|
1. Calculate the enthalpy for the following reaction:
N2(g)+2O2(g)2NO2 (g) H=???kJ
Using the following two equations:
N2(g)+O2(g)2NO(g) H = +180kJ
2NO2 (g)2NO(g)+O2(g) H = +112kJ
2. Calculate Ho for this reaction:
2N2 (g)+5O2 (g)2N2O5(g)
using the following three equations:
H2 (g)+(1/2) O2 (g)H2O(l) H = -285.8kJ
N2O5(g)+H2O(l)2HNO3(l) H = -76.6kJ
(1/2)N2 (g)+(3/2)O2 (g)+(1/2)H2(g)HNO3(l) H = - 174.1kJ
3. Calculate Hf for this reaction:
6C(s)+6H2(g)+3O2(g)C6H12O6(s)
using the following three equations:
C(s)+O2(g)CO2 (g) H= -393.51 kJ
H2(g)+(1/2)O2(g)H2O(l) H= -285.83 kJ
C6H12O6(s)+6O2 (g)6CO2 (g)+6H2O(l) H= -2803.02 kJ
4. Given the following reactions and their enthalpy changes, calculate the enthalpy change for
2NO2(g)N2O4(g)
N2(g)+2O2(g)2NO2 (g) +67.8kJ
N2(g)+2O2(g)N2O4(g) +9.67kJ
5. Use the thermochemical equations shown below to determine the enthalpy for the reaction:
C2H6O(l)+3O2(g)2CO2(g)+3H2O(l)
2C2H4O(l)+2H2O(l)2C2H6O(l)+O2(g) H= +203.5kJ
2CO2 (g)+2H2O(l)C2H4O(l)+5/2O2(g) H= +583.5kJ
|