This
results in different chemical and physical properties, essential for un-
derstanding biochemical processes. Stereoisomerism is divided into
two main types: enantiomerism and diastereomerism.
—
Question: Design a stereochemistry problem involving cyclohex-
ane. The compound should be 1,2-dimethylcyclohexane. Provide
details on the types of stereoisomers possible for this compound and
ask for their identification and comparison.
—
Solution:
Step 1: Understanding the Structure of Cyclohexane Cyclohexane
is a six-membered ring, and when substituents are added, they can
occupy two distinct positions - axial (projecting outward, parallel to
the axis of the ring) or equatorial (projecting outward, but in the
plane of the ring).
Step 2: Identifying the Positions of the Substituents For 1,2-
dimethylcyclohexane, the two methyl groups are attached to the first
and second carbon atoms of the cyclohexane ring.
Step 3: Understanding the Concept of Stereoisomerism In 1,2-
dimethylcyclohexane, the two methyl groups can either be: - both in
axial positions - both in equatorial positions - one in an axial and one
in an equatorial position
This results in different steric configurations:
1. cis-1,2-dimethylcyclohexane: Both methyl groups are either
above or below the plane of the ring (one axial and one equatorial,
6
on the same side of the ring). 2. trans-1,2-dimethylcyclohexane: One
methyl group is above the plane and one is below the plane of the
ring (one axial and one equatorial, on opposite sides of the ring).
Step 4: Analysis of Stability Generally, substituents in the equa-
torial position are more favorable due to less steric strain and 1,3-
diaxial interactions. Therefore, the stability of these isomers usually
increases with the number of substituents in the equatorial position.
Step 5: Conceptual Question Determine and draw the most stable
conformation of cis-1,2-dimethylcyclohexane and trans-1,2-dimethylcyclohexane,
and compare their stability.
Answer: - For cis-1,2-dimethylcyclohexane, the most stable con-
formation would be where both methyl groups are equatorial. - For
trans-1,2-dimethylcyclohexane, one methyl group will be axial and
the other equatorial, but upon ring flip, the positions interchange.
Given these considerations, the cis-1,2-dimethylcyclohexane with
both methyl groups in the equatorial position is generally more stable
due to minimized steric strain.
This problem requires understanding the spatial arrangement in
cyclohexane and the effects of substituent positions on stability and
properties of molecules.
Question 5
Question: Propose a mechanism for the acid-catalyzed esterifica-
tion of acetic acid (CH3COOH) with ethanol (CH3CH2OH) to form
ethyl acetate (CH3COOCH2CH3) and water.
—
Answer and Step-by-Step Solution:
Step 1: Acid Catalyst Protonation The first step in the mecha-
nism is the protonation of the carbonyl oxygen of acetic acid by the
sulfuric acid catalyst. The oxygen atom in the carbonyl group of
acetic acid has lone pairs which can accept a proton, leading to a
more electrophilic carbonyl carbon.
Equation:
CH3COOH +H+→CH3COOH+
2
Step 2: Nucleophilic Attack The protonated acetic acid now reacts
with ethanol. The lone pair of electrons on the oxygen atom of ethanol
attacks the electrophilic carbonyl carbon of the protonated acetic
acid. This step results in the formation of a tetrahedral intermediate.
Equation:
CH3COOH+
2+CH3CH2OH →CH3COOCH2CH3OH+
Step 3: Departure of Water In this tetrahedral intermediate, the
-OH group present in the intermediate can act as a leaving group.
7
The intermediate eliminates a molecule of water, forming the ester
ethyl acetate.
Equation:
CH3COOCH2CH3OH+→CH3COOCH2CH3+H2O
Step 4: Deprotonation The final step of the reaction involves the
removal of a proton from the ester product, catalyzed by the leftover
acid catalyst, restoring the catalyst and completing the formation of
ethyl acetate.
