Homework needs to be completed by tomorrow (3pm EST)

PrincessT

organic_chemistry_1.ppt

Home >Chemistry homework help >Homework needs to be completed by tomorrow (3pm EST)

Solomons 12e Clicker Questions

Chapter 1

Section: 1.4

1) Which of the following is the best Lewis Structure for the IO4– ion?

Section: 1.5

2) What is the formal charge of nitrogen in the following structure?

a) +2
b) +1
c) 0
d) -1

e) -2

Section: 1.5

3) What is the formal charge of oxygen in the following structure?

a) +2
b) +1
c) 0
d) -1

e) -2

4) Which of the following are correct resonance structures of structure I?

a) A and B
b) B, C, and D
c) A, B, and D
d) all of these choices

e) none of these choices

Section: 1.8

5) What is the best resonance structure for structure I?

a) A
b) B
c) C
d) D

Section: 1.12-1.14

6) What is the hybridization of the indicated atom in the following structure?

a) sp3
b) sp2
c) sp
d) sp2d2

e) none of these choices

Section: 1.12-1.14

7) What is the hybridization of the indicated atom in the following structure?

a) sp3
b) sp2
c) sp
d) sp2d2

e) none of these choices

Section: 1.12-1.14

8) What is the correct molecular orbital diagram for the following structure?

a)
b)
c)
d)

Section: 1.12-1.14

9) What is the hybridization of the indicated atom in the following structure?

a) sp3
b) sp2
c) sp
d) sp2d2

e) none of these choices

Section: 1.12-1.14

10) What is the hybridization of the indicated atom in the following structure?

a) sp3
b) sp2
c) sp
d) sp2d2

e) none of these choices

Section: 1.4, 1.7

11) Which of the following is the best, correct Lewis Structure for CH2C(CH3)CH2CH3?

Section: 1.7

12) Which of the choices is equivalent to CH3CH2CH(OH)CH2CH3?

b) C5H11O

Section: 1.7

13) Which is the correct bond-line formula for the following structure?

Section: 1.7

14) Which is the correct condensed formula for the following structure?

a) CH3CH2CH(OH)CHCH2CH3
b) CH3CH2CH(OH)CH(CH2CH3)2
c) CH3CH2(OH)CH(CH2CH3)CH3
d) CH3CH2CH2(OH)CH(CH2CH3)CH2CH3