Equation:
CH3COOCH2CH3+H+→CH3COOCH2CH3
Summary: Through these steps, acetic acid and ethanol under
an acid catalyst undergo esterification to produce ethyl acetate and
water. This reaction is a classic example of an esterification, where
an acid reacts with an alcohol to form an ester and water, facilitated
by an acid catalyst.
Overall Equation:
CH3COOH +CH3CH2OH H+
−−→ CH3COOCH2CH3+H2O
Question 5: Esterification Reaction
Question: Propose a mechanism for the acid-catalyzed esterifica-
tion of acetic acid (CH3COOH) with ethanol (CH3CH2OH) to form
ethyl acetate (CH3COOCH2CH3) and water.
—
Answer and Step-by-Step Solution:
Step 1: Acid Catalyst Protonation The first step in the mecha-
nism is the protonation of the carbonyl oxygen of acetic acid by the
sulfuric acid catalyst. The oxygen atom in the carbonyl group of
acetic acid has lone pairs which can accept a proton, leading to a
more electrophilic carbonyl carbon.
Equation:
CH3COOH +H+→CH3COOH+
2
Step 2: Nucleophilic Attack The protonated acetic acid now reacts
with ethanol. The lone pair of electrons on the oxygen atom of ethanol
attacks the electrophilic carbonyl carbon of the protonated acetic
acid. This step results in the formation of a tetrahedral intermediate.
Equation:
CH3COOH+
2+CH3CH2OH →CH3COOCH2CH3OH+
Step 3: Departure of Water In this tetrahedral intermediate, the
-OH group present in the intermediate can act as a leaving group.
8
The intermediate eliminates a molecule of water, forming the ester
ethyl acetate.
Equation:
CH3COOCH2CH3OH+→CH3COOCH2CH3+H2O
Step 4: Deprotonation The final step of the reaction involves the
removal of a proton from the ester product, catalyzed by the leftover
acid catalyst, restoring the catalyst and completing the formation of
ethyl acetate.
Equation:
CH3COOCH2CH3+H+→CH3COOCH2CH3
Summary: Through these steps, acetic acid and ethanol under
an acid catalyst undergo esterification to produce ethyl acetate and
water. This reaction is a classic example of an esterification, where
an acid reacts with an alcohol to form an ester and water, facilitated
by an acid catalyst.
Overall Equation:
CH3COOH +CH3CH2OH H+
−−→ CH3COOCH2CH3+H2O
Question 6
Problem: Devise a synthesis route for 3-methyl-2-butanol starting
from 2-methylpropene.
Step-by-Step Solution
Step 1: Hydration of 2-methylpropene (tert-butyl alcohol forma-
tion)
- Reaction: 2-methylpropene (CH3C(CH3)=CH2)undergoes acid-
catalyzed hydration. - Mechanism: The double bond of 2-methylpropene
reacts with H2O in the presence of an acid catalyst (e.g., H2SO4). -
Product: tert-Butyl alcohol ((CH3)3COH).
Step 2: Esterification of tert-Butyl alcohol
- Reaction: tert-Butyl alcohol is treated with acetic acid under
acidic conditions to form tert-butyl acetate. - Mechanism: The hy-
droxyl group of tert-Butyl alcohol reacts with the carboxyl group
of acetic acid, eliminating water and forming tert-butyl acetate. -
Product: tert-Butyl acetate ((CH3)3COOCCH3).
Step 3: Grignard Reagent Formation
- Reaction: Methyl magnesium bromide is formed from methyl
bromide and magnesium in dry ether. - Mechanism: Bromine in
methyl bromide interacts with the magnesium atom to form methyl
magnesium bromide. - Product: Methyl magnesium bromide (CH3MgBr).
9
Step 4: Reaction of Methyl magnesium bromide with tert-Butyl
acetate
- Reaction: Methyl magnesium bromide reacts with tert-butyl ac-
etate. - Mechanism: This Grignard reaction involves the nucleophilic
attack of the methyl anion (from methyl magnesium bromide) on the
carbonyl carbon of tert-butyl acetate. - Intermediate: Ketone inter-
mediate (2-methyl-2-pentanone). - Further Reaction: Water is added
to protonate the intermediate, yielding the ketone.
Step 5: Reduction of the Ketone
- Reaction: Reduction of 2-methyl-2-pentanone using sodium boro-
hydride (NaBH4). - Mechanism: The borohydride ion (BH−
4) reduces
the carbonyl group to a hydroxyl group. - Product: 3-methyl-2-
butanol.
This synthesis route demonstrates a process involving hydration,
esterification, formation and use of a Grignard reagent, and reduction,
to synthesize 3-methyl-2-butanol from 2-methylpropene. Question 6:
Synthesis of 3-methyl-2-butanol
Problem: Devise a synthesis route for 3-methyl-2-butanol starting
from 2-methylpropene.
Step-by-Step Solution
Step 1: Hydration of 2-methylpropene (tert-butyl alcohol forma-
tion)
- Reaction: 2-methylpropene (CH3C(CH3)=CH2)undergoes acid-
catalyzed hydration. - Mechanism: The double bond of 2-methylpropene
reacts with H2O in the presence of an acid catalyst (e.g., H2SO4). -
Product: tert-Butyl alcohol ((CH3)3COH).
Step 2: Esterification of tert-Butyl alcohol
- Reaction: tert-Butyl alcohol is treated with acetic acid under
acidic conditions to form tert-butyl acetate. - Mechanism: The hy-
droxyl group of tert-Butyl alcohol reacts with the carboxyl group
of acetic acid, eliminating water and forming tert-butyl acetate. -
Product: tert-Butyl acetate ((CH3)3COOCCH3).
Step 3: Grignard Reagent Formation
- Reaction: Methyl magnesium bromide is formed from methyl
bromide and magnesium in dry ether. - Mechanism: Bromine in
methyl bromide interacts with the magnesium atom to form methyl
magnesium bromide. - Product: Methyl magnesium bromide (CH3MgBr).
Step 4: Reaction of Methyl magnesium bromide with tert-Butyl
acetate
- Reaction: Methyl magnesium bromide reacts with tert-butyl ac-
etate. - Mechanism: This Grignard reaction involves the nucleophilic
attack of the methyl anion (from methyl magnesium bromide) on the
carbonyl carbon of tert-butyl acetate. - Intermediate: Ketone inter-
mediate (2-methyl-2-pentanone). - Further Reaction: Water is added
to protonate the intermediate, yielding the ketone.
Step 5: Reduction of the Ketone
10
- Reaction: Reduction of 2-methyl-2-pentanone using sodium boro-
hydride (NaBH4). - Mechanism: The borohydride ion (BH−
4) reduces
the carbonyl group to a hydroxyl group. - Product: 3-methyl-2-
butanol.
This synthesis route demonstrates a process involving hydration,
esterification, formation and use of a Grignard reagent, and reduction,
to synthesize 3-methyl-2-butanol from 2-methylpropene.
Question 7
Given the alkene 2-methyl-2-butene, predict the product when it
reacts with hydrogen bromide (HBr).
Step-by-Step Solution:
Step 1: Identify the Structure of the Alkene 2-methyl-2-butene
is an alkene, meaning it contains a carbon-carbon double bond. Its
structure can be drawn or visualized as follows: - Carbon chain: CH3-
C(CH3)=C(CH3)-CH3
Step 2: Understand Hydrohalogenation Hydrohalogenation is the
addition of hydrogen halides like HBr to alkenes. This reaction typi-
cally follows Markovnikov’s rule, where the hydrogen atom from the
hydrogen halide forms a bond with the carbon of the double bond that
has the greater number of hydrogen atoms, and the halide (bromine,
in this case) bonds with the other carbon atom.
Step 3: Applying Markovnikov’s Rule - The structure of 2-methyl-
2-butene is symmetrical around the double bond. Therefore, either
carbon of the double bond can add hydrogen or bromine without
an initial preference since both carbons have the same number of
hydrogen atoms. - However, consider the secondary and tertiary
carbon classification: the CH3-C(CH3)=C(CH3)-CH3 has a tertiary
carbon at either carbon of the double bond.
Step 4: Predict the Product Formation - Both carbons of the dou-
ble bond in 2-methyl-2-butene are tertiary. According to Markovnikov’s
rule, bromine (Br) will attach to either carbon (as it doesn’t make
a difference in this overly symmetrical case), breaking the double
bond, while hydrogen (H) will attach to the other. - This leads us to
the same product, no matter at which carbon the hydrogen attaches
because of the symmetry: 2-bromo-2-methylbutane.
Formulate the Molecular Formula of the Product: - Hydrogen
attaches to one of the tertiary carbons, breaking the double bond,
and the bromine attaches to the other tertiary carbon. This results
in the product 2-bromo-2-methylbutane (C5H11Br).
Step 5: Confirm Chirality or Other Stereochemistry (if required)
- Since symmetrical addition to a symmetrical alkene does not lead
to chirality, the product (2-bromo-2-methylbutane) does not have a
chiral center.
11
Conclusion: The reaction of 2-methyl-2-butene with HBr yields 2-
bromo-2-methylbutane following the principles of hydrohalogenation
and Markovnikov’s rule. Question 7: Alkene Reactions - Hydrohalo-
genation
Given the alkene 2-methyl-2-butene, predict the product when it
reacts with hydrogen bromide (HBr).
Step-by-Step Solution:
Step 1: Identify the Structure of the Alkene 2-methyl-2-butene
is an alkene, meaning it contains a carbon-carbon double bond. Its
structure can be drawn or visualized as follows: - Carbon chain: CH3-
C(CH3)=C(CH3)-CH3
Step 2: Understand Hydrohalogenation Hydrohalogenation is the
addition of hydrogen halides like HBr to alkenes. This reaction typi-
cally follows Markovnikov’s rule, where the hydrogen atom from the
hydrogen halide forms a bond with the carbon of the double bond that
has the greater number of hydrogen atoms, and the halide (bromine,
in this case) bonds with the other carbon atom.
Step 3: Applying Markovnikov’s Rule - The structure of 2-methyl-
2-butene is symmetrical around the double bond. Therefore, either
carbon of the double bond can add hydrogen or bromine without
an initial preference since both carbons have the same number of
hydrogen atoms. - However, consider the secondary and tertiary
carbon classification: the CH3-C(CH3)=C(CH3)-CH3 has a tertiary
carbon at either carbon of the double bond.
Step 4: Predict the Product Formation - Both carbons of the dou-
ble bond in 2-methyl-2-butene are tertiary. According to Markovnikov’s
rule, bromine (Br) will attach to either carbon (as it doesn’t make
a difference in this overly symmetrical case), breaking the double
bond, while hydrogen (H) will attach to the other. - This leads us to
the same product, no matter at which carbon the hydrogen attaches
because of the symmetry: 2-bromo-2-methylbutane.
Formulate the Molecular Formula of the Product: - Hydrogen
attaches to one of the tertiary carbons, breaking the double bond,
and the bromine attaches to the other tertiary carbon. This results
in the product 2-bromo-2-methylbutane (C5H11Br).
Step 5: Confirm Chirality or Other Stereochemistry (if required)
- Since symmetrical addition to a symmetrical alkene does not lead
to chirality, the product (2-bromo-2-methylbutane) does not have a
chiral center.
Conclusion: The reaction of 2-methyl-2-butene with HBr yields 2-
bromo-2-methylbutane following the principles of hydrohalogenation
and Markovnikov’s rule.
12
Question 8
Question: What is the outcome of the reaction between benzalde-
hyde (C6H5CHO) and acetophenone (C6H5COCH3) in the presence
of an alkali such as NaOH?
Step-by-Step Solution:
Step 1: Understand the components involved. - Benzaldehyde: An
aromatic aldehyde with the formula C6H5CHO. - Acetophenone: An
aromatic ketone with the formula C6H5COCH3. - NaOH: Sodium
hydroxide, a strong base.
Step 2: Identify the Type of Reaction The reaction between ben-
zaldehyde and acetophenone in basic conditions involves a condensa-
tion process known as an aldol condensation.
Step 3: Mechanism of Aldol Condensation 1. Base Addition: In
the presence of NaOH, the hydroxide ion (OH-) acts as a base and
deprotonates the alpha-hydrogen of acetophenone. This forms an
enolate ion from the acetophenone.
2. Nucleophilic Attack: The enolate ion from acetophenone acts
as a nucleophile and attacks the electrophilic carbonyl carbon of ben-
zaldehyde.
3. Formation of Alcohol: The attack leads to the formation of a
beta-hydroxyketone.
Step 4: Water Elimination 4. Under basic conditions, further
heating causes dehydration of the beta-hydroxyketone, leading to the
formation of an ,-unsaturated ketone.
Step 5: Product Formation 5. The final product from the reaction
between benzaldehyde and acetophenone under aldol condensation
and subsequent dehydration is benzylideneacetophenone (chalcone),
generally represented as C6H5CH=CHCOCH3.
Summary: The reaction between benzaldehyde and acetophenone
in the presence of NaOH leads to the formation of benzylideneace-
tophenone (chalcone) through an aldol condensation followed by a
dehydration reaction. This is an essential reaction in organic synthe-
sis for the formation of chalcone compounds, which are important in
various chemical and pharmacological syntheses. Organic Chemistry
Question for Liberty University - Question 8
Question: What is the outcome of the reaction between benzalde-
hyde (C6H5CHO) and acetophenone (C6H5COCH3) in the presence
of an alkali such as NaOH?
Step-by-Step Solution:
Step 1: Understand the components involved. - Benzaldehyde: An
aromatic aldehyde with the formula C6H5CHO. - Acetophenone: An
aromatic ketone with the formula C6H5COCH3. - NaOH: Sodium
hydroxide, a strong base.
Step 2: Identify the Type of Reaction The reaction between ben-
zaldehyde and acetophenone in basic conditions involves a condensa-
13
tion process known as an aldol condensation.
Step 3: Mechanism of Aldol Condensation 1. Base Addition: In
the presence of NaOH, the hydroxide ion (OH-) acts as a base and
deprotonates the alpha-hydrogen of acetophenone. This forms an
enolate ion from the acetophenone.
2. Nucleophilic Attack: The enolate ion from acetophenone acts
as a nucleophile and attacks the electrophilic carbonyl carbon of ben-
zaldehyde.
3. Formation of Alcohol: The attack leads to the formation of a
beta-hydroxyketone.
Step 4: Water Elimination 4. Under basic conditions, further
heating causes dehydration of the beta-hydroxyketone, leading to the
formation of an ,-unsaturated ketone.
Step 5: Product Formation 5. The final product from the reaction
between benzaldehyde and acetophenone under aldol condensation
and subsequent dehydration is benzylideneacetophenone (chalcone),
generally represented as C6H5CH=CHCOCH3.
Summary: The reaction between benzaldehyde and acetophenone
in the presence of NaOH leads to the formation of benzylideneace-
tophenone (chalcone) through an aldol condensation followed by a
dehydration reaction. This is an essential reaction in organic synthe-
sis for the formation of chalcone compounds, which are important in
various chemical and pharmacological syntheses.
Question 9
How would you distinguish between the structural isomers of bu-
tanol using infrared spectroscopy (IR) and nuclear magnetic reso-
nance (NMR) spectroscopy? Consider the four isomers: 1-butanol,
2-butanol, iso-butanol, and tert-butanol.
—
Answer and Explanation:
Step 1: Understanding the Structure of Isomers - 1-butanol: A
straight-chain primary alcohol (CHCHCHCHOH). - 2-butanol: A
secondary alcohol where the -OH group is on the second carbon of the
straight chain (CHCH(OH)CHCH). - iso-butanol (isobutanol): An-
other form of a secondary alcohol, but arranged differently (CH)CHCHOH.
- tert-butanol: A tertiary alcohol, with the -OH group attached to a
carbon that itself is connected to three other carbons (C(CH)OH).
Step 2: Using Infrared Spectroscopy (IR) - OH Stretch: All iso-
mers show a broad O-H stretch typically around 3200-3600 cm−1, indicatingthepresenceofanalcoholgroup.−
C−HandC−OStretches :−1−butanoland2−butanol :T hesewillshowsimilarstretchesforC−
Haround2900cm−1andC−Oaround1050−1150cm−1.−iso−butanol :SimilarC−
Hstretch, possibleslightshif tsinC −Ostretchduetodif ferentenvironment. −
tert−butanol :Duetosterichindrancearoundthetertiarycarbon, tert−butanolmighthaveslightshiftsorvariationsintheintensityof peaks.
14
Step 3: Using Nuclear Magnetic Resonance (NMR) Spectroscopy
- 1-butanol: - 1H NMR: A triplet for the -CHOH group, quartet for
the -CH- next to -OH, and multiplets for other methylene groups. -
13C NMR: Four distinct peaks for each type of carbon. - 2-butanol:
- 1H NMR: A singlet for the -OH, a quartet for the -CH(OH)-, and
triplets/multiplets for other -CH and -CH groups. - 13C NMR: Dis-
tinct peaks for the carbon bearing the OH, separate from the other
carbons. - iso-butanol: - 1H NMR: Similar to 2-butanol but different
splitting due to branching. - 13C NMR: Unique peak for the carbon
bearing OH; three other carbons showing varying environments. -
tert-butanol: - 1H NMR: All nine hydrogens appear as a singlet due
to the symmetric environment of the tert-butyl group. - 13C NMR:
Only one prominent carbon signal for the tertiary carbon, distinct
from signals seen in other alcohols.
Step 4: Distinguishing Based on Spectroscopic Data - IR Spec-
troscopy: OH group identification is similar across all; look for subtle
differences in C-H and C-O stretches. - NMR Spectroscopy: Provides
clear differentiation based on the environment around the OH group
and the number and type of hydrogen environments: - 1-butanol:
Complex splitting patterns in 1H NMR. - 2-butanol: Clear secondary
alcohol indication with quartet for CH(OH). - iso-butanol: Secondary,
but different pattern from 2-butanol. - tert-butanol: Simplest spectra
with fewer signals.
Conclusion: Careful analysis of NMR is most effective for distin-
guishing these isomers due to variations in carbon and hydrogen en-
vironments directly reflected in the spectra. IR can corroborate the
presence of alcohol but is less definitive for differentiating isomers
unless combined with NMR data.Question 9: Isomer Identification
in Butanol
How would you distinguish between the structural isomers of bu-
tanol using infrared spectroscopy (IR) and nuclear magnetic reso-
nance (NMR) spectroscopy? Consider the four isomers: 1-butanol,
2-butanol, iso-butanol, and tert-butanol.
—
Answer and Explanation:
Step 1: Understanding the Structure of Isomers - 1-butanol: A
straight-chain primary alcohol (CHCHCHCHOH). - 2-butanol: A
secondary alcohol where the -OH group is on the second carbon of the
straight chain (CHCH(OH)CHCH). - iso-butanol (isobutanol): An-
other form of a secondary alcohol, but arranged differently (CH)CHCHOH.
- tert-butanol: A tertiary alcohol, with the -OH group attached to a
carbon that itself is connected to three other carbons (C(CH)OH).
Step 2: Using Infrared Spectroscopy (IR) - OH Stretch: All iso-
mers show a broad O-H stretch typically around 3200-3600 cm−1, indicatingthepresenceofanalcoholgroup.−
C−HandC−OStretches :−1−butanoland2−butanol :T hesewillshowsimilarstretchesforC−
Haround2900cm−1andC−Oaround1050−1150cm−1.−iso−butanol :SimilarC−
15
Hstretch, possibleslightshif tsinC −Ostretchduetodif ferentenvironment. −
tert−butanol :Duetosterichindrancearoundthetertiarycarbon, tert−butanolmighthaveslightshiftsorvariationsintheintensityof peaks.
Step 3: Using Nuclear Magnetic Resonance (NMR) Spectroscopy
- 1-butanol: - 1H NMR: A triplet for the -CHOH group, quartet for
the -CH- next to -OH, and multiplets for other methylene groups. -
13C NMR: Four distinct peaks for each type of carbon. - 2-butanol:
- 1H NMR: A singlet for the -OH, a quartet for the -CH(OH)-, and
triplets/multiplets for other -CH and -CH groups. - 13C NMR: Dis-
tinct peaks for the carbon bearing the OH, separate from the other
carbons. - iso-butanol: - 1H NMR: Similar to 2-butanol but different
splitting due to branching. - 13C NMR: Unique peak for the carbon
bearing OH; three other carbons showing varying environments. -
tert-butanol: - 1H NMR: All nine hydrogens appear as a singlet due
to the symmetric environment of the tert-butyl group. - 13C NMR:
Only one prominent carbon signal for the tertiary carbon, distinct
from signals seen in other alcohols.
Step 4: Distinguishing Based on Spectroscopic Data - IR Spec-
troscopy: OH group identification is similar across all; look for subtle
differences in C-H and C-O stretches. - NMR Spectroscopy: Provides
clear differentiation based on the environment around the OH group
and the number and type of hydrogen environments: - 1-butanol:
Complex splitting patterns in 1H NMR. - 2-butanol: Clear secondary
alcohol indication with quartet for CH(OH). - iso-butanol: Secondary,
but different pattern from 2-butanol. - tert-butanol: Simplest spectra
with fewer signals.
Conclusion: Careful analysis of NMR is most effective for distin-
guishing these isomers due to variations in carbon and hydrogen en-
vironments directly reflected in the spectra. IR can corroborate the
presence of alcohol but is less definitive for differentiating isomers
unless combined with NMR data.
Question 10
A student at Liberty University is learning about nucleophilic sub-
stitution reactions in their Organic Chemistry course. Given the
molecules below, predict which will primarily undergo an SN1 reac-
tion and which will primarily undergo an SN2 reaction. Explain why
based on the structure of the molecule.
Molecules: 1. 2-bromo-2-methylpropane 2. 1-bromobutane
Provide the major product for each reaction type.
—
Step-by-Step Solution
Part A: Determining Reaction Types
1. 2-bromo-2-methylpropane:
16
- Structure: This molecule is a tertiary alkyl halide. - Reaction
Type: Tertiary alkyl halides like 2-bromo-2-methylpropane primarily
undergo SN1 reactions. This is because the carbon atom bonded to
the halide (bromine here) is surrounded by three alkyl groups, which
can stabilize the carbocation intermediate formed during the reaction
through inductive effect and hyperconjugation.
2. 1-bromobutane:
- Structure: This molecule is a primary alkyl halide. - Reaction
Type: Primary alkyl halides like 1-bromobutane primarily undergo
SN2 reactions. This is because the carbon atom bonded to the halide
(bromine here) is only attached to one alkyl group, offering little
steric hindrance to the attacking nucleophile. Also, primary alkyl
halides do not form stable carbocations needed for SN1 reactions.
Part B: Reaction Products
1. 2-bromo-2-methylpropane (SN1 Reaction):
Mechanism:
- Step 1: The leaving group (bromide ion, Br) departs, forming
a carbocation. The carbon attached to the Br becomes a positively
charged carbocation. - Step 2: A nucleophile (e.g., water in a solvol-
ysis reaction) attacks the carbocation.
Major Product:
- The major product would be 2-methyl-2-propanol if water acts as
the nucleophiles. This involves nucleophilic attack on the carbocation
followed by deprotonation.
2. 1-bromobutane (SN2 Reaction):
Mechanism:
- A single step mechanism where the nucleophile attacks the car-
bon bonded to bromine from the opposite side of the leaving group,
leading to inversion of configuration.
Major Product:
- Assuming the nucleophile is hydroxide (OH), the major product
will be 1-butanol. The OH attacks from the opposite side of the Br
departure, leading to an inversion of stereochemistry and forming the
alcohol.
Conclusion
Through understanding the structure and stability of intermedi-
ates (carbocations for SN1 and steric hindrance for SN2), students
at Liberty University can predict the type of nucleophilic substitu-
tion reaction that an alkyl halide will undergo, as well as the major
products formed in these reactions.Question 10: Understanding SN1
and SN2 Reactions
A student at Liberty University is learning about nucleophilic sub-
stitution reactions in their Organic Chemistry course. Given the
molecules below, predict which will primarily undergo an SN1 reac-
tion and which will primarily undergo an SN2 reaction. Explain why
based on the structure of the molecule.
17
Molecules: 1. 2-bromo-2-methylpropane 2. 1-bromobutane
Provide the major product for each reaction type.
—
Step-by-Step Solution
Part A: Determining Reaction Types
1. 2-bromo-2-methylpropane:
- Structure: This molecule is a tertiary alkyl halide. - Reaction
Type: Tertiary alkyl halides like 2-bromo-2-methylpropane primarily
undergo SN1 reactions. This is because the carbon atom bonded to
the halide (bromine here) is surrounded by three alkyl groups, which
can stabilize the carbocation intermediate formed during the reaction
through inductive effect and hyperconjugation.
2. 1-bromobutane:
- Structure: This molecule is a primary alkyl halide. - Reaction
Type: Primary alkyl halides like 1-bromobutane primarily undergo
SN2 reactions. This is because the carbon atom bonded to the halide
(bromine here) is only attached to one alkyl group, offering little
steric hindrance to the attacking nucleophile. Also, primary alkyl
halides do not form stable carbocations needed for SN1 reactions.
Part B: Reaction Products
1. 2-bromo-2-methylpropane (SN1 Reaction):
Mechanism:
- Step 1: The leaving group (bromide ion, Br) departs, forming
a carbocation. The carbon attached to the Br becomes a positively
charged carbocation. - Step 2: A nucleophile (e.g., water in a solvol-
ysis reaction) attacks the carbocation.
Major Product:
- The major product would be 2-methyl-2-propanol if water acts as
the nucleophiles. This involves nucleophilic attack on the carbocation
followed by deprotonation.
2. 1-bromobutane (SN2 Reaction):
Mechanism:
- A single step mechanism where the nucleophile attacks the car-
bon bonded to bromine from the opposite side of the leaving group,
leading to inversion of configuration.
Major Product:
- Assuming the nucleophile is hydroxide (OH), the major product
will be 1-butanol. The OH attacks from the opposite side of the Br
departure, leading to an inversion of stereochemistry and forming the
alcohol.
Conclusion
Through understanding the structure and stability of intermedi-
ates (carbocations for SN1 and steric hindrance for SN2), students
at Liberty University can predict the type of nucleophilic substitu-
tion reaction that an alkyl halide will undergo, as well as the major
products formed in these reactions.
18